IL26015A - N11-substituted pyridobenzodiazepines and their preparation - Google Patents
N11-substituted pyridobenzodiazepines and their preparationInfo
- Publication number
- IL26015A IL26015A IL26015A IL2601566A IL26015A IL 26015 A IL26015 A IL 26015A IL 26015 A IL26015 A IL 26015A IL 2601566 A IL2601566 A IL 2601566A IL 26015 A IL26015 A IL 26015A
- Authority
- IL
- Israel
- Prior art keywords
- pyridobenzodiazepines
- substituted
- preparation
- substituted pyridobenzodiazepines
- Prior art date
Links
- CJHKJXZMFZKGHI-UHFFFAOYSA-N 1h-pyrido[2,3-i][1,2]benzodiazepine Chemical class N1N=CC=CC2=CC=C(N=CC=C3)C3=C12 CJHKJXZMFZKGHI-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/12—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains three hetero rings
- C07D491/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US46644365A | 1965-06-23 | 1965-06-23 | |
| US466439A US3324116A (en) | 1965-06-23 | 1965-06-23 | Certain pyridobenzodiazepine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL26015A true IL26015A (en) | 1970-02-19 |
Family
ID=27041661
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL26015A IL26015A (en) | 1965-06-23 | 1966-06-22 | N11-substituted pyridobenzodiazepines and their preparation |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US3324116A (enExample) |
| BE (1) | BE682971A (enExample) |
| DE (1) | DE1695080A1 (enExample) |
| DK (1) | DK114777B (enExample) |
| GB (1) | GB1083278A (enExample) |
| IL (1) | IL26015A (enExample) |
| NL (2) | NL6608673A (enExample) |
| NO (1) | NO120581B (enExample) |
| SE (1) | SE326189B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL131484C (enExample) * | 1965-06-23 | |||
| US3860600A (en) * | 1972-07-10 | 1975-01-14 | Sterling Drug Inc | Octahydropyrrido{8 2,1-c{9 {8 1,4{9 benzodiazepines |
| US3947408A (en) * | 1974-08-05 | 1976-03-30 | American Cyanamid Company | Pyrrolo-benzodiazepines, method of preparation and method of use |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3150125A (en) * | 1959-09-22 | 1964-09-22 | Wander Ag Dr A | 5-(basic substituted)-10, 11-dihydro-11-oxo-5h-dibenzo[b, e][1, 4]diazepine compounds |
| US3297755A (en) * | 1960-12-02 | 1967-01-10 | Hoffmann La Roche | 2-chloro-5-trifluoromethylbenzo-phenone compounds |
| US3300504A (en) * | 1964-01-06 | 1967-01-24 | Geigy Chem Corp | Lower alkyl esters of (substituted) benzyl pipecolinic acid and derivatives thereof |
| NL131484C (enExample) * | 1965-06-23 |
-
0
- NL NL131484D patent/NL131484C/xx active
-
1965
- 1965-06-23 US US466439A patent/US3324116A/en not_active Expired - Lifetime
- 1965-06-23 US US466443A patent/US3483187A/en not_active Expired - Lifetime
-
1966
- 1966-06-22 NL NL6608673A patent/NL6608673A/xx unknown
- 1966-06-22 DK DK320466AA patent/DK114777B/da unknown
- 1966-06-22 NO NO66163597A patent/NO120581B/no unknown
- 1966-06-22 DE DE19661695080 patent/DE1695080A1/de active Pending
- 1966-06-22 IL IL26015A patent/IL26015A/xx unknown
- 1966-06-22 GB GB27821/66A patent/GB1083278A/en not_active Expired
- 1966-06-22 BE BE682971D patent/BE682971A/xx unknown
- 1966-06-22 SE SE08539/66A patent/SE326189B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1695080A1 (de) | 1970-12-10 |
| SE326189B (enExample) | 1970-07-20 |
| GB1083278A (en) | 1967-09-13 |
| BE682971A (enExample) | 1966-12-22 |
| US3324116A (en) | 1967-06-06 |
| DK114777B (da) | 1969-08-04 |
| NO120581B (enExample) | 1970-11-09 |
| NL131484C (enExample) | |
| US3483187A (en) | 1969-12-09 |
| NL6608673A (enExample) | 1966-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL24787A (en) | 4-aryl-isoflavanoids and their preparation | |
| IL26812A (en) | 1-benzoylpropyl-4-phenyl-piperidin-4-ol derivatives and their preparation | |
| IL34501A (en) | Penicillins and their preparation | |
| IL28433A (en) | 2-phenylhydrazino-imidazolines and processes for their preparation | |
| IL30973A0 (en) | Omikron-isopropylaminobenzophenones and their preparation | |
| IL30267A (en) | Ketonitriles and their preparation | |
| MY7200042A (en) | 3-(piperazinoalkyl)-pyrazoles and their preparation | |
| IL32436A0 (en) | 1-carbamoyl-3-aroylpyrrolidines and their preparation | |
| IL32810A0 (en) | 3-amino-and 3-acylamino-isothiazoles and their preparation | |
| IL22697A (en) | Pyrazino-isoquinoline derivatives and their preparation | |
| IL26625A (en) | Thiadiazoles and their preparation | |
| IL23236A (en) | Dibenzocycloheptadiene derivatives and their preparation | |
| IL26015A (en) | N11-substituted pyridobenzodiazepines and their preparation | |
| IL25976A (en) | Dibenzocycloheptatriene derivatives and their preparation | |
| IL32335A (en) | 6-amino-1-vinyl-1-tetralols and their preparation | |
| IL34853A (en) | 4'-demethyl-epipodophyllotoxin-beta-d-glucoside and its preparation | |
| IL39118A (en) | 2-allyloxy-3-methoxybenzamides and their preparation | |
| MY7000048A (en) | Substituted piperazines and preparation thereof | |
| IL23628A (en) | Dibenzocycloheptadiene derivatives and their preparation | |
| IL30022A0 (en) | Ethinyl-substituted 1-phenoxy-2-hydroxy-3-alkylaminopropanes and their preparation | |
| IL26626A (en) | Sulfathiadiazoles and their production | |
| IL28258A (en) | 16-methyl-4-pregnen-3beta-ol-20-ones and their preparation | |
| CY536A (en) | Vaccine and its preparation | |
| IL33252A0 (en) | Quinoxaline-di-n-oxide-lactones and their preparation | |
| IL27674A (en) | 1-sulphanilyl-2-imino-imidazolidine derivatives and their preparation |