IL23870A - 2-methoxy-3,6-dichlorobenzyl alcohol and its esters,having aphidicidal and herbicidal activity and process for preparing same - Google Patents
2-methoxy-3,6-dichlorobenzyl alcohol and its esters,having aphidicidal and herbicidal activity and process for preparing sameInfo
- Publication number
- IL23870A IL23870A IL23870A IL2387065A IL23870A IL 23870 A IL23870 A IL 23870A IL 23870 A IL23870 A IL 23870A IL 2387065 A IL2387065 A IL 2387065A IL 23870 A IL23870 A IL 23870A
- Authority
- IL
- Israel
- Prior art keywords
- methoxy
- dichlorobenzyl
- group
- alcohol
- compound
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 9
- ALPTWNJSENXENZ-UHFFFAOYSA-N (3,6-dichloro-2-methoxyphenyl)methanol Chemical compound COC1=C(Cl)C=CC(Cl)=C1CO ALPTWNJSENXENZ-UHFFFAOYSA-N 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title description 4
- 150000002148 esters Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 37
- 241000196324 Embryophyta Species 0.000 claims description 36
- 239000000203 mixture Substances 0.000 claims description 21
- -1 2-Methoxy-3, 6-dichlorobenzyl benzoate Chemical compound 0.000 claims description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 231100000331 toxic Toxicity 0.000 claims description 5
- 230000002588 toxic effect Effects 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 3
- FKIKPQHMWFZFEB-UHFFFAOYSA-N 3,6-dichloro-2-hydroxybenzoic acid Chemical compound OC(=O)C1=C(O)C(Cl)=CC=C1Cl FKIKPQHMWFZFEB-UHFFFAOYSA-N 0.000 claims description 3
- AWSBKDYHGOOSML-UHFFFAOYSA-N dicamba-methyl Chemical compound COC(=O)C1=C(Cl)C=CC(Cl)=C1OC AWSBKDYHGOOSML-UHFFFAOYSA-N 0.000 claims description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 claims description 3
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- MOOSUOOFKNOHEU-UHFFFAOYSA-N (3,6-dichloro-2-methoxyphenyl)methyl 2,2-dichloroacetate Chemical compound ClC(C(=O)OCC1=C(C(=CC=C1Cl)Cl)OC)Cl MOOSUOOFKNOHEU-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 claims 1
- 230000000266 injurious effect Effects 0.000 claims 1
- YYPUSXWRDIQUQE-UHFFFAOYSA-N phenoxymethanethioic s-acid Chemical compound OC(=S)OC1=CC=CC=C1 YYPUSXWRDIQUQE-UHFFFAOYSA-N 0.000 claims 1
- 238000012360 testing method Methods 0.000 description 21
- 229940126062 Compound A Drugs 0.000 description 15
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 15
- 239000007788 liquid Substances 0.000 description 15
- 208000027418 Wounds and injury Diseases 0.000 description 14
- 230000006378 damage Effects 0.000 description 14
- 208000014674 injury Diseases 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000126 substance Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000002689 soil Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 5
- 206010061217 Infestation Diseases 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 240000006122 Chenopodium album Species 0.000 description 4
- 235000009344 Chenopodium album Nutrition 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000000428 dust Substances 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 3
- 235000004135 Amaranthus viridis Nutrition 0.000 description 3
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 3
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 244000025670 Eleusine indica Species 0.000 description 3
- 235000014716 Eleusine indica Nutrition 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 244000056139 Brassica cretica Species 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 2
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 2
- 235000005476 Digitaria cruciata Nutrition 0.000 description 2
- 235000006830 Digitaria didactyla Nutrition 0.000 description 2
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- NSXKVMCVAPWBAV-UHFFFAOYSA-N butanethioyl chloride Chemical compound CCCC(Cl)=S NSXKVMCVAPWBAV-UHFFFAOYSA-N 0.000 description 2
- 244000038559 crop plants Species 0.000 description 2
