IL28611A - Carbonates and esters of halo nitrophenols and fungicidal compositions containing same - Google Patents
Carbonates and esters of halo nitrophenols and fungicidal compositions containing sameInfo
- Publication number
- IL28611A IL28611A IL28611A IL2861167A IL28611A IL 28611 A IL28611 A IL 28611A IL 28611 A IL28611 A IL 28611A IL 2861167 A IL2861167 A IL 2861167A IL 28611 A IL28611 A IL 28611A
- Authority
- IL
- Israel
- Prior art keywords
- dinitrophenyl
- dichloro
- carbonate
- group
- compounds
- Prior art date
Links
- -1 halo nitrophenols Chemical class 0.000 title claims description 49
- 239000000203 mixture Substances 0.000 title description 14
- 150000002148 esters Chemical class 0.000 title description 12
- 230000000855 fungicidal effect Effects 0.000 title description 8
- 150000004649 carbonic acid derivatives Chemical class 0.000 title description 7
- 238000000034 method Methods 0.000 claims description 58
- 150000001875 compounds Chemical class 0.000 claims description 50
- 238000002360 preparation method Methods 0.000 claims description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 19
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- 229910052783 alkali metal Inorganic materials 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 13
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 239000003960 organic solvent Substances 0.000 claims description 11
- 125000001424 substituent group Chemical group 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 9
- 150000004820 halides Chemical class 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 claims description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical group CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 6
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 6
- 150000001340 alkali metals Chemical class 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 150000002576 ketones Chemical group 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 239000011230 binding agent Substances 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 150000002430 hydrocarbons Chemical class 0.000 claims description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000002541 furyl group Chemical group 0.000 claims description 4
- 229910052736 halogen Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- CXHHBNMLPJOKQD-UHFFFAOYSA-M methyl carbonate Chemical compound COC([O-])=O CXHHBNMLPJOKQD-UHFFFAOYSA-M 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- DNWPZKHWFNHPED-UHFFFAOYSA-N (3,6-dichloro-2,4-dinitrophenyl) prop-2-enoate Chemical compound C(C=C)(=O)OC1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])Cl DNWPZKHWFNHPED-UHFFFAOYSA-N 0.000 claims description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 2
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N ortho-diethylbenzene Natural products CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 2
- BQDKFFICLVYWIA-UHFFFAOYSA-M 2-ethoxyethyl carbonate Chemical compound CCOCCOC([O-])=O BQDKFFICLVYWIA-UHFFFAOYSA-M 0.000 claims 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims 1
- WQULVXNWEYLDJY-UHFFFAOYSA-N bis(2-chloroethyl) carbonate Chemical compound ClCCOC(=O)OCCCl WQULVXNWEYLDJY-UHFFFAOYSA-N 0.000 claims 1
- JKJWYKGYGWOAHT-UHFFFAOYSA-N bis(prop-2-enyl) carbonate Chemical compound C=CCOC(=O)OCC=C JKJWYKGYGWOAHT-UHFFFAOYSA-N 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- VUPKGFBOKBGHFZ-UHFFFAOYSA-N dipropyl carbonate Chemical compound CCCOC(=O)OCCC VUPKGFBOKBGHFZ-UHFFFAOYSA-N 0.000 claims 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 claims 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 claims 1
