IL60919A - 7beta-(2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetylamino)-3-cephem-4-carboxylic acid compounds,their manufacture and pharmaceutical compositions containing them - Google Patents
7beta-(2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetylamino)-3-cephem-4-carboxylic acid compounds,their manufacture and pharmaceutical compositions containing themInfo
- Publication number
- IL60919A IL60919A IL60919A IL6091980A IL60919A IL 60919 A IL60919 A IL 60919A IL 60919 A IL60919 A IL 60919A IL 6091980 A IL6091980 A IL 6091980A IL 60919 A IL60919 A IL 60919A
- Authority
- IL
- Israel
- Prior art keywords
- hydroxyiminoacetylamino
- 7beta
- cephem
- thiadiazol
- amino
- Prior art date
Links
- ANHOYYXNUWWHOU-MLUIRONXSA-N (6R,7R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class NC1=NC(=NS1)C(C(=O)N[C@H]1[C@@H]2N(C(=CCS2)C(=O)O)C1=O)=NO ANHOYYXNUWWHOU-MLUIRONXSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/08—1,2,4-Thiadiazoles; Hydrogenated 1,2,4-thiadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH779879 | 1979-08-28 | ||
| CH514480 | 1980-07-04 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL60919A0 IL60919A0 (en) | 1980-10-26 |
| IL60919A true IL60919A (en) | 1984-03-30 |
Family
ID=25697080
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL60919A IL60919A (en) | 1979-08-28 | 1980-08-26 | 7beta-(2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetylamino)-3-cephem-4-carboxylic acid compounds,their manufacture and pharmaceutical compositions containing them |
Country Status (13)
| Country | Link |
|---|---|
| EP (1) | EP0025017A1 (en) |
| AR (1) | AR227218A1 (en) |
| AU (1) | AU6179480A (en) |
| DD (1) | DD152788A5 (en) |
| DK (1) | DK365980A (en) |
| ES (1) | ES8106531A1 (en) |
| FI (1) | FI802673A7 (en) |
| GR (1) | GR69830B (en) |
| IL (1) | IL60919A (en) |
| NO (1) | NO802532L (en) |
| NZ (1) | NZ194784A (en) |
| PH (1) | PH16618A (en) |
| PT (1) | PT71747B (en) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GR75644B (en) * | 1980-06-18 | 1984-08-02 | Fujisawa Pharmaceutical Co | |
| GR78245B (en) * | 1980-09-12 | 1984-09-26 | Ciba Geigy Ag | |
| US4431642A (en) * | 1980-12-01 | 1984-02-14 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| GR76342B (en) * | 1981-02-02 | 1984-08-06 | Fujisawa Pharmaceutical Co | |
| EP0062321B1 (en) * | 1981-04-03 | 1989-03-01 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds, processes for their preparation, pharmaceutical compositions containing them and their starting compounds |
| US4521413A (en) * | 1981-09-14 | 1985-06-04 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| DE3300593A1 (en) * | 1983-01-11 | 1984-07-12 | Bayer Ag, 5090 Leverkusen | NEW CEPHALOSPORINE AND METHOD FOR THEIR PRODUCTION |
| CA1276929C (en) * | 1984-04-09 | 1990-11-27 | Masahisa Oka | Cephalosporin antibacterial agents |
| JPH0653739B2 (en) * | 1984-11-15 | 1994-07-20 | 協和醗酵工業株式会社 | 3-position substituted carbacephem compound |
| AR029004A1 (en) * | 1999-09-22 | 2003-06-04 | Essential Therapeutics Inc | ACID COMPOUND 7-ACILAMINO-3-HETEROARILTIO-3-CEBOEM CARBOXILICO AND ITS USE FOR THE PREPARATION OF AN ANTIBACTERIAL COMPOSITION |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1592149A (en) * | 1976-10-08 | 1981-07-01 | Fujisawa Pharmaceutical Co | 3 7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for preparation thereof |
| PH17188A (en) * | 1977-03-14 | 1984-06-14 | Fujisawa Pharmaceutical Co | New cephem and cepham compounds and their pharmaceutical compositions and method of use |
| US4268509A (en) * | 1978-07-10 | 1981-05-19 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds and processes for preparation thereof |
| AU536842B2 (en) * | 1978-12-29 | 1984-05-24 | Fujisawa Pharmaceutical Co., Ltd. | Cephalosporin antibiotics |
-
1980
- 1980-08-22 EP EP80810261A patent/EP0025017A1/en not_active Withdrawn
- 1980-08-25 FI FI802673A patent/FI802673A7/en not_active Application Discontinuation
- 1980-08-26 IL IL60919A patent/IL60919A/en unknown
- 1980-08-26 GR GR62750A patent/GR69830B/el unknown
- 1980-08-27 DD DD80223551A patent/DD152788A5/en unknown
- 1980-08-27 PH PH24499A patent/PH16618A/en unknown
- 1980-08-27 AU AU61794/80A patent/AU6179480A/en not_active Abandoned
- 1980-08-27 PT PT71747A patent/PT71747B/en unknown