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- MXZBXCKWSHEHAP-UHFFFAOYSA-N ethanethioyl chloride Chemical compound CC(Cl)=S MXZBXCKWSHEHAP-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 244000144972 livestock Species 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- WTBAHSZERDXKKZ-UHFFFAOYSA-N octadecanoyl chloride Chemical compound CCCCCCCCCCCCCCCCCC(Cl)=O WTBAHSZERDXKKZ-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- QCMHWZUFWLOOGI-UHFFFAOYSA-N s-ethyl chloromethanethioate Chemical compound CCSC(Cl)=O QCMHWZUFWLOOGI-UHFFFAOYSA-N 0.000 description 2
- 208000037974 severe injury Diseases 0.000 description 2
- 230000009528 severe injury Effects 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 2
- FBZWYFBNIGSUPS-UHFFFAOYSA-N (2-chlorophenyl) ethaneperoxoate Chemical compound CC(=O)OOC1=CC=CC=C1Cl FBZWYFBNIGSUPS-UHFFFAOYSA-N 0.000 description 1
- LBFDHCJMQGDGQX-UHFFFAOYSA-N (3,6-dichloro-2-methoxyphenyl)methyl acetate Chemical compound C(C)(=O)OCC1=C(C(=CC=C1Cl)Cl)OC LBFDHCJMQGDGQX-UHFFFAOYSA-N 0.000 description 1
- IIDOUJAZIBWROI-UHFFFAOYSA-N (3,6-dichloro-2-methoxyphenyl)methyl propanoate Chemical compound C(CC)(=O)OCC1=C(C(=CC=C1Cl)Cl)OC IIDOUJAZIBWROI-UHFFFAOYSA-N 0.000 description 1
- AZFAIOQVEYTPKD-UHFFFAOYSA-N 2-(2,4,5-trichlorophenoxy)acetyl chloride Chemical compound ClC(=O)COC1=CC(Cl)=C(Cl)C=C1Cl AZFAIOQVEYTPKD-UHFFFAOYSA-N 0.000 description 1
- FUJSJWRORKKPAI-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetyl chloride Chemical compound ClC(=O)COC1=CC=C(Cl)C=C1Cl FUJSJWRORKKPAI-UHFFFAOYSA-N 0.000 description 1
- ABYSGRXBGLVRGO-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)acetyl chloride Chemical compound CC1=CC(Cl)=CC=C1OCC(Cl)=O ABYSGRXBGLVRGO-UHFFFAOYSA-N 0.000 description 1
- LLUYGIUJQSTELT-UHFFFAOYSA-N 3,6-dichloro-2-methoxybenzoyl chloride Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(Cl)=O LLUYGIUJQSTELT-UHFFFAOYSA-N 0.000 description 1
- 241000253994 Acyrthosiphon pisum Species 0.000 description 1
- 235000003130 Arctium lappa Nutrition 0.000 description 1
- 240000005528 Arctium lappa Species 0.000 description 1
- 235000011292 Brassica rapa Nutrition 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 241000217446 Calystegia sepium Species 0.000 description 1
- 241000421296 Cerastium arvense Species 0.000 description 1
- 235000005918 Cirsium arvense Nutrition 0.000 description 1
- 240000001579 Cirsium arvense Species 0.000 description 1
- 244000272323 Cirsium lanceolatum Species 0.000 description 1
- 235000010856 Cirsium lanceolatum Nutrition 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002206 Daucus carota subsp carota Nutrition 0.000 description 1
- 240000003173 Drymaria cordata Species 0.000 description 1
- 241001479540 Echium vulgare Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- 235000000060 Malva neglecta Nutrition 0.000 description 1
- 240000000982 Malva neglecta Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000016499 Oxalis corniculata Nutrition 0.000 description 1
- 240000007001 Rumex acetosella Species 0.000 description 1
- 235000015761 Rumex acetosella Nutrition 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- 235000001155 Setaria leucopila Nutrition 0.000 description 1
- 244000010062 Setaria pumila Species 0.000 description 1
- 241000511959 Silene latifolia subsp. alba Species 0.000 description 1
- 240000007807 Sisymbrium officinale Species 0.000 description 1
- 240000002439 Sorghum halepense Species 0.000 description 1
- 235000008214 Thlaspi arvense Nutrition 0.000 description 1
- 240000008488 Thlaspi arvense Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 235000010599 Verbascum thapsus Nutrition 0.000 description 1
- 244000178289 Verbascum thapsus Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- MNUYNGXMQRGJSJ-UHFFFAOYSA-N benzenecarbothioyl chloride Chemical compound ClC(=S)C1=CC=CC=C1 MNUYNGXMQRGJSJ-UHFFFAOYSA-N 0.000 description 1
- 235000005770 birds nest Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-M chloroacetate Chemical compound [O-]C(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-M 0.000 description 1
