IL44443A - פירימיניל אסטרים של חומצה פוספורית ותכשירים קוטלי מזיקים המכילים אותם - Google Patents
פירימיניל אסטרים של חומצה פוספורית ותכשירים קוטלי מזיקים המכילים אותםInfo
- Publication number
- IL44443A IL44443A IL44443A IL4444374A IL44443A IL 44443 A IL44443 A IL 44443A IL 44443 A IL44443 A IL 44443A IL 4444374 A IL4444374 A IL 4444374A IL 44443 A IL44443 A IL 44443A
- Authority
- IL
- Israel
- Prior art keywords
- carbon atoms
- pesticidal compositions
- compound
- formula
- compounds
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 39
- 230000000361 pesticidal effect Effects 0.000 title claims description 17
- FNEQSJOUOUGPBG-UHFFFAOYSA-N pyrimidin-2-yl dihydrogen phosphate Chemical class OP(O)(=O)OC1=NC=CC=N1 FNEQSJOUOUGPBG-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 62
- 125000004432 carbon atom Chemical group C* 0.000 claims description 34
- 241000607479 Yersinia pestis Species 0.000 claims description 26
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 24
- 238000002360 preparation method Methods 0.000 claims description 24
- 239000004480 active ingredient Substances 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 239000003085 diluting agent Substances 0.000 claims description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical group [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 8
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 8
- -1 alkali metal salt Chemical class 0.000 claims description 6
- 125000003282 alkyl amino group Chemical group 0.000 claims description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 239000005864 Sulphur Chemical group 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 239000008187 granular material Substances 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 239000000080 wetting agent Substances 0.000 claims description 4
- 206010061217 Infestation Diseases 0.000 claims description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 3
- 239000002270 dispersing agent Substances 0.000 claims description 3
- 239000003995 emulsifying agent Substances 0.000 claims description 3
- 150000002576 ketones Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 claims description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 claims description 2
- 125000006323 alkenyl amino group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 230000000855 fungicidal effect Effects 0.000 claims description 2
- 239000000417 fungicide Substances 0.000 claims description 2
- 239000002917 insecticide Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 159000000000 sodium salts Chemical class 0.000 claims description 2
- 238000009736 wetting Methods 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims 1
- 239000000543 intermediate Substances 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- 239000000243 solution Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- KMJJJTCKNZYTEY-UHFFFAOYSA-N chloro-diethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(Cl)(=S)OCC KMJJJTCKNZYTEY-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 6
- AKVFEVJIDCUHKH-UHFFFAOYSA-N ethyl 2-[2-(diethylamino)-4-oxo-1h-pyrimidin-6-yl]acetate Chemical compound CCOC(=O)CC1=CC(O)=NC(N(CC)CC)=N1 AKVFEVJIDCUHKH-UHFFFAOYSA-N 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 241000256118 Aedes aegypti Species 0.000 description 5
- 241001454293 Tetranychus urticae Species 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 241000196324 Embryophyta Species 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- 241000238631 Hexapoda Species 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 241000255969 Pieris brassicae Species 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 240000006677 Vicia faba Species 0.000 description 4
