IT1106846B - Lampadina ad incandescenza con specchio termico trasparente di tipo etalon - Google Patents
Lampadina ad incandescenza con specchio termico trasparente di tipo etalonInfo
- Publication number
- IT1106846B IT1106846B IT52426/78A IT5242678A IT1106846B IT 1106846 B IT1106846 B IT 1106846B IT 52426/78 A IT52426/78 A IT 52426/78A IT 5242678 A IT5242678 A IT 5242678A IT 1106846 B IT1106846 B IT 1106846B
- Authority
- IT
- Italy
- Prior art keywords
- incandescent bulb
- type transparent
- transparent thermal
- etalon type
- thermal mirror
- Prior art date
Links
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01K—ELECTRIC INCANDESCENT LAMPS
- H01K1/00—Details
- H01K1/28—Envelopes; Vessels
- H01K1/32—Envelopes; Vessels provided with coatings on the walls; Vessels or coatings thereon characterised by the material thereof
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US86315577A | 1977-12-22 | 1977-12-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IT7852426A0 IT7852426A0 (it) | 1978-12-22 |
| IT1106846B true IT1106846B (it) | 1985-11-18 |
Family
ID=25340406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT52426/78A IT1106846B (it) | 1977-12-22 | 1978-12-22 | Lampadina ad incandescenza con specchio termico trasparente di tipo etalon |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS55500031A (show.php) |
| AU (1) | AU526737B2 (show.php) |
| CA (1) | CA1131688A (show.php) |
| CH (1) | CH627301A5 (show.php) |
| FR (1) | FR2412941A1 (show.php) |
| GB (1) | GB2036422B (show.php) |
| IT (1) | IT1106846B (show.php) |
| SE (1) | SE7906932L (show.php) |
| WO (1) | WO1979000424A1 (show.php) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5958753A (ja) * | 1982-09-28 | 1984-04-04 | 株式会社東芝 | 白熱電球 |
| KR890004640B1 (ko) * | 1984-09-28 | 1989-11-21 | 가부시끼 가이샤 도시바 | 광확산코우팅 및 그 형성방법과 코우팅한 램프 |
| US5276763A (en) * | 1990-07-09 | 1994-01-04 | Heraeus Quarzglas Gmbh | Infrared radiator with protected reflective coating and method for manufacturing same |
| US5660462A (en) * | 1994-09-13 | 1997-08-26 | Osram Sylvania Inc. | High efficiency vehicle headlights and reflector lamps |
| DE102004016954A1 (de) * | 2004-04-06 | 2005-10-27 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Reflektorlampe mit Halogenfüllung |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3188513A (en) * | 1963-04-10 | 1965-06-08 | Gen Electric | Optical filters and lamps embodying the same |
| FR1389295A (fr) * | 1963-04-10 | 1965-02-12 | Lampes Sa | Filtres optiques et lampes comprenant de tels filtres |
| US3682528A (en) * | 1970-09-10 | 1972-08-08 | Optical Coating Laboratory Inc | Infra-red interference filter |
| NL7405071A (nl) * | 1974-04-16 | 1975-10-20 | Philips Nv | Gloeilamp met infrarood filter. |
-
1978
- 1978-12-22 AU AU42858/78A patent/AU526737B2/en not_active Expired
- 1978-12-22 JP JP50026678A patent/JPS55500031A/ja active Pending
- 1978-12-22 FR FR7836110A patent/FR2412941A1/fr active Granted
- 1978-12-22 CA CA318,534A patent/CA1131688A/en not_active Expired
- 1978-12-22 IT IT52426/78A patent/IT1106846B/it active
- 1978-12-22 GB GB7927498A patent/GB2036422B/en not_active Expired
- 1978-12-22 CH CH784779A patent/CH627301A5/de not_active IP Right Cessation
- 1978-12-22 WO PCT/US1978/000245 patent/WO1979000424A1/en not_active Ceased
-
1979
- 1979-08-20 SE SE7906932A patent/SE7906932L/ unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT7852426A0 (it) | 1978-12-22 |
| FR2412941A1 (fr) | 1979-07-20 |
| GB2036422B (en) | 1982-07-07 |
| SE7906932L (sv) | 1979-08-20 |
| WO1979000424A1 (en) | 1979-07-12 |
| CA1131688A (en) | 1982-09-14 |
| FR2412941B1 (show.php) | 1984-04-20 |
| AU526737B2 (en) | 1983-01-27 |
| AU4285878A (en) | 1979-06-28 |
| CH627301A5 (show.php) | 1981-12-31 |
| GB2036422A (en) | 1980-06-25 |
| JPS55500031A (show.php) | 1980-01-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT1102120B (it) | Sorgente di luce incandescente con specchio termico trasparente | |
| AT358659B (de) | Biegsame gluehlampenreihe | |
| NL7811796A (nl) | Lichtreflector. | |
| NL7802314A (nl) | Kaarslicht. | |
| NL7800886A (nl) | Tegen hoge temperatuur bestendige, ingekapselde, electrisch lichtende lamp. | |
| NL7607038A (nl) | Elektrische gloeilamp. | |
| NL184651C (nl) | Elektrische gloeilamp. | |
| NL7802242A (nl) | Gloeilamphouder met bescherming tegen overmatige temperatuur. | |
| BR7707129A (pt) | Filtro permeavel a luz,refletor de radiacao termica e lampada eletrica dotada de um filtro deste tipo | |
| NL179100C (nl) | Elektrische gloeilamp. | |
| DK436177A (da) | Laserreflektor | |
| IT1106846B (it) | Lampadina ad incandescenza con specchio termico trasparente di tipo etalon | |
| IT7830682A0 (it) | Apparecchio per illuminazione elettrica. | |
| DK577576A (da) | Tabsfri spejlende reflektor | |
| NL7610860A (nl) | Hulsloze elektrische gloeilamp. | |
| NL7400762A (nl) | Electrische gloeilamp. | |
| NL7400763A (nl) | Electrische gloeilamp. | |
| IT1091217B (it) | Lampadina alogena ad incandescenza con riflettore | |
| JPS52111288A (en) | Reflector type light focusing bulb | |
| NL7700150A (nl) | Halogeen gloeilamp. | |
| NL7704774A (nl) | Elektrische gloeilamp. | |
| NL7704182A (nl) | Elektrische gloeilamp. | |
| IT1085041B (it) | Lampadina elettrica | |
| NL185740C (nl) | Elektrische gloeilamp. | |
| NL7805958A (nl) | Elektrische gloeilamp. |