- 125000001302 tertiary amino group Chemical group 0.000 claims 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 14
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 239000007787 solid Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 240000007594 Oryza sativa Species 0.000 description 8
- 235000007164 Oryza sativa Nutrition 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 235000009566 rice Nutrition 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- XMXUSLWJWJCKTL-UHFFFAOYSA-N 3,6-dichloro-2,4-dinitrophenol Chemical compound OC1=C(Cl)C=C([N+]([O-])=O)C(Cl)=C1[N+]([O-])=O XMXUSLWJWJCKTL-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000000417 fungicide Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 3
- 206010039509 Scab Diseases 0.000 description 3
- 240000003768 Solanum lycopersicum Species 0.000 description 3
- 150000001339 alkali metal compounds Chemical class 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- DCZQWUVMOYGELO-UHFFFAOYSA-N (3,6-dichloro-2,4-dinitrophenyl) methyl carbonate Chemical compound C(OC1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])Cl)(OC)=O DCZQWUVMOYGELO-UHFFFAOYSA-N 0.000 description 2
- XZESDMPSRWWLJO-UHFFFAOYSA-N 3,6-dibromo-2,4-dinitrophenol Chemical compound BrC1=C(C(=C(C(=C1)[N+](=O)[O-])Br)[N+](=O)[O-])O XZESDMPSRWWLJO-UHFFFAOYSA-N 0.000 description 2
- 241001450781 Bipolaris oryzae Species 0.000 description 2
- 241000207199 Citrus Species 0.000 description 2
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 2
- 241000223218 Fusarium Species 0.000 description 2
- 241001330975 Magnaporthe oryzae Species 0.000 description 2
- 206010027146 Melanoderma Diseases 0.000 description 2
- 235000009754 Vitis X bourquina Nutrition 0.000 description 2
- 235000012333 Vitis X labruscana Nutrition 0.000 description 2
- 240000006365 Vitis vinifera Species 0.000 description 2
- 235000014787 Vitis vinifera Nutrition 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 235000020971 citrus fruits Nutrition 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 244000000004 fungal plant pathogen Species 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- TXSXJLMEOQAASX-QHHAFSJGSA-N phenyl (e)-but-2-enoate Chemical compound C\C=C\C(=O)OC1=CC=CC=C1 TXSXJLMEOQAASX-QHHAFSJGSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- IKGIEJXDCGZBBZ-NSCUHMNNSA-N (3,6-dichloro-2,4-dinitrophenyl) (e)-but-2-enoate Chemical compound C\C=C\C(=O)OC1=C(Cl)C=C([N+]([O-])=O)C(Cl)=C1[N+]([O-])=O IKGIEJXDCGZBBZ-NSCUHMNNSA-N 0.000 description 1
- ODIZMDIGNKMWJP-UHFFFAOYSA-N (3,6-dichloro-2,4-dinitrophenyl) propanoate Chemical compound C(CC)(=O)OC1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])Cl ODIZMDIGNKMWJP-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- FNAKEOXYWBWIRT-UHFFFAOYSA-N 2,3-dibromophenol Chemical class OC1=CC=CC(Br)=C1Br FNAKEOXYWBWIRT-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- UOUVTDNOZJGQGE-UHFFFAOYSA-N 3-chloro-3-phenylpropan-1-ol Chemical compound OCCC(Cl)C1=CC=CC=C1 UOUVTDNOZJGQGE-UHFFFAOYSA-N 0.000 description 1
- FAENHBAWJVITGP-UHFFFAOYSA-N 4,5-dichloro-2,3-dinitrophenol Chemical class Oc1cc(Cl)c(Cl)c(c1[N+]([O-])=O)[N+]([O-])=O FAENHBAWJVITGP-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000688200 Cingulata Species 0.000 description 1
- 241000407098 Colletotrichum coffeanum Species 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 241000371644 Curvularia ravenelii Species 0.000 description 1
- 241001645342 Diaporthe citri Species 0.000 description 1
- 241000663351 Diplocarpon rosae Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241001284615 Frangula californica Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241000223221 Fusarium oxysporum Species 0.000 description 1
