IL49911A - 5-benzoyl-pyrrole-2-acetic acid derivatives, their preparation and pharmaceutical compositions containing them - Google Patents
5-benzoyl-pyrrole-2-acetic acid derivatives, their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL49911A IL49911A IL49911A IL4991176A IL49911A IL 49911 A IL49911 A IL 49911A IL 49911 A IL49911 A IL 49911A IL 4991176 A IL4991176 A IL 4991176A IL 49911 A IL49911 A IL 49911A
- Authority
- IL
- Israel
- Prior art keywords
- pyrrole
- benzoyl
- preparation
- acetic acid
- pharmaceutical compositions
- Prior art date
Links
- WIKBTCSCVFVCER-UHFFFAOYSA-N 2-(5-benzoyl-1h-pyrrol-2-yl)acetic acid Chemical class N1C(CC(=O)O)=CC=C1C(=O)C1=CC=CC=C1 WIKBTCSCVFVCER-UHFFFAOYSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/335—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F5/00—Compounds containing elements of Groups 3 or 13 of the Periodic Table
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/591,217 US4048191A (en) | 1975-06-27 | 1975-06-27 | Halo-substituted 1-loweralkyl-5-aroylpyrrole-2-acetic acid compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL49911A0 IL49911A0 (en) | 1976-08-31 |
| IL49911A true IL49911A (en) | 1979-09-30 |
Family
ID=24365579
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL49911A IL49911A (en) | 1975-06-27 | 1976-06-25 | 5-benzoyl-pyrrole-2-acetic acid derivatives, their preparation and pharmaceutical compositions containing them |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4048191A (cs) |
| JP (1) | JPS525761A (cs) |
| AT (1) | AT361462B (cs) |
| AU (1) | AU508884B2 (cs) |
| BE (1) | BE843454A (cs) |
| CA (1) | CA1094084A (cs) |
| CH (1) | CH624936A5 (cs) |
| CS (1) | CS222227B2 (cs) |
| DE (1) | DE2628475A1 (cs) |
| DK (1) | DK274676A (cs) |
| ES (1) | ES449083A1 (cs) |
| FR (1) | FR2316942A1 (cs) |
| GB (1) | GB1540437A (cs) |
| IL (1) | IL49911A (cs) |
| IN (1) | IN144407B (cs) |
| IT (1) | IT1062038B (cs) |
| NL (1) | NL7606999A (cs) |
| PH (1) | PH11645A (cs) |
| PT (1) | PT65280B (cs) |
| RO (1) | RO70264B (cs) |
| SE (1) | SE418083B (cs) |
| YU (1) | YU156276A (cs) |
| ZA (1) | ZA763814B (cs) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4200645A (en) * | 1977-05-10 | 1980-04-29 | Beecham Group Limited | Pyrrole derivatives |
| US4119639A (en) * | 1977-06-27 | 1978-10-10 | Mcneil Laboratories, Incorporated | Preparation of 5-aroylpyrrole-2-acetic acid derivatives |
| GB1592996A (en) * | 1977-10-10 | 1981-07-15 | Rolland Sa A | Acylated pyrrole carboxylic acids and derivatives thereof |
| US4246175A (en) * | 1979-05-29 | 1981-01-20 | Ethyl Corporation | Synthesis of 5-cyano-1-hydrocarbylpyrrole-2-acetic acid |
| US4213905A (en) * | 1979-06-25 | 1980-07-22 | Mcneilab, Inc. | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid salts |
| US4246176A (en) * | 1979-07-05 | 1981-01-20 | Ethyl Corporation | Synthesis of 5-aroyl-1-hydrocarbylpyrrole-2-acetic acid |
| DE3065460D1 (en) * | 1979-07-28 | 1983-12-08 | Beecham Group Plc | Benzocycloheptapyrrolealkanoic acids and their derivatives, processes for their preparation and pharmaceutical compositions containing them |
| US4363918A (en) * | 1979-09-11 | 1982-12-14 | Janssen Pharmaceutica N.V. | Method of preparing 1-alkyl-3-carboxy-1H pyrrole-2-acetic acids |
| US4388468A (en) * | 1980-04-04 | 1983-06-14 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4565879A (en) * | 1980-04-04 | 1986-01-21 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4374255A (en) * | 1980-04-04 | 1983-02-15 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4333878A (en) * | 1980-04-04 | 1982-06-08 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4565878A (en) * | 1980-04-04 | 1986-01-21 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4299770A (en) * | 1980-05-29 | 1981-11-10 | Mallinckrodt, Inc. | Recovery of substituted pyrrole acetate |
| US4396626A (en) * | 1980-10-09 | 1983-08-02 | Beecham Group Limited | Cyclic compounds and their use |
| US4511576A (en) * | 1981-04-23 | 1985-04-16 | Pfizer Inc. | Antidiabetic pyrrolecarboxylic acids |
