IL37971A - 2-amino-4-thiocyanatobenzothiazoles and their preparation - Google Patents
2-amino-4-thiocyanatobenzothiazoles and their preparationInfo
- Publication number
- IL37971A IL37971A IL37971A IL3797171A IL37971A IL 37971 A IL37971 A IL 37971A IL 37971 A IL37971 A IL 37971A IL 3797171 A IL3797171 A IL 3797171A IL 37971 A IL37971 A IL 37971A
- Authority
- IL
- Israel
- Prior art keywords
- thiocyanatobenzothiazoles
- amino
- preparation
- Prior art date
Links
- UFBPDYYYTQLCQV-UHFFFAOYSA-N NC=1SC2=C(N=1)C(=CC=C2)SC#N Chemical class NC=1SC2=C(N=1)C(=CC=C2)SC#N UFBPDYYYTQLCQV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US8495270A | 1970-10-28 | 1970-10-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL37971A0 IL37971A0 (en) | 1971-12-29 |
| IL37971A true IL37971A (en) | 1974-09-10 |
Family
ID=22188237
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL37971A IL37971A (en) | 1970-10-28 | 1971-10-20 | 2-amino-4-thiocyanatobenzothiazoles and their preparation |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3706759A (OSRAM) |
| AU (1) | AU455235B2 (OSRAM) |
| BE (1) | BE774427A (OSRAM) |
| CH (1) | CH561193A5 (OSRAM) |
| DE (1) | DE2153590A1 (OSRAM) |
| FR (1) | FR2111892B1 (OSRAM) |
| GB (1) | GB1328079A (OSRAM) |
| IL (1) | IL37971A (OSRAM) |
| NL (1) | NL7114700A (OSRAM) |
| ZA (1) | ZA717018B (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4012409A (en) * | 1975-12-29 | 1977-03-15 | Morton-Norwich Products, Inc. | N-(6-Ethyl-4-thiocyanato-2-benzothiazolyl)-5-nitrofuramide |
| US4169093A (en) * | 1978-05-25 | 1979-09-25 | Morton-Norwich Products, Inc. | 2-Amino-5-phenylmethoxy-6-methoxybenzothiazole hydrochloride |
-
1970
- 1970-10-28 US US84952A patent/US3706759A/en not_active Expired - Lifetime
-
1971
- 1971-10-20 IL IL37971A patent/IL37971A/xx unknown
- 1971-10-20 ZA ZA717018A patent/ZA717018B/xx unknown
- 1971-10-22 GB GB4912771A patent/GB1328079A/en not_active Expired
- 1971-10-25 BE BE774427A patent/BE774427A/xx unknown
- 1971-10-26 NL NL7114700A patent/NL7114700A/xx unknown
- 1971-10-27 CH CH1568771A patent/CH561193A5/xx not_active IP Right Cessation
- 1971-10-27 DE DE19712153590 patent/DE2153590A1/de active Pending
- 1971-10-27 FR FR7138643A patent/FR2111892B1/fr not_active Expired
- 1971-10-27 AU AU35053/71A patent/AU455235B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1328079A (en) | 1973-08-30 |
| ZA717018B (en) | 1973-06-27 |
| DE2153590A1 (de) | 1972-05-04 |
| FR2111892A1 (OSRAM) | 1972-06-09 |
| FR2111892B1 (OSRAM) | 1974-10-18 |
| AU455235B2 (en) | 1974-11-21 |
| BE774427A (fr) | 1972-04-25 |
| CH561193A5 (OSRAM) | 1975-04-30 |
| NL7114700A (OSRAM) | 1972-05-03 |
| US3706759A (en) | 1972-12-19 |
| AU3505371A (en) | 1973-05-03 |
| IL37971A0 (en) | 1971-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MY7500161A (en) | Phenoxy-hydroxypropylamines and their preparation | |
| IL34383A0 (en) | 2-acylimidazoles and their preparation | |
| GB1323371A (en) | Heterocyclized polydiynylenes and methods for their preparation | |
| IL35797A0 (en) | 3-propionyl-salicylic acid and its preparation | |
| IL43512A0 (en) | Aspirin-tea coprecipitates and their preparation | |
| IL37563A (en) | 8-cyano-5-octanolide and its preparation | |
| IL37762A0 (en) | New penicillins and their preparation | |
| IL37971A0 (en) | Thiocyanatobenzothiazoles and their preparation | |
| IL36977A0 (en) | 2,6-methano-3-benzazocines and their preparation | |
| IL36085A0 (en) | Benzocycloheptaisoquinoline derivatives and their preparation | |
| ZA711607B (en) | New n-vinyl-quinolones and the preparation thereof | |
| IL37932A0 (en) | Thiocyanatobenzothiazoles and their preparation | |
| IL37008A (en) | Cyclophosphates and their preparation | |
| IL36728A0 (en) | Substituted pyrrolylmethylamines and their preparation | |
| IL38281A0 (en) | Substituted butyronitriles and their preparation | |
| IL33812A0 (en) | 9alpha-fluoro-16-fluoromethylene-prednisolone-21-ester and preparation thereof | |
| ZA711467B (en) | Thioxsanthene derivatives and their preparation | |
| IL37476A0 (en) | New penicillines and their preparation | |
| IL46413A0 (en) | New 7-aminocephalosporins and their preparation | |
| GB1367110A (en) | Films and their preparation | |
| ZA715706B (en) | Herbicidally-active substituted phenyl-thiocarbamates and their manufacture and use | |
| IL36984A0 (en) | Substituted dehydroabietylamines and preparation thereof | |
| AU454159B2 (en) | Trioletheramides and their preparation | |
| CA836571A (en) | 20-spirox-4-ene-3-ones and their preparation | |
| CA851730A (en) | Arylsulphonylureas and arylsulphonylthioureas and their preparation |