IT1081809B - Idrazono cefalosporine - Google Patents
Idrazono cefalosporineInfo
- Publication number
- IT1081809B IT1081809B IT24436/77A IT2443677A IT1081809B IT 1081809 B IT1081809 B IT 1081809B IT 24436/77 A IT24436/77 A IT 24436/77A IT 2443677 A IT2443677 A IT 2443677A IT 1081809 B IT1081809 B IT 1081809B
- Authority
- IT
- Italy
- Prior art keywords
- hydraze
- cephalosporine
- hydraze cephalosporine
- Prior art date
Links
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/72—Hydrazones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT24436/77A IT1081809B (it) | 1977-06-07 | 1977-06-07 | Idrazono cefalosporine |
| GB7826322A GB2000139B (en) | 1977-06-07 | 1978-06-05 | Hydrazono derivatives of cephalosporins |
| US05/913,475 US4178444A (en) | 1977-06-07 | 1978-06-07 | Hydrazono derivatives of cephalosporins |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT24436/77A IT1081809B (it) | 1977-06-07 | 1977-06-07 | Idrazono cefalosporine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT1081809B true IT1081809B (it) | 1985-05-21 |
Family
ID=11213512
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT24436/77A IT1081809B (it) | 1977-06-07 | 1977-06-07 | Idrazono cefalosporine |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4178444A (it) |
| GB (1) | GB2000139B (it) |
| IT (1) | IT1081809B (it) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2818263A1 (de) * | 1978-04-26 | 1979-11-08 | Bayer Ag | Beta-lactamantibiotika |
| IT1211080B (it) * | 1981-07-21 | 1989-09-29 | Craf Sud | Idrazonocefem derivati biologicamente attivi. |
| CA2505150A1 (en) * | 2002-12-02 | 2004-06-17 | Applied Research Systems Ars Holding N.V. | Aza-peptides |
| US7712724B2 (en) * | 2007-06-21 | 2010-05-11 | Tac, Llc | Dynamic ball valve sealing device for three-way valves |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3971778A (en) * | 1972-05-12 | 1976-07-27 | Glaxo Laboratories Limited | Cephalosporins having (α-etherified oximino)acylamido groups at the 7-position |
| FR2265391B1 (it) * | 1974-04-02 | 1978-11-03 | Isf Spa |
-
1977
- 1977-06-07 IT IT24436/77A patent/IT1081809B/it active
-
1978
- 1978-06-05 GB GB7826322A patent/GB2000139B/en not_active Expired
- 1978-06-07 US US05/913,475 patent/US4178444A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB2000139A (en) | 1979-01-04 |
| US4178444A (en) | 1979-12-11 |
| GB2000139B (en) | 1982-05-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT1097838B (it) | Composti fotocromici | |
| FI780566A7 (fi) | Kinazolin-foereningar | |
| SE7803062L (sv) | Alkylperfluoro-epsilon-fluoroformylestrar | |
| ATA784877A (de) | Hoergeraet | |
| BE857403A (fr) | Reacteur-echangeur | |
| DK563182A (da) | Portal-krananordning | |
| IT1109264B (it) | 3-ammino-pirazoli sostituiti | |
| SE7811945L (sv) | Omrorarkulkvarn | |
| BE872389A (nl) | Bismuthrijke pyrochloor-type verbindingen | |
| AT376049B (de) | Zielverfolger | |
| SE7803334L (sv) | Hammarkross | |
| AT361057B (de) | Stereomikrophonanordnung | |
| FI783119A7 (fi) | Hoegeffektiv skruvextruder foer plastmaterial | |
| FI781736A7 (fi) | Lagerutrymme foer bulkmaterial | |
| BE865477A (fr) | Waarschuwingssysteem | |
| BE855216A (fr) | Grondbewerkingsmachine | |
| ATA909778A (de) | Menstrualtampon | |
| ATA28778A (de) | Haarschneidemaschine | |
| FI783618A7 (fi) | Oximester | |
| BE5T2 (fr) | Wasmiddelrn | |
| FI783554A7 (fi) | Katodstraoleroer | |
| NO149405C (no) | Krafttilfoerselsanordning | |
| DK60678A (da) | 1-oxadethiacephamforbindelser | |
| IT1097816B (it) | Composti beta-lattamici | |
| DK574378A (da) | Termoomskifter |