| US4374997A (en) * | 1981-06-04 | 1983-02-22 | Merck & Co., Inc. | Process for the preparation of zomepirac and related compounds |
| US4434175A (en) | 1981-08-10 | 1984-02-28 | Merck & Co., Inc. | Nonsteroidal compounds as anti-inflammatory and analgesic agents |
| ES507179A0 (es) * | 1981-11-16 | 1982-08-16 | Pharmedical Sa Lab | Procedimiento de preparacion de derivados del acido 2-pirrol-acetico. |
| IT1153750B (it) * | 1982-09-21 | 1987-01-14 | Montedison Spa | Processo per la preparazione dell'acido 3-carbossi-1-metilpirrol-2-acetico |
| US4536512A (en) * | 1982-10-08 | 1985-08-20 | Merck & Co., Inc. | 5-(2,3-Dihydro-1H-pyrrolizin-5-oyl)-2,3-dihydro-1H-pyrrolizine-1-alkanoic or carboxylic acids and use thereof as anti-inflammatory and analgesic agents |
| US4533671A (en) * | 1982-10-08 | 1985-08-06 | Merck & Co., Inc. | 5-(2,3-Dihydro-1H-pyrrolizin-5-oyl)-2-alkanoic or carboxylic acids and analogs as anti-inflammatory and analgesic agents |
| US4835288A (en) * | 1987-01-14 | 1989-05-30 | Syntex Inc. | Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-a]pyrrole-1,7-dicarboxylates |
| US4937368A (en) * | 1987-01-14 | 1990-06-26 | Syntex (U.S.A.) Inc. | Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-A]pyrrole-1,7-dicarboxylates |
| CA1334975C (en) * | 1987-11-13 | 1995-03-28 | James H. Holms | Furan and pyrrole containing lipoxygenase inhibiting compounds |
| US5622948A (en) * | 1994-12-01 | 1997-04-22 | Syntex (U.S.A.) Inc. | Pyrrole pyridazine and pyridazinone anti-inflammatory agents |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3655693A (en) * | 1969-06-25 | 1972-04-11 | Merck & Co Inc | Anti-inflammatory salicyclic acid derivatives |
| US3752826A (en) * | 1970-01-26 | 1973-08-14 | Mcneilab Inc | Aroyl substituted pyrroles |
| US3952012A (en) * | 1970-01-26 | 1976-04-20 | Mcneil Laboratories, Incorporated | Aroyl-substituted pyrroles |
| US3721680A (en) * | 1970-06-15 | 1973-03-20 | Mc Neil Labor Inc | 5-aroyl-2-(beta-hydroxyethyl)-1-loweralkylpyrroles |
| US3707478A (en) * | 1970-06-15 | 1972-12-26 | Mcneilab Inc | 5-aroyl-2-(beta-r3-ethyl)-1-loweralkyl-pyrroles |
| BE792042A (fr) * | 1971-11-30 | 1973-05-29 | Ciba Geigy | Procede de preparation de nouvelles alcenylene-amines substituees en 3 |
| US3803169A (en) * | 1972-01-21 | 1974-04-09 | Mc Neil Labor Inc | Cycloalkanoyl-substituted pyrroles |
| US3803171A (en) * | 1972-01-21 | 1974-04-09 | Mc Neil Labor Inc | 5-phenylacetyl-pyrroles |
| US3846447A (en) * | 1972-08-03 | 1974-11-05 | Mcneilab Inc | Preparation of 5-aroyl-pyrroles and intermediates therefor |
| US3998844A (en) * | 1975-06-02 | 1976-12-27 | Mcneil Laboratories, Incorporated | Uncatalyzed aroylation of 1-alkylpyrrole-2-acetic acid derivatives |
-
1975
- 1975-06-27 US US05/591,217 patent/US4048191A/en not_active Expired - Lifetime
-
1976
- 1976-05-24 IN IN897/CAL/76A patent/IN144407B/en unknown
- 1976-05-31 PH PH18494A patent/PH11645A/en unknown
- 1976-06-02 GB GB22759/76A patent/GB1540437A/en not_active Expired
- 1976-06-16 JP JP51069845A patent/JPS525761A/ja active Pending
- 1976-06-18 DK DK274676A patent/DK274676A/da not_active Application Discontinuation
- 1976-06-21 ES ES449083A patent/ES449083A1/es not_active Expired
- 1976-06-23 AU AU15159/76A patent/AU508884B2/en not_active Expired
- 1976-06-23 SE SE7607240A patent/SE418083B/xx unknown
- 1976-06-24 CA CA255,611A patent/CA1094084A/en not_active Expired
- 1976-06-24 RO RO86570A patent/RO70264B/ro unknown
- 1976-06-24 CS CS764179A patent/CS222227B2/cs unknown
- 1976-06-25 PT PT65280A patent/PT65280B/pt unknown
- 1976-06-25 CH CH818576A patent/CH624936A5/de not_active IP Right Cessation
- 1976-06-25 IT IT50171/76A patent/IT1062038B/it active
- 1976-06-25 DE DE19762628475 patent/DE2628475A1/de not_active Ceased
- 1976-06-25 YU YU01562/76A patent/YU156276A/xx unknown
- 1976-06-25 NL NL7606999A patent/NL7606999A/xx not_active Application Discontinuation
- 1976-06-25 BE BE168356A patent/BE843454A/xx not_active IP Right Cessation
- 1976-06-25 IL IL49911A patent/IL49911A/xx unknown
- 1976-06-25 ZA ZA00763814A patent/ZA763814B/xx unknown
