IL24824A - N-arylsulphonyl-2-oxo-piperidine-1-carboxamides and hetero-ring homologues thereof - Google Patents
N-arylsulphonyl-2-oxo-piperidine-1-carboxamides and hetero-ring homologues thereofInfo
- Publication number
- IL24824A IL24824A IL24824A IL2482465A IL24824A IL 24824 A IL24824 A IL 24824A IL 24824 A IL24824 A IL 24824A IL 2482465 A IL2482465 A IL 2482465A IL 24824 A IL24824 A IL 24824A
- Authority
- IL
- Israel
- Prior art keywords
- general formula
- organic
- salts
- hetero
- formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 239000012948 isocyanate Substances 0.000 claims description 3
- 150000002513 isocyanates Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000001246 bromo group Chemical class Br* 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000008298 dragée Substances 0.000 description 4
- 244000061456 Solanum tuberosum Species 0.000 description 3
- 235000002595 Solanum tuberosum Nutrition 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- ONNDGYXYNGPSJT-UHFFFAOYSA-N 2,2-diethyl-1,4-dioxane Chemical compound CCC1(CC)COCCO1 ONNDGYXYNGPSJT-UHFFFAOYSA-N 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 241001466453 Laminaria Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 150000003951 lactams Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical compound O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/27—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
- C07D211/76—Oxygen atoms attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/06—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing isoquinuclidine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Wing Frames And Configurations (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1638664A CH440278A (de) | 1964-12-18 | 1964-12-18 | Verfahren zur Herstellung von neuen N'-substituierten N-Arylsulfonylharnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL24824A true IL24824A (en) | 1969-07-30 |
Family
ID=4416912
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL24824A IL24824A (en) | 1964-12-18 | 1965-12-17 | N-arylsulphonyl-2-oxo-piperidine-1-carboxamides and hetero-ring homologues thereof |
Country Status (11)
| Country | Link |
|---|---|
| AT (1) | AT256123B (de) |
| BE (1) | BE673985A (de) |
| BR (1) | BR6575819D0 (de) |
| CH (1) | CH440278A (de) |
| DK (1) | DK109201C (de) |
| ES (1) | ES320858A1 (de) |
| FR (2) | FR1481062A (de) |
| GB (1) | GB1057978A (de) |
| IL (1) | IL24824A (de) |
| NL (1) | NL6516499A (de) |
| NO (1) | NO118558B (de) |
-
1964
- 1964-12-18 CH CH1638664A patent/CH440278A/de unknown
-
1965
- 1965-12-17 DK DK647665AA patent/DK109201C/da active
- 1965-12-17 BR BR175819/65A patent/BR6575819D0/pt unknown
- 1965-12-17 BE BE673985A patent/BE673985A/xx unknown
- 1965-12-17 GB GB53563/65A patent/GB1057978A/en not_active Expired
- 1965-12-17 ES ES0320858A patent/ES320858A1/es not_active Expired
- 1965-12-17 NL NL6516499A patent/NL6516499A/xx unknown
- 1965-12-17 FR FR42803A patent/FR1481062A/fr not_active Expired
- 1965-12-17 NO NO160963A patent/NO118558B/no unknown
- 1965-12-17 AT AT1137165A patent/AT256123B/de active
- 1965-12-17 IL IL24824A patent/IL24824A/en unknown
-
1966
- 1966-03-16 FR FR53701A patent/FR5419M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES320858A1 (es) | 1966-09-01 |
| FR1481062A (fr) | 1967-05-19 |
| NO118558B (de) | 1970-01-12 |
| BE673985A (de) | 1966-06-17 |
| NL6516499A (de) | 1966-06-20 |
| DK109201C (da) | 1968-04-01 |
| CH440278A (de) | 1967-07-31 |
| FR5419M (de) | 1967-10-02 |
| GB1057978A (en) | 1967-02-08 |
| AT256123B (de) | 1967-08-10 |
| BR6575819D0 (pt) | 1973-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL34026A (en) | 10-oxo-10,11-dihydro-5h-dibenz(b,f)azepine-5-carboxamide,its production and pharmaceutical preparations containing it | |
| US3726897A (en) | 1,2,3,8-tetrahydrodibenzo(3,4:6,7)cyclohepta(1,2-c)pyrroles as cns-depressants | |
| US3716639A (en) | Anorexigenic tetrahydrobenzazepines | |
| IL30458A (en) | 6-chloro-2,3,4,5-tetrahydro-1h-3-benzazepine,its preparation and compositions containing it | |
| US3752892A (en) | Anorexigenic tetrahydrobenzazepine derivative method and composition thereof | |
| IL24824A (en) | N-arylsulphonyl-2-oxo-piperidine-1-carboxamides and hetero-ring homologues thereof | |
| US4232158A (en) | 10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5,10-imines | |
| US3185679A (en) | Azepine derivatives | |
| US3755357A (en) | 2,3 - dihydro - 5-trifluoromethyl-1h-di-benzo(2,3:6,7)thiepino(4,5-c)pyrroles as cns-depressants | |
| US3634426A (en) | Pyrimido( 2-a)indoles and diazepino (1 12-a)indoles | |
| US3917634A (en) | 1-(2,6-Dimethyl-2-octen-8-yl)-2-substituted or unsubstituted phenylimidazoles | |
| US3597445A (en) | 1h-isoinodle intermediates | |
| IL39883A (en) | 2-aminomethyl-6-phenyl-4h-s-triazolo(1,5-alpha)(1,4)benzodiazepine derivatives,their production and pharmaceutical compositions containing them | |
| US3910947A (en) | Preparation of imidazo{8 2,1-a{9 isoindoles | |
| US3535313A (en) | N'-substituted n-arylsulfonyl urea | |
| US3505314A (en) | N-heterocyclic compounds | |
| US3755360A (en) | 2,3,4,5-tetrahydro-7h-(1,3)diazepino-(2,1-a)isoindoles | |
| US3518307A (en) | Cyclohexenyl amines | |
| US3709913A (en) | N-thienylalkyl-beta-alkoxy-trifluoro-methylphenalkylamines | |
| US3689649A (en) | N-substituted n-arylsulfonyl ureas for producing a hypoglycaemic effect | |
| US3547954A (en) | 1-substituted 3-arylsulfonyl ureas | |
| JPS5989666A (ja) | ５Ｈ−ジベンゾ〔ｂ，ｆ〕アゼピン−５−カルボキサミド、その製造方法、及びそれを含む医薬用調製物 | |
| US3859285A (en) | 10, 11-dihydro-5h-benzo (4,5) cyclohepta (1,2-b) pyrazines | |
| US3663567A (en) | N-substituted cycloalkanoindoles | |
| US3772378A (en) | 7-oxo-benzocycloheptene acetic acids |