- 229940089960 chloroacetate Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000009526 moderate injury Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 235000003513 sheep sorrel Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 229940066528 trichloroacetate Drugs 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 235000005765 wild carrot Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C329/00—Thiocarbonic acids; Halides, esters or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US34737064A | 1964-02-26 | 1964-02-26 | |
| US382337A US3334125A (en) | 1964-02-26 | 1964-07-13 | Esters of 3-6-dichloro-2-methoxy-benzyl alcohol |
| US394317A US3356737A (en) | 1964-02-26 | 1964-09-03 | Methoxy chlorobenzyl alcohols |
| US640846A US3393064A (en) | 1964-02-26 | 1967-05-24 | Herbicidal composition and method |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL23870A true IL23870A (en) | 1970-01-29 |
Family
ID=33314424
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL23870A IL23870A (en) | 1964-02-26 | 1965-07-02 | 2-methoxy-3,6-dichlorobenzyl alcohol and its esters,having aphidicidal and herbicidal activity and process for preparing same |
Country Status (8)
| Country | Link |
|---|---|
| US (3) | US3334125A (xx) |
| BE (1) | BE666778A (xx) |
| BR (1) | BR6571247D0 (xx) |
| CH (1) | CH467016A (xx) |
| DE (1) | DE1518432B2 (xx) |
| GB (1) | GB1101396A (xx) |
| IL (1) | IL23870A (xx) |
| NL (1) | NL6508958A (xx) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4242122A (en) * | 1970-10-02 | 1980-12-30 | Monsanto Company | Herbicidal meta-bifunctional benzenes |
| US3969403A (en) * | 1973-06-22 | 1976-07-13 | Celamerck Gmbh & Co. Kg | Process for preparation of 2-methoxy-3,6-dichloro-benzoic acid |
| FR2297201A1 (fr) * | 1975-01-10 | 1976-08-06 | Thomson Csf | Produits mesogenes pour cellules a cristal liquide, et procede de fabrication desdits produits |
| DE2843184A1 (de) * | 1978-10-04 | 1980-04-24 | Hoechst Ag | Verfahren zur herstellung von (phenoxi- bzw. benzyl)-phenoxipropionsaeuremethylestern |
| US4780251A (en) * | 1984-07-27 | 1988-10-25 | Hoffman-La Roche Inc. | Phenyl substituted-2,4,6,8-nonatetraenoic acid |
| US4883614A (en) * | 1984-07-27 | 1989-11-28 | Hoffman-La Roche Inc. | Phenyl substituted-2,4,6,8-nonatetraenoic acid |
| US4648996A (en) * | 1984-07-27 | 1987-03-10 | Hoffmann-La Roche Inc. | Phenyl substituted-2,4,6,8-nonatetraenoic acid |
| US4883613A (en) * | 1984-07-27 | 1989-11-28 | Hoffmann-La Roche Inc. | Phenyl substituted-2,4,6,8-nonatetraenoic acid |
| US4894480A (en) * | 1984-07-27 | 1990-01-16 | Hoffmann-La Roche Inc. | Phenyl substituted-2,4,6,8-nonatetraenoic acid |
| ZA854828B (en) * | 1984-07-27 | 1986-03-26 | Hoffmann La Roche | Phenyl nonatetraenoic acid derivatives |
| US5001256A (en) * | 1988-11-18 | 1991-03-19 | Ici Americas Inc. | Trisubstituted benzoic acid intermediates |
| US5073642A (en) * | 1988-11-18 | 1991-12-17 | Ici Americas Inc. | Trisubstituted benzoic acid intermediates |
| US5068423A (en) * | 1988-11-18 | 1991-11-26 | Ici Americas Inc. | Trisubstituted benzoic acid intermediates |
| US5075497A (en) * | 1988-11-18 | 1991-12-24 | Ici Americas, Inc. | Trisubstituted benzoic acid intermediates |
| US5047572A (en) * | 1988-11-18 | 1991-09-10 | Ici Americas Inc. | Trisubstituted benzoic acid intermediates |
| WO2015075087A1 (en) * | 2013-11-21 | 2015-05-28 | Basf Se | Process for selective chlorination of salicylic acid derivatives |
| US10725055B1 (en) * | 2016-04-15 | 2020-07-28 | University Of Oregon | Compounds for carbonyl sulfide/carbon disulfide/hydrogen sulfide release and methods of making and using the same |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA566562A (en) * | 1958-11-25 | The Dow Chemical Company | Polychlorosaligenin esters of 2,2-dichloropropionic acid | |
| US2327338A (en) * | 1939-12-13 | 1943-08-24 | Monsanto Chemicals | Insect control |
