IL31671A - Benzoyl chloride phenylhydrazones - Google Patents
Benzoyl chloride phenylhydrazonesInfo
- Publication number
- IL31671A IL31671A IL31671A IL3167169A IL31671A IL 31671 A IL31671 A IL 31671A IL 31671 A IL31671 A IL 31671A IL 3167169 A IL3167169 A IL 3167169A IL 31671 A IL31671 A IL 31671A
- Authority
- IL
- Israel
- Prior art keywords
- benzoyl chloride
- chloride phenylhydrazones
- phenylhydrazones
- benzoyl
- chloride
- Prior art date
Links
- IUSCIWAUZVKPPY-UHFFFAOYSA-N n-phenylbenzenecarbohydrazonoyl chloride Chemical class C=1C=CC=CC=1C(Cl)=NNC1=CC=CC=C1 IUSCIWAUZVKPPY-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/72—Hydrazones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
- C07C243/24—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids
- C07C243/38—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids with acylating carboxyl groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US70994368A | 1968-03-04 | 1968-03-04 | |
| US779251A US3879543A (en) | 1968-03-04 | 1968-11-26 | Certain benzoyl chloride phenylhydrazones as insecticides and miticides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL31671A0 IL31671A0 (en) | 1969-04-30 |
| IL31671A true IL31671A (en) | 1973-05-31 |
Family
ID=27108349
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL31671A IL31671A (en) | 1968-03-04 | 1969-02-21 | Benzoyl chloride phenylhydrazones |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3879543A (enExample) |
| DE (2) | DE1909868A1 (enExample) |
| FR (1) | FR2003172A1 (enExample) |
| GB (2) | GB1254585A (enExample) |
| IL (1) | IL31671A (enExample) |
| NL (1) | NL6903247A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3930020A (en) * | 1970-07-13 | 1975-12-30 | Upjohn Co | Compositions and methods of combatting arthropodal pests using phenylhydrazone derivatives |
| US3930021A (en) * | 1970-07-13 | 1975-12-30 | Upjohn Co | Compositions and methods of combatting arthropodal pests using phenylhydrozone derivatives |
| ZA713026B (en) * | 1970-08-26 | 1973-03-28 | Upjohn Co | Anthelmintic method and formulations |
| MY131441A (en) * | 1992-12-29 | 2007-08-30 | American Cyanamid Co | Amidrazones and their use as insecticidal and acaricidal agents |
| US6492527B1 (en) * | 1999-10-13 | 2002-12-10 | Fmc Corporation | Process to prepare aryltriazolinones and novel intermediates thereto |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1204878B (de) * | 1963-02-21 | 1965-11-11 | Bayer Ag | Akarizide Mittel |
-
1968
- 1968-11-26 US US779251A patent/US3879543A/en not_active Expired - Lifetime
-
1969
- 1969-02-21 IL IL31671A patent/IL31671A/xx unknown
- 1969-02-27 DE DE19691909868 patent/DE1909868A1/de active Pending
- 1969-02-27 DE DE19691926366 patent/DE1926366A1/de active Pending
- 1969-03-03 FR FR6905745A patent/FR2003172A1/fr not_active Withdrawn
- 1969-03-03 GB GB01286/69A patent/GB1254585A/en not_active Expired
- 1969-03-03 GB GB3398/71A patent/GB1254586A/en not_active Expired
- 1969-03-03 NL NL6903247A patent/NL6903247A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1909868A1 (de) | 1969-10-16 |
| FR2003172A1 (enExample) | 1969-11-07 |
| IL31671A0 (en) | 1969-04-30 |
| DE1926366A1 (de) | 1970-01-15 |
| GB1254585A (en) | 1971-11-24 |
| GB1254586A (en) | 1971-11-24 |
| US3879543A (en) | 1975-04-22 |
| NL6903247A (enExample) | 1969-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MY7500028A (en) | Bromo-ergocryptine | |
| IE33790L (en) | N-acylaminoacid amides | |
| YU31734B (en) | Drzac posrednickih elemenata u kotrljajnim lezistima | |
| MY7400300A (en) | N-tritylimidazole | |
| YU31869A (en) | Aparat s televizijsko slikovno cevjo | |
| IL33473A0 (en) | Diazepine-derivatives | |
| YU169969A (en) | Izmenjivac toplote | |
| IL32493A0 (en) | Imidazolidino-quinazolines | |
| IE32701L (en) | Pyridazones-herbicides | |
| IL32959A0 (en) | Novel 4-cyano-4-phenyl-aminocyclohexanes | |
| CY728A (en) | Omega-cyanoalkylcarbamylbenzimidazoles | |
| IL31738A0 (en) | Dibenzocycloheptenes | |
| IL31671A (en) | Benzoyl chloride phenylhydrazones | |
| YU153769A (en) | Elektricni postavni uredaj | |
| IL31705A0 (en) | Dibenzocycloheptenes | |
| YU129169A (en) | Elektricna pegla | |
| MY7400045A (en) | Hexahydroazepines | |
| IL32250A0 (en) | Electrophotography | |
| IL32346A (en) | 3-substituted-benzyl cyclopropane-carboxylates | |
| IL33043A (en) | Aminobenzocycloalkylnitriles | |
| IL32875A (en) | Oxazinobenzodiazepines | |
| IL31653A (en) | 18-nor-13beta-ethyl-5alpha-androstan-3-ones | |
| IL35339A0 (en) | Crossbar-distributor | |
| YU32474B (en) | Visokonaponska celija u metalnoj kapsuli | |
| IL32326A (en) | Cyanoglyoxylate-phenylhydrazones |