- 241000235789 Hyperoartia Species 0.000 description 1
- 208000003351 Melanosis Diseases 0.000 description 1
- 241001555627 Melonis Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 241001626624 Nakataea sigmoidea Species 0.000 description 1
- 241000222291 Passalora fulva Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000233622 Phytophthora infestans Species 0.000 description 1
- 241000233629 Phytophthora parasitica Species 0.000 description 1
- 241000220324 Pyrus Species 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- 235000001630 Pyrus pyrifolia var culta Nutrition 0.000 description 1
- 244000079529 Pyrus serotina Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 235000016954 Ribes hudsonianum Nutrition 0.000 description 1
- 240000001890 Ribes hudsonianum Species 0.000 description 1
- 235000001466 Ribes nigrum Nutrition 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 235000004433 Simmondsia californica Nutrition 0.000 description 1
- 244000061458 Solanum melongena Species 0.000 description 1
- 235000002597 Solanum melongena Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- 241001006642 Venturia pyrina Species 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 235000002098 Vicia faba var. major Nutrition 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 231100000460 acute oral toxicity Toxicity 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- RNTDIPZSJWIRKY-UHFFFAOYSA-N butan-2-yl phenyl carbonate Chemical compound CCC(C)OC(=O)OC1=CC=CC=C1 RNTDIPZSJWIRKY-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 235000019219 chocolate Nutrition 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 231100001225 mammalian toxicity Toxicity 0.000 description 1
- ZEUVFLMEIVRYLW-UHFFFAOYSA-N methanol;phenyl acetate Chemical compound OC.CC(=O)OC1=CC=CC=C1 ZEUVFLMEIVRYLW-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- RBXVOQPAMPBADW-UHFFFAOYSA-N nitrous acid;phenol Chemical class ON=O.OC1=CC=CC=C1 RBXVOQPAMPBADW-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- AGUWUIVKDXDKBT-UHFFFAOYSA-N phenyl 2-chloroacetate Chemical compound ClCC(=O)OC1=CC=CC=C1 AGUWUIVKDXDKBT-UHFFFAOYSA-N 0.000 description 1
- YYHDAWBGVZLMAD-UHFFFAOYSA-N phenyl furan-2-carboxylate Chemical compound C=1C=COC=1C(=O)OC1=CC=CC=C1 YYHDAWBGVZLMAD-UHFFFAOYSA-N 0.000 description 1
- USVUMWSMZMQXIZ-UHFFFAOYSA-N phenyl heptanoate Chemical compound CCCCCCC(=O)OC1=CC=CC=C1 USVUMWSMZMQXIZ-UHFFFAOYSA-N 0.000 description 1
- SOOXQKVMQBCEGW-UHFFFAOYSA-N phenyl hexanoate Chemical compound CCCCCC(=O)OC1=CC=CC=C1 SOOXQKVMQBCEGW-UHFFFAOYSA-N 0.000 description 1
- KETKOCDCPHVSEN-UHFFFAOYSA-N phenyl propan-2-yl carbonate Chemical compound CC(C)OC(=O)OC1=CC=CC=C1 KETKOCDCPHVSEN-UHFFFAOYSA-N 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- AHIHJODVQGBOND-UHFFFAOYSA-N propan-2-yl hydrogen carbonate Chemical compound CC(C)OC(O)=O AHIHJODVQGBOND-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/43—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C329/00—Thiocarbonic acids; Halides, esters or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB40427/66A GB1190384A (en) | 1966-09-09 | 1966-09-09 | Dinitrodihalophenyl esters and fungicidal compositions containing them |
| GB4042666 | 1966-09-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28611A true IL28611A (en) | 1972-02-29 |
Family
ID=26264401
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28611A IL28611A (en) | 1966-09-09 | 1967-09-08 | Carbonates and esters of halo nitrophenols and fungicidal compositions containing same |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3759972A (cs) |