- 235000010749 Vicia faba Nutrition 0.000 description 4
- 235000002098 Vicia faba var. major Nutrition 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 241001300076 Deroceras reticulatum Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241000171274 Megoura Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 241001608567 Phaedon cochleariae Species 0.000 description 3
- 244000046052 Phaseolus vulgaris Species 0.000 description 3
- 241000500437 Plutella xylostella Species 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- XFBJRFNXPUCPKU-UHFFFAOYSA-N chloro-dimethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound COP(Cl)(=S)OC XFBJRFNXPUCPKU-UHFFFAOYSA-N 0.000 description 3
- 238000010410 dusting Methods 0.000 description 3
- 235000005489 dwarf bean Nutrition 0.000 description 3
- GGHOZKGKIRUBHJ-UHFFFAOYSA-N ethyl 2-[2-(ethylamino)-4-oxo-1h-pyrimidin-6-yl]acetate Chemical compound CCNC1=NC(O)=CC(CC(=O)OCC)=N1 GGHOZKGKIRUBHJ-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- PTMHPRAIXMAOOB-UHFFFAOYSA-L phosphoramidate Chemical compound NP([O-])([O-])=O PTMHPRAIXMAOOB-UHFFFAOYSA-L 0.000 description 3
- 239000008262 pumice Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 241001124076 Aphididae Species 0.000 description 2
- 241001425390 Aphis fabae Species 0.000 description 2
- 241000238657 Blattella germanica Species 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- 241001635274 Cydia pomonella Species 0.000 description 2
- 241001127120 Dysdercus fasciatus Species 0.000 description 2
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 2
- 241000257159 Musca domestica Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 241000254179 Sitophilus granarius Species 0.000 description 2
- 241000254112 Tribolium confusum Species 0.000 description 2
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000011928 denatured alcohol Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- JSDVANDODLTPEZ-UHFFFAOYSA-N ethyl 2-(2-methyl-4-oxo-1h-pyrimidin-6-yl)acetate Chemical compound CCOC(=O)CC1=CC(=O)N=C(C)N1 JSDVANDODLTPEZ-UHFFFAOYSA-N 0.000 description 2
- QIPGNSZJMQDSBY-UHFFFAOYSA-N ethyl 2-(4-oxo-2-propan-2-yl-1h-pyrimidin-6-yl)acetate Chemical compound CCOC(=O)CC1=CC(O)=NC(C(C)C)=N1 QIPGNSZJMQDSBY-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- LMQMCICGTMPZSN-UHFFFAOYSA-N methyl 2-[2-(diethylamino)-4-oxo-1h-pyrimidin-6-yl]acetate Chemical compound CCN(CC)C1=NC(O)=CC(CC(=O)OC)=N1 LMQMCICGTMPZSN-UHFFFAOYSA-N 0.000 description 2
- 239000008267 milk Substances 0.000 description 2
- 235000013336 milk Nutrition 0.000 description 2
- 210000004080 milk Anatomy 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000011120 plywood Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- YMCAGFVUHPRWLF-UHFFFAOYSA-N 2-(2-methyl-4-oxo-1h-pyrimidin-6-yl)acetic acid Chemical compound CC1=NC(=O)C=C(CC(O)=O)N1 YMCAGFVUHPRWLF-UHFFFAOYSA-N 0.000 description 1
- UGBYCXPPXHBCTD-UHFFFAOYSA-N 2-(4-oxo-1h-pyrimidin-6-yl)acetic acid Chemical compound OC(=O)CC1=CC(=O)N=CN1 UGBYCXPPXHBCTD-UHFFFAOYSA-N 0.000 description 1
- YXGBFHCGNNHQGS-UHFFFAOYSA-N 2-[2-(dimethylamino)-4-hydroxy-1H-pyrimidin-4-yl]acetic acid Chemical compound CN(C)C1=NC=CC(O)(CC(O)=O)N1 YXGBFHCGNNHQGS-UHFFFAOYSA-N 0.000 description 1
- WSGUAYQFFRJFMB-UHFFFAOYSA-N 2-[2-(ethylamino)-4-oxo-1h-pyrimidin-6-yl]acetic acid Chemical compound CCNC1=NC(O)=CC(CC(O)=O)=N1 WSGUAYQFFRJFMB-UHFFFAOYSA-N 0.000 description 1
- KNDAEDDIIQYRHY-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(piperazin-1-ylmethyl)pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical group C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)CN1CCNCC1 KNDAEDDIIQYRHY-UHFFFAOYSA-N 0.000 description 1
