IL30009A - 1,2,4-benzothiadiazepine 1,1-dioxide derivatives - Google Patents
1,2,4-benzothiadiazepine 1,1-dioxide derivativesInfo
- Publication number
- IL30009A IL30009A IL30009A IL3000968A IL30009A IL 30009 A IL30009 A IL 30009A IL 30009 A IL30009 A IL 30009A IL 3000968 A IL3000968 A IL 3000968A IL 30009 A IL30009 A IL 30009A
- Authority
- IL
- Israel
- Prior art keywords
- benzothiadiazepine
- dioxide derivatives
- dioxide
- derivatives
- Prior art date
Links
- FHPWVYWEPHZNLT-UHFFFAOYSA-N 1lambda6,2,4-benzothiadiazepine 1,1-dioxide Chemical class S1(N=CN=CC2=C1C=CC=C2)(=O)=O FHPWVYWEPHZNLT-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/36—Seven-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64822667A | 1967-06-23 | 1967-06-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL30009A0 IL30009A0 (en) | 1968-07-25 |
| IL30009A true IL30009A (en) | 1972-03-28 |
Family
ID=24599924
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL30009A IL30009A (en) | 1967-06-23 | 1968-05-16 | 1,2,4-benzothiadiazepine 1,1-dioxide derivatives |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3671528A (Direct) |
| BE (1) | BE716945A (Direct) |
| FR (1) | FR1571016A (Direct) |
| GB (1) | GB1195933A (Direct) |
| IL (1) | IL30009A (Direct) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3516616A1 (de) * | 1984-08-30 | 1986-03-13 | Bayer Ag, 5090 Leverkusen | Benzodisultame |
| DE3517845A1 (de) * | 1985-05-17 | 1986-11-20 | Bayer Ag, 5090 Leverkusen | Benzolactamsultame |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3051727A (en) * | 1962-08-28 | S-dihydro-l | ||
| US1915334A (en) * | 1930-10-16 | 1933-06-27 | Du Pont | Fluosilicate of organic heterocyclic bases and process of making it |
| US3163644A (en) * | 1959-10-16 | 1964-12-29 | Ciba Geigy Corp | Derivatives of 2-h-1, 2, 4-benzo thiadiazine-1, 1-dioxide |
| US3090783A (en) * | 1962-06-12 | 1963-05-21 | Olin Mathieson | Dihydrobenzothiadiazines |
| US3203954A (en) * | 1963-07-15 | 1965-08-31 | Upjohn Co | Novel 3, 5-disubstituted-1, 2, 6-(2h)-thiadiazine-1, 1-dioxides |
| US3377357A (en) * | 1966-06-27 | 1968-04-09 | Lilly Co Eli | 1, 2-benzothiazepine-1, 1-dioxides and their preparation |
| US3407198A (en) * | 1966-08-10 | 1968-10-22 | Upjohn Co | 2h-1, 2, 3-benzothiadiazine-1, 1-dioxides |
| US3464996A (en) * | 1967-05-16 | 1969-09-02 | Upjohn Co | 6h - dibenzo(c,g)(1,2,5)thiadiazocine - 5,5-dioxides and method for their production |
| US3526638A (en) * | 1967-10-05 | 1970-09-01 | Smithkline Corp | Substituted 3,4-dihydro-1h-2,1,5-benzothiadiazocine-2,2-dioxides |
-
1967
- 1967-06-23 US US648226A patent/US3671528A/en not_active Expired - Lifetime
-
1968
- 1968-05-16 IL IL30009A patent/IL30009A/xx unknown
- 1968-05-22 GB GB24466/68A patent/GB1195933A/en not_active Expired
- 1968-06-21 FR FR1571016D patent/FR1571016A/fr not_active Expired
- 1968-06-21 BE BE716945D patent/BE716945A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1195933A (en) | 1970-06-24 |
| BE716945A (Direct) | 1968-12-23 |
| US3671528A (en) | 1972-06-20 |
| IL30009A0 (en) | 1968-07-25 |
| FR1571016A (Direct) | 1969-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MY7100160A (en) | 1,2,4- triazine-5-ones | |
| MY7400279A (en) | 4-phenyl-dquinazolinone derivatives | |
| IE32353L (en) | Phenoxypropanolamine derivatives | |
| CY679A (en) | New phenthiazine derivatives | |
| IE32312L (en) | 5-benzylpyrimidine derivatives | |
| IL30009A0 (en) | 1,2,4-benzothiadiazepine-1,1-dioxide derivatives | |
| IL30466A0 (en) | 1,3-benzoxazin derivatives | |
| IE31122L (en) | 1, 2, 5-thiadiazole derivatives | |
| IE31123L (en) | 1, 2, 5-thiadiazole derivatives | |
| IE31124L (en) | 1, 2, 5-thiadiazole derivatives | |
| IL29920A0 (en) | Oxazinoisoquinoline derivatives | |
| IE31937B1 (en) | Benzdiaz (1,4)epinone-(2) derivatives | |
| IE31279L (en) | Pryidoindole derivatives. | |
| IE31564L (en) | Benzdiazepine derivatives. | |
| IE31311L (en) | Triazolo-tetrazolo-pyridazine derivatives. | |
| IE31293L (en) | 2-sulphamylthioxanthene-9-one derivatives. | |
| IE31183L (en) | 1, 8-naphthyridine derivatives | |
| AU3187568A (en) | 2, 3, 4, 5, 6-pentachlorobenzylidenamine derivatives | |
| IE31143L (en) | 1, 2-dihydrobenzodiazepines | |
| IE31026L (en) | 3, 5-seco-a-nor-steroids | |
| IE31536L (en) | 3, 1-benzothiazines | |
| IE31643L (en) | 11, 13ß-DIALKYLSTEROIDS | |
| IE32101L (en) | 4, 6-dichlorosteroids | |
| IE31079L (en) | Substituted 6, 7-benzomorphans | |
| IE31078L (en) | Substituted 6, 7-benzomorphans |