- 1980-08-27 DK DK365980A patent/DK365980A/en not_active Application Discontinuation
- 1980-08-27 NO NO802532A patent/NO802532L/en unknown
- 1980-08-27 NZ NZ194784A patent/NZ194784A/en unknown
- 1980-08-27 ES ES494538A patent/ES8106531A1/en not_active Expired
-
1981
- 1981-12-28 AR AR287963A patent/AR227218A1/en active
Also Published As
| Publication number | Publication date |
|---|---|
| NZ194784A (en) | 1982-12-21 |
| DK365980A (en) | 1981-03-01 |
| GR69830B (en) | 1982-07-19 |
| PT71747B (en) | 1981-06-08 |
| DD152788A5 (en) | 1981-12-09 |
| AU6179480A (en) | 1981-03-05 |
| NO802532L (en) | 1981-03-02 |
| AR227218A1 (en) | 1982-09-30 |
| ES494538A0 (en) | 1981-08-16 |
| ES8106531A1 (en) | 1981-08-16 |
| FI802673A7 (en) | 1981-01-01 |
| EP0025017A1 (en) | 1981-03-11 |
| IL60919A0 (en) | 1980-10-26 |
| PH16618A (en) | 1983-11-28 |
| PT71747A (en) | 1980-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3070286D1 (en) | 7-acylamino-3-substituted cephalosporanic acid derivatives, processes for their preparation and pharmaceutical compositions containing them | |
| IL68618A0 (en) | Heterocyclic compounds,their manufacture and pharmaceutical compositions containing them | |
| IL59203A0 (en) | Lactam compounds and their salts,their production and pharmaceutical compositions containing them | |
| DE2967410D1 (en) | Cephem and cepham compounds, processes for their preparation, pharmaceutical compositions containing them | |
| DE2966913D1 (en) | Cephem compounds, processes for their preparation and pharmaceutical compositions containing them | |
| DE2966293D1 (en) | Cephem compounds, processes for their preparation and pharmaceutical compositions containing them | |
| IL63790A0 (en) | 3-cephem-4-carboxylic acid compounds,their manufacture and pharmaceutical compositions containing them | |
| IL72471A (en) | Pharmaceutical compositions containing 2-(hetero)aryl-quinoline-4-carboxylic acid and derivatives thereof,certain such novel compounds and their preparation | |
| IL68323A (en) | Alkanoyl-3-(substituted alkoxy)-phenoxyalkylcarboxylic acid derivatives,their manufacture and pharmaceutical compositions containing them | |
| DE3069560D1 (en) | Cephem compounds, processes for their preparation and pharmaceutical compositions containing them | |
| IL60919A (en) | 7beta-(2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetylamino)-3-cephem-4-carboxylic acid compounds,their manufacture and pharmaceutical compositions containing them | |
| DE3069364D1 (en) | Cephem compounds, processes for their preparation and pharmaceutical compositions containing them | |
| ZA805666B (en) | Pharmaceutical compositions containing paracetamol | |
| IL78301A (en) | 7-beta-(2-(2-amino-4-thiazolyl)-2-alkenoylamino)-3-cephem-4-carboxylic acid esters,processes for the preparation thereof and anti-bacterial compositions containing the same | |
| AU533471B2 (en) | Pharmaceutical composition comprising modified polyriboinosinic-polyribocytidylic acid | |
| IL60025A (en) | Process for the preparation of 1,3,7-tri substituted xanthines and certain new such xanthines and pharmaceutical compositions containing them | |
| IL63531A (en) | 7-beta-(alpha-syn-methoxyiminoalpha-2(2-aminothiazol-4-yl)-acetamido)-3-((1,2,3-thiadiazol-5-ylthio)methyl)-3-cephem-4-carboxylic acids,their preparation and pharmaceutical compositions comprising them | |
| ZA803795B (en) | Substituted alkyloximes derived from 7-(2-amino-4-thiazolyl)-acetamido- cephalosporanic acid, their preparation, their use as medicaments and the compositions containing them | |
| IL68015A0 (en) | Fungicidal compositions containing 2-cyano-3-amino-2-propenoic acid derivatives,certain such novel compounds and their preparation | |
| IL60813A0 (en) | Heterocyclic compounds, their preparation and pharmaceutical compositions containing them | |
| DE3064666D1 (en) | Pharmaceutical compositions containing paracetamol | |
| GB2055042B (en) | Pharmaceutical compositions containing substituted biruets compound | |
| IL59257A0 (en) | -lactam compounds and salts thereof,their production and pharmaceutical compositions containing them | |
| GB2055043B (en) | Pharmaceutical compositions containing substituted biuret compounds | |
| IL60600A (en) | Pharmaceutical compositions comprising certain azolylalkenol compounds |