- HAEVLZUBSLBWIX-UHFFFAOYSA-N 2-octylphenol;oxirane Chemical compound C1CO1.CCCCCCCCC1=CC=CC=C1O HAEVLZUBSLBWIX-UHFFFAOYSA-N 0.000 description 1
- ABAFKQHGFDZEJO-UHFFFAOYSA-N 4,6,6-trimethylbicyclo[3.1.1]heptane-4-carbaldehyde Chemical compound C1C2C(C)(C)C1CCC2(C)C=O ABAFKQHGFDZEJO-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001600407 Aphis <genus> Species 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- 241000256113 Culicidae Species 0.000 description 1
- 241000237858 Gastropoda Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 241000243786 Meloidogyne incognita Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 241000131102 Oryzaephilus Species 0.000 description 1
- 241000186704 Pinales Species 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- NGFFLHMFSINFGB-UHFFFAOYSA-N [chloro(methoxy)phosphoryl]oxymethane Chemical compound COP(Cl)(=O)OC NGFFLHMFSINFGB-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 210000000234 capsid Anatomy 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- LGTLXDJOAJDFLR-UHFFFAOYSA-N diethyl chlorophosphate Chemical compound CCOP(Cl)(=O)OCC LGTLXDJOAJDFLR-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- QWXYZCJEXYQNEI-OSZHWHEXSA-N intermediate I Chemical compound COC(=O)[C@@]1(C=O)[C@H]2CC=[N+](C\C2=C\C)CCc2c1[nH]c1ccccc21 QWXYZCJEXYQNEI-OSZHWHEXSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004452 microanalysis Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- WRMCZHYLTVSDQU-UHFFFAOYSA-N pyrimidin-1-ium;acetate Chemical class CC(O)=O.C1=CN=CN=C1 WRMCZHYLTVSDQU-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229960001866 silicon dioxide Drugs 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000925 very toxic Toxicity 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
- C07D239/36—One oxygen atom as doubly bound oxygen atom or as unsubstituted hydroxy radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/645—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having two nitrogen atoms as the only ring hetero atoms
- C07F9/6509—Six-membered rings
- C07F9/6512—Six-membered rings having the nitrogen atoms in positions 1 and 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1515973A GB1418784A (en) | 1973-03-29 | 1973-03-29 | Phosphorus containing pyrimidine compounds and pesticidal compositions comprising them |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL44443A0 IL44443A0 (en) | 1974-06-30 |
| IL44443A true IL44443A (he) | 1977-04-29 |
Family
ID=10054080
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL44443A IL44443A (he) | 1973-03-29 | 1974-03-19 | פירימיניל אסטרים של חומצה פוספורית ותכשירים קוטלי מזיקים המכילים אותם |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3932631A (he) |
| JP (1) | JPS5024447A (he) |
| AU (1) | AU475617B2 (he) |
| DE (1) | DE2415437A1 (he) |
| FR (1) | FR2223380B1 (he) |
| GB (1) | GB1418784A (he) |
| HU (1) | HU168940B (he) |
| IL (1) | IL44443A (he) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4048172A (en) * | 1973-03-29 | 1977-09-13 | Imperial Chemical Industries Limited | Carbonylmethylpyrimidin-6-yl phosphates and phosphorothionates |
| DE2831165A1 (de) * | 1978-07-15 | 1980-01-24 | Bayer Ag | 2-cyclopropyl-pyrimidin(4)yl-thionophosphonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
| DE2907773A1 (de) * | 1979-02-28 | 1980-09-11 | Consortium Elektrochem Ind | Verfahren zur herstellung von diazinon |
| FR2544445B1 (fr) * | 1983-04-14 | 1985-06-21 | Electricite De France | Dispositif de securite a membrane et couteau d'eclatement, destine a limiter la pression d'un fluide |
