IL54784A - Rifamycin compounds - Google Patents
Rifamycin compoundsInfo
- Publication number
- IL54784A IL54784A IL54784A IL5478478A IL54784A IL 54784 A IL54784 A IL 54784A IL 54784 A IL54784 A IL 54784A IL 5478478 A IL5478478 A IL 5478478A IL 54784 A IL54784 A IL 54784A
- Authority
- IL
- Israel
- Prior art keywords
- rifamycin compounds
- rifamycin
- compounds
- Prior art date
Links
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical class OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL54784A IL54784A (en) | 1976-06-01 | 1978-05-25 | Rifamycin compounds |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL7649701A IL49701A (en) | 1975-06-13 | 1976-06-01 | 3-amino-4-deoxo-4-imino rifamycin derivatives and their preparation |
| IL54784A IL54784A (en) | 1976-06-01 | 1978-05-25 | Rifamycin compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL54784A true IL54784A (en) | 1981-05-20 |
Family
ID=26320564
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL54784A IL54784A (en) | 1976-06-01 | 1978-05-25 | Rifamycin compounds |
Country Status (1)
| Country | Link |
|---|---|
| IL (1) | IL54784A (en) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9134329B2 (en) | 2012-08-30 | 2015-09-15 | The Texas A&M University System | Compositions and methods for drug-sensitization or inhibition of a cancer cell |
-
1978
- 1978-05-25 IL IL54784A patent/IL54784A/en unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9134329B2 (en) | 2012-08-30 | 2015-09-15 | The Texas A&M University System | Compositions and methods for drug-sensitization or inhibition of a cancer cell |
| US9539237B2 (en) | 2012-08-30 | 2017-01-10 | The Texas A&M University System | Compositions and methods for drug-sensitization or inhibition of a cancer cell |
| US9867807B2 (en) | 2012-08-30 | 2018-01-16 | The Texas A&M University System | Compositions and methods for drug-sensitization or inhibition of a cancer cell |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL48824A0 (en) | Thc-type compounds | |
| ZA763256B (en) | Rifamycin compounds | |
| ZA772252B (en) | Antibiotic compounds | |
| GB1557090A (en) | Rifamycin compounds | |
| JPS5297994A (en) | Betaalactummcontaining compounds | |
| GB1534075A (en) | Rifamycin compounds | |
| JPS5317639A (en) | Hexakisazo compounds | |
| KE3258A (en) | 21-halogenopregnane compounds | |
| GB1546954A (en) | Rifamycin compounds | |
| GB1539364A (en) | 11-deoxy-11-oxaprostaglandin compounds | |
| JPS52111590A (en) | Novel cephalospoline compounds | |
| GB1541512A (en) | Antibiotic compounds | |
| JPS52102227A (en) | Haloalkylphosphate compounds | |
| ZA772175B (en) | Oxothia compounds | |
| JPS5285216A (en) | Azamethineemetal complex compounds | |
| JPS5331730A (en) | Aminoonaphthalimide series compounds | |
| IL54784A (en) | Rifamycin compounds | |
| JPS5297990A (en) | Cephalospoline compounds | |
| GB1542597A (en) | Bicyclic compounds | |
| ZA773018B (en) | Bicyclic compounds | |
| CY1211A (en) | Azatetracyclic compounds | |
| JPS52100491A (en) | Cephalospoline compounds | |
| JPS5318555A (en) | Compounds | |
| GB1542784A (en) | Arylorganobromosilicone compounds | |
| AU494112B2 (en) | Rifamycin compounds |