| US2394916A (en) * | 1945-05-31 | 1946-02-12 | American Chem Paint Co | Methods and compositions for killing weeds |
| US2615823A (en) * | 1950-03-30 | 1952-10-28 | Niagara Alkali Company | Bactericidal and fungicidal composition |
| US2861097A (en) * | 1956-11-02 | 1958-11-18 | Dow Chemical Co | Benzyl esters of polychloroaliphatic monocarboxylic acids |
| US3158645A (en) * | 1958-02-13 | 1964-11-24 | Hooker Chemical Corp | 2, 3, 6-trichlorobenzyl-2, 4-dichlorophenoxy-acetate |
| US3020146A (en) * | 1958-09-22 | 1962-02-06 | Velsicol Chemical Corp | Method of destroying undesirable plants |
| US3013057A (en) * | 1958-10-13 | 1961-12-12 | Velsicol Chemical Corp | 2-methoxy-3, 5-dichlorophenylacetates |
| NL112201C (xx) * | 1958-10-15 | |||
| US3336131A (en) * | 1966-09-26 | 1967-08-15 | Hooker Chemical Corp | Method of controlling plant growth |
-
1964
- 1964-07-13 US US382337A patent/US3334125A/en not_active Expired - Lifetime
- 1964-09-03 US US394317A patent/US3356737A/en not_active Expired - Lifetime
-
1965
- 1965-06-30 GB GB27802/65A patent/GB1101396A/en not_active Expired
- 1965-07-02 IL IL23870A patent/IL23870A/en unknown
- 1965-07-12 BE BE666778D patent/BE666778A/xx unknown
- 1965-07-12 DE DE1965V0028866 patent/DE1518432B2/de active Granted
- 1965-07-12 NL NL6508958A patent/NL6508958A/xx unknown
- 1965-07-13 BR BR171247/65A patent/BR6571247D0/pt unknown
- 1965-07-13 CH CH980465A patent/CH467016A/de unknown
-
1967
- 1967-05-24 US US640846A patent/US3393064A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH467016A (de) | 1969-01-15 |
| DE1518432B2 (de) | 1976-04-22 |
| DE1518432A1 (de) | 1969-06-26 |
| US3356737A (en) | 1967-12-05 |
| US3393064A (en) | 1968-07-16 |
| NL6508958A (xx) | 1966-01-14 |
| GB1101396A (en) | 1968-01-31 |
| BR6571247D0 (pt) | 1973-09-20 |
| US3334125A (en) | 1967-08-01 |
| BE666778A (xx) | 1966-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4551547A (en) | Biocidal 2-aryl-1, 3-cyclopentanedione enol ester compounds | |
| US4283348A (en) | Method of preparing 2-aryl-3-cyclopentanedione compounds | |
| US4659372A (en) | Biocidal 2-aryl-1,3-cyclohexanedione enol ester compounds | |
| US4526723A (en) | Biocidal enol esters of non-ortho substituted 2-aryl-1-3-cycloalkanedione compounds | |
| US4314069A (en) | Herbicidal compound, herbicidal composition containing the same, and method of use thereof | |
| IL23870A (en) | 2-methoxy-3,6-dichlorobenzyl alcohol and its esters,having aphidicidal and herbicidal activity and process for preparing same | |
| US4632698A (en) | Biocidal 2-aryl-1,3-cyclopentanedione enol ester compounds | |
| EP0269656A1 (en) | NEW MALONIC ACID DERIVATIVES AND COMPOSITIONS CONTAINING IT TO DELAY PLANT GROWTH. | |
| US3187042A (en) | N-alkoxy benzamides | |
| US3168561A (en) | N-alkoxy 2-alkyl-4-chlorophenoxyacetamides for the control of pests | |
| US3371106A (en) | Acetyl substituted phenoxyacetamides and their use as herbicides | |
| US3301885A (en) | Phenyl nu-hydrocarboxy nu-hydrocarbyl thiocarbamates | |
| US3370108A (en) | O-ethyl-o-phenyl-s-(n-methoxy-n-iso-propylacetamido)-dithiophosphate | |
| US3005828A (en) | Phenoxyacetoxy-butyne-2 derivatives | |
| US3166591A (en) | Phenoxyacetamides for the control of pests | |
| US3385689A (en) | Method of controlling undesirable plant growth | |
| US3306726A (en) | Method for the control of weeds | |
| US3212873A (en) | Di-(n-alkoxy) amides of 2, 3, 5, 6-tetrachloroterephthalic acid | |
| US3296292A (en) | Esters and amides of 2, 3, 5, 6-tetrachloromonothioterephthalic acid | |
| US3333945A (en) | Herbicidal composition and method | |
| EP0093384A1 (en) | Thiophene derivatives and fungicidal composition containing the same | |
| US2861096A (en) | 2, 3, 6-trichlorobenzyl esters of chloroacetic acids | |
| US3446613A (en) | N-alkanoyloxyphenoxyalkanamides as herbicides | |
| US2815365A (en) | Neutral polychloro-aliphatic acid esters of polyhydroxyphenols | |
| US3352897A (en) | Nu-alkoxy amides of 4-halophenoxyalkylcarboxy acids |