| US6258001B1 (en) | 1999-03-26 | 2001-07-10 | Aisin Aw Co., Ltd. | Vehicle drive train |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL129225C (he) * | 1963-03-28 | 1900-01-01 | ||
| US3651224A (en) * | 1967-09-21 | 1972-03-21 | Ici Ltd | Pesticidal pyrimidine derivative |
| GB1257634A (he) * | 1968-08-07 | 1971-12-22 | ||
| CH535264A (de) * | 1970-08-07 | 1973-03-31 | Sandoz Ag | Verfahren zur Herstellung neuer Phosphorsäureamidester |
-
1973
- 1973-03-29 GB GB1515973A patent/GB1418784A/en not_active Expired
-
1974
- 1974-03-14 US US05/451,368 patent/US3932631A/en not_active Expired - Lifetime
- 1974-03-19 IL IL44443A patent/IL44443A/he unknown
- 1974-03-21 AU AU66920/74A patent/AU475617B2/en not_active Expired
- 1974-03-28 FR FR7410920A patent/FR2223380B1/fr not_active Expired
- 1974-03-29 JP JP49034752A patent/JPS5024447A/ja active Pending
- 1974-03-29 DE DE2415437A patent/DE2415437A1/de active Pending
- 1974-03-29 HU HUIE622A patent/HU168940B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU168940B (he) | 1976-08-28 |
| FR2223380B1 (he) | 1977-10-07 |
| GB1418784A (en) | 1975-12-24 |
| AU475617B2 (en) | 1976-08-26 |
| FR2223380A1 (he) | 1974-10-25 |
| DE2415437A1 (de) | 1974-10-10 |
| US3932631A (en) | 1976-01-13 |
| IL44443A0 (en) | 1974-06-30 |
| JPS5024447A (he) | 1975-03-15 |
| AU6692074A (en) | 1975-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3657247A (en) | Pesticidal halogen-substituted pyrimidinyl phosphorus esters | |
| US4041157A (en) | Fungicidal pyrimidine derivatives | |
| US4014882A (en) | Trifluoromethyl substituted pyrimidine derivatives useful as insecticides | |
| US3932631A (en) | Certain organophosphorus compounds used to control insects | |
| CA1091671A (en) | Cyclopropyl-substituted pyrimidin-4-y1(thiono)(thiol)- phosphoric(phosphonic) acid esters and ester-amides and their use as insecticides and acaricides | |
| US4024277A (en) | Phosphoro-aminosulfenyl derivatives of benzofuran carbamates | |
| US3928586A (en) | O,O-Diethyl-0-1-(2,4-dichlorophenyl)-2,2-dibromovinyl phosphate used to control the Colorado potato beetle | |
| US4048172A (en) | Carbonylmethylpyrimidin-6-yl phosphates and phosphorothionates | |
| CA1039299A (en) | Amide phosphorothiolate pesticides | |
| US3094457A (en) | Toxic omicron, omicron-dimethyl and omicron, omicron-diethyl s-pentachlorophenyl phosphorothioate | |
| US3767662A (en) | Certain 1,3-thiazolidin-4-ones | |
| CA1047497A (en) | Heterocyclic derivative | |
| IL44555A (en) | Pyrimidyl (thio)phosphoric acid esters | |
| US3935212A (en) | Pesticidal substituted 2-hydroxylaminopyrimidinyl phosphorus esters | |
| US4225595A (en) | Piperazine phosphates and phosphonate insecticides | |
| US4086239A (en) | Thiazole bis-phosphates and phosphonates, intermediates, and insecticidal compositions and methods | |
| US3726973A (en) | 1-alkoxy(-alk enyloxy,-phenoxy)-1-thiono-3-chloro(3-alkyl) phospholines compositions and their use | |
| US3856948A (en) | Insecticidal phosphoric acid esters | |
| US3843655A (en) | Heterocyclic compounds and compositions | |
| US3906094A (en) | Method and composition for combatting fungus with fungicidally-active pyrimidine derivatives | |
| US3912812A (en) | Certain pyrimidine derivatives as insecticides and fungicides | |
| US3524861A (en) | Phosphorylated benzofurazans | |
| CA1078399A (en) | Insecticidal active thiophene phosphorous derivatives | |
| US4363804A (en) | Phosphonodithioylacetylamino phenyl pyrazoles | |
| US4008319A (en) | O,S-dialkyl O-benzoyl-phenyl phosphorothiolates and phosphorodithioates, pesticidal compositions and methods of use |