- 1976-06-25 FR FR7619467A patent/FR2316942A1/fr active Granted
- 1976-06-25 AT AT468276A patent/AT361462B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| PT65280B (en) | 1978-05-08 |
| ATA468276A (de) | 1980-08-15 |
| PH11645A (en) | 1978-05-08 |
| RO70264A (ro) | 1983-04-29 |
| BE843454A (fr) | 1976-12-27 |
| FR2316942B1 (cs) | 1978-12-22 |
| YU156276A (en) | 1983-01-21 |
| IT1062038B (it) | 1983-06-25 |
| ZA763814B (en) | 1978-02-22 |
| DE2628475A1 (de) | 1977-01-13 |
| AU508884B2 (en) | 1980-04-03 |
| CH624936A5 (cs) | 1981-08-31 |
| AU1515976A (en) | 1978-01-05 |
| CA1094084A (en) | 1981-01-20 |
| US4048191A (en) | 1977-09-13 |
| JPS525761A (en) | 1977-01-17 |
| GB1540437A (en) | 1979-02-14 |
| DK274676A (da) | 1976-12-28 |
| RO70264B (ro) | 1983-04-30 |
| AT361462B (de) | 1981-03-10 |
| ES449083A1 (es) | 1977-11-16 |
| CS222227B2 (en) | 1983-05-27 |
| NL7606999A (nl) | 1976-12-29 |
| FR2316942A1 (fr) | 1977-02-04 |
| IN144407B (cs) | 1978-04-29 |
| SE7607240L (sv) | 1976-12-28 |
| PT65280A (en) | 1976-07-01 |
| IL49911A0 (en) | 1976-08-31 |
| SE418083B (sv) | 1981-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL49238A (en) | O-aminoethyl trifluoromethyl-phenyl-ketoximes, their preparation and pharmaceutical compositions containing them | |
| IL48642A0 (en) | 3-amino-indazolecarboxylic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL49911A (en) | 5-benzoyl-pyrrole-2-acetic acid derivatives, their preparation and pharmaceutical compositions containing them | |
| IL50176A0 (en) | Novel tetrahydroisoquinoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL49411A0 (en) | Phenylalkane-carboxylic acid derivatives,processes for the preparation thereof and pharmaceutical compositions containing the same | |
| IL47360A (en) | -amino- and -formyl- -(p-acycloxyphenyl) acetamido-3-cephem-4-carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL49406A0 (en) | Novel imidazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL48806A0 (en) | New biphenyloxy derivatives,their preparation and pharmaceutical compositions containing them | |
| IL50690A0 (en) | Novel benzisothiazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL50869A (en) | Heterocyclylthio-ethylimidazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL50631A0 (en) | 1-benzazolylalkyl-4-substituted-piperidines,their preparation and pharmaceutical compositions containing them | |
| IL49788A0 (en) | 11-desoxy-16-aryloxy-omega-pentanorprostaglandins,their preparation and pharmaceutical compositions containing them | |
| IL50736A0 (en) | Phenoxyalkylcarboxylic acid derivatives,processes for the preparation thereof and pharmaceutical compositions containing the same | |
| IL49758A0 (en) | Novel phenothiazine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL49629A0 (en) | New derivatives of 2-phenylamino-2-imidazoline,their preparation and pharmaceutical compositions containing them | |
| IL50335A (en) | Diphenylalkylpolyamine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL52820A (en) | Acylated benzimidazole-2-methanol and-2-carboxylic acid derivatives, their preparation and pharmaceutical compositions containing them | |
| IL52638A (en) | Clivanic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL50156A (en) | N,n-bis-isoquinolinoalkylamine derivatives, their preparation and pharmaceutical compositions containing them | |
| IL47299A (en) | 3-thiomethyl-3-cephem-4-carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL50644A (en) | 12-aza-11-oxo-15-hydroxyprostanoic acid analogues,their preparation and pharmaceutical compositions containing them | |
| IL49971A0 (en) | New 2-benzoypranone derivatives,their preparation and pharmaceutical compositions containing them | |
| IL47519A (en) | 7-sulphinimidoyl(sulphimidoyl)-xanthone-2-carboxylic acid derivatives, their preparation and pharmaceutical compositions containing them | |
| IL49099A (en) | Xanthene-9-carboxylates, their preparation and pharmaceutical compositions containing them | |
| IL48791A0 (en) | Novel penicillin derivatives,their preparation and pharmaceutical compositions containing them |