IL22473A - Phenyl-piperidyl-indane,-hydro-naphthalene,-benzosuberone and-thionaphthene derivatives and their preparation - Google Patents
Phenyl-piperidyl-indane,-hydro-naphthalene,-benzosuberone and-thionaphthene derivatives and their preparationInfo
- Publication number
- IL22473A IL22473A IL22473A IL2247364A IL22473A IL 22473 A IL22473 A IL 22473A IL 22473 A IL22473 A IL 22473A IL 2247364 A IL2247364 A IL 2247364A IL 22473 A IL22473 A IL 22473A
- Authority
- IL
- Israel
- Prior art keywords
- benzosuberone
- indane
- piperidyl
- hydro
- naphthalene
- Prior art date
Links
- YMBIDUXQVRDORG-UHFFFAOYSA-N 1-(1-phenyl-2,3-dihydroinden-1-yl)piperidine Chemical compound C1(=CC=CC=C1)C1(CCC2=CC=CC=C12)N1CCCCC1 YMBIDUXQVRDORG-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/92—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with a hetero atom directly attached to the ring nitrogen atom
- C07D211/94—Oxygen atom, e.g. piperidine N-oxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEM0059180 | 1963-12-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL22473A true IL22473A (en) | 1968-08-22 |
Family
ID=7309459
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL22473A IL22473A (en) | 1963-12-07 | 1964-11-18 | Phenyl-piperidyl-indane,-hydro-naphthalene,-benzosuberone and-thionaphthene derivatives and their preparation |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3328411A (fr) |
| BE (1) | BE656720A (fr) |
| BR (1) | BR6465106D0 (fr) |
| CH (1) | CH460771A (fr) |
| DE (1) | DE1470055A1 (fr) |
| FR (1) | FR4098M (fr) |
| GB (1) | GB1039450A (fr) |
| IL (1) | IL22473A (fr) |
| NL (1) | NL6413199A (fr) |
| SE (1) | SE323678B (fr) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3532752A (en) * | 1965-12-30 | 1970-10-06 | Merck & Co Inc | 1-alkylidene-3-indenyl aliphatic amines |
| US3321483A (en) * | 1966-06-09 | 1967-05-23 | Bristol Myers Co | Substituted 3, 4-dihydro-3-phenyl-4-hydroxy-{[(amino)alkoxy (or alkylthio) phenyl]} thiochroman |
| US3476759A (en) * | 1967-05-02 | 1969-11-04 | Mcneilab Inc | 2- and 3-(4-piperidyl) indanes and indanols |
| FR2447914A1 (fr) * | 1979-02-05 | 1980-08-29 | Sanofi Sa | Nouveaux benzothiophenes, leurs procedes de preparation et leur application notamment comme hypolipemiants et hypocholesterolemiants |
| CH647235A5 (de) * | 1980-02-13 | 1985-01-15 | Sandoz Ag | 4-(2,2-dialkylindan-1-yliden)piperidin derivate, ihre herstellung und verwendung. |
| DE102004021637A1 (de) * | 2004-05-03 | 2005-12-01 | Merck Patent Gmbh | Dihydrobenzothiophene |
| TW200621677A (en) * | 2004-09-21 | 2006-07-01 | Astellas Pharma Inc | Cyclic amine derivative or salt thereof |
| DE102005010000A1 (de) * | 2005-03-04 | 2006-09-07 | Merck Patent Gmbh | Indane |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2916490A (en) * | 1959-12-08 | Ocjhs | ||
| US2794048A (en) * | 1957-05-28 | Z-aminomethyl-indane compounds | ||
| US1915334A (en) * | 1930-10-16 | 1933-06-27 | Du Pont | Fluosilicate of organic heterocyclic bases and process of making it |
| US2610183A (en) * | 1949-09-26 | 1952-09-09 | Texas Co | 3-substituted derivatives of 2, 3-dihydrothianaphthene-1-dioxide |
| US2890984A (en) * | 1955-08-04 | 1959-06-16 | Pfizer & Co C | Pharmaceutical composition containing 2-(1, 2, 3, 4-tetrahydro-1-naphthyl)imidazo-line |
| US2854379A (en) * | 1956-06-06 | 1958-09-30 | Miles Lab | Tranquilizing composition comprising 2