| CH (1) | CH489196A (cs) |
| CS (1) | CS155165B2 (cs) |
| DE (1) | DE1643457C3 (cs) |
| FR (1) | FR1550196A (cs) |
| GB (1) | GB1190384A (cs) |
| IL (1) | IL28611A (cs) |
| NL (1) | NL6712393A (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2315641A1 (de) * | 1973-03-29 | 1974-10-17 | Hoechst Ag | Akarizide dispersionen |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3052601A (en) * | 1956-07-10 | 1962-09-04 | Diamond Alkali Co | Phenolic lamprey larvicides |
| US2917534A (en) * | 1957-08-09 | 1959-12-15 | Dow Chemical Co | 2-nitro-3,4,6-trichlorophenyl alkyl carbonates |
| NL122364C (cs) * | 1960-05-30 | |||
| NL276256A (cs) * | 1961-03-22 |
-
1966
- 1966-09-09 GB GB40427/66A patent/GB1190384A/en not_active Expired
-
1967
- 1967-09-08 CS CS643767A patent/CS155165B2/cs unknown
- 1967-09-08 NL NL6712393A patent/NL6712393A/xx unknown
- 1967-09-08 FR FR1550196D patent/FR1550196A/fr not_active Expired
- 1967-09-08 DE DE1643457A patent/DE1643457C3/de not_active Expired
- 1967-09-08 IL IL28611A patent/IL28611A/en unknown
- 1967-09-11 CH CH1264167A patent/CH489196A/de not_active IP Right Cessation
-
1971
- 1971-01-14 US US00106551A patent/US3759972A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3759972A (en) | 1973-09-18 |
| NL6712393A (cs) | 1968-03-11 |
| DE1643457C3 (de) | 1974-04-04 |
| GB1190384A (en) | 1970-05-06 |
| CS155165B2 (cs) | 1974-05-30 |
| FR1550196A (cs) | 1968-12-20 |
| CH489196A (de) | 1970-04-30 |
| DE1643457B2 (de) | 1973-09-13 |
| DE1643457A1 (de) | 1972-04-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0104532B1 (en) | O-halobenzoic acid derivatives, process for their preparation, herbicidal compositions and their use | |
| US3328156A (en) | Method of controlling plant growth | |
| CA2103110C (en) | Insecticidal n'-substituted-n,n'-diacylhydrazines | |
| US3894078A (en) | 5-Acetamido-2,4-dimethyltrifluoromethanesulfonanilide | |
| US4005141A (en) | Perfluoroalkylsulfonamidoaryl compounds | |
| US3393064A (en) | Herbicidal composition and method | |
| EP0033614B1 (en) | Phenylalkanoic acid derivatives, processes for the preparation thereof and pharmaceutical compositions containing them | |
| US4091037A (en) | Preparation of alkylthiomethylphenols | |
| DK174496B1 (da) | Fremgangsmåde til fremstilling af 5-(2,5-dimethylphenoxy)-2,2-dimethylpentansyre | |
| US5464811A (en) | Benzene derivatives substituted with heterocyclic ring and herbicides containing same as active ingredients | |
| IL28611A (en) | Carbonates and esters of halo nitrophenols and fungicidal compositions containing same | |
| US4486601A (en) | Esters of 2-adamantanone oxime | |
| US4277624A (en) | Process for preparing diphenyl ethers | |
| Suzuki et al. | Synthesis and acaricidal activity of phenylpiperazine derivatives | |
| US5478849A (en) | Thiadiazole derivative, process for producing it and agricultural and horticultural fungicide using it as an active ingredient | |
| US3201410A (en) | Certain 3-aryl-2, 4-oxazolidine dione compounds | |
| GB1593932A (en) | Cycloalkane carboxanilides and their use as herbicides | |
| SU472506A3 (ru) | Способ получени производных морфолина | |
| US4435588A (en) | Herbicidal compounds, compositions, and method of use | |
| US4935053A (en) | Unsaturated haloacetanilides | |
| US2948720A (en) | Sulfonium compounds and their preparation | |
| Yoneyama et al. | Phytotoxic activity of N-benzylbenzenesulfonamides | |
| US3489772A (en) | Sulfonium salts and process of preparation thereof | |
| US4094900A (en) | Method of preparing aryloxybenzoic and arylthiobenzoic acids | |
| US4086255A (en) | Perfluoroalkylsulfonamidoaryl compounds |