IL25416A - 2-(ethylamino)-2-(2-thienyl)cyclohexanone - Google Patents
2-(ethylamino)-2-(2-thienyl)cyclohexanoneInfo
- Publication number
- IL25416A IL25416A IL25416A IL2541666A IL25416A IL 25416 A IL25416 A IL 25416A IL 25416 A IL25416 A IL 25416A IL 2541666 A IL2541666 A IL 2541666A IL 25416 A IL25416 A IL 25416A
- Authority
- IL
- Israel
- Prior art keywords
- ethylamino
- cyclohexanone
- thienyl
- Prior art date
Links
- QAXBVGVYDCAVLV-UHFFFAOYSA-N tiletamine Chemical compound C=1C=CSC=1C1(NCC)CCCCC1=O QAXBVGVYDCAVLV-UHFFFAOYSA-N 0.000 title 2
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44136865A | 1965-03-19 | 1965-03-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL25416A true IL25416A (en) | 1969-09-25 |
Family
ID=23752605
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL25416A IL25416A (en) | 1965-03-19 | 1966-03-18 | 2-(ethylamino)-2-(2-thienyl)cyclohexanone |
Country Status (11)
| Country | Link |
|---|---|
| BE (1) | BE678092A (cs) |
| BR (1) | BR6677981D0 (cs) |
| CH (2) | CH457500A (cs) |
| DE (1) | DE1300953B (cs) |
| DK (1) | DK112246B (cs) |
| ES (1) | ES324380A1 (cs) |
| FR (2) | FR1471911A (cs) |
| GB (1) | GB1065188A (cs) |
| IL (1) | IL25416A (cs) |
| NL (1) | NL145238B (cs) |
| SE (2) | SE325584B (cs) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL294634A (cs) * | 1963-06-28 |
-
1966
- 1966-03-18 IL IL25416A patent/IL25416A/xx unknown
- 1966-03-18 ES ES0324380A patent/ES324380A1/es not_active Expired
- 1966-03-18 NL NL666603587A patent/NL145238B/xx not_active IP Right Cessation
- 1966-03-18 GB GB12161/66A patent/GB1065188A/en not_active Expired
- 1966-03-18 FR FR54138A patent/FR1471911A/fr not_active Expired
- 1966-03-18 SE SE03596/66A patent/SE325584B/xx unknown
- 1966-03-18 BR BR177981/66A patent/BR6677981D0/pt unknown
- 1966-03-18 CH CH252468A patent/CH457500A/fr unknown
- 1966-03-18 DE DEP39011A patent/DE1300953B/de active Pending
- 1966-03-18 BE BE678092D patent/BE678092A/xx not_active IP Right Cessation
- 1966-03-18 CH CH394366A patent/CH453384A/fr unknown
- 1966-03-18 DK DK143466AA patent/DK112246B/da unknown
- 1966-06-14 FR FR65371A patent/FR5589M/fr not_active Expired
-
1968
- 1968-02-15 SE SE01975/68A patent/SE325585B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR5589M (cs) | 1967-12-04 |
| SE325584B (cs) | 1970-07-06 |
| DE1300953B (de) | 1969-08-14 |
| NL145238B (nl) | 1975-03-17 |
| CH453384A (fr) | 1968-06-14 |
| ES324380A1 (es) | 1967-02-01 |
| GB1065188A (en) | 1967-04-12 |
| BR6677981D0 (pt) | 1973-09-11 |
| SE325585B (cs) | 1970-07-06 |
| CH457500A (fr) | 1968-06-15 |
| NL6603587A (cs) | 1966-09-20 |
| DK112246B (da) | 1968-11-25 |
| FR1471911A (fr) | 1967-03-03 |
| BE678092A (cs) | 1966-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR1465560A (fr) | Bidon | |
| FI54660C (fi) | Faergtelevisionsbildroer foersett med en vaesentligen rektangulaer haolmask | |
| CH438397A (fr) | Balayeuse | |
| AT289497B (de) | Elektromagnetischer Stoßvibrator | |
| CH451985A (de) | Kehrmaschine | |
| FI53488C (fi) | Borrbom med parallellfoeringslaenkorgan | |
| CH443087A (de) | Ergometer | |
| CH472707A (fr) | Cliché électrophotographique | |
| CH444659A (de) | Kamera | |
| ZA702577B (en) | 2-(5-nitro-2-imidazolyl)-benzimidazoles | |
| BR6677439D0 (pt) | Compostos homociclicos | |
| FR1459879A (fr) | Ski métallique | |
| FR1502275A (fr) | Duromètre | |
| IL25416A (en) | 2-(ethylamino)-2-(2-thienyl)cyclohexanone | |
| FI53642C (fi) | Korsningspunktnaet foersett med testanordningar | |
| BR6906788D0 (pt) | 2-(1-subtituidas-3-pirrolidinil)-isoindolinas | |
| FR1478335A (fr) | Alambic perfectionné | |
| CA791739A (en) | 2-(ethylamino)-2-(2-thienyl) cyclohexanone | |
| IT941615B (it) | Bigodino per permanente | |
| CA791740A (en) | 2-(ethylamino)-2-(2-thienyl)-cyclohexanone | |
| CA718397A (en) | 2-(o-halophenyl)-benzimidazoles | |
| AU435828B2 (en) | 2-(oxothiazolyl)-benzimidazoles | |
| FR1469087A (fr) | Ergomètre perfectionné | |
| FI53668C (fi) | Krutkraftdriven bultpistol med kardusmagasin | |
| FR1431376A (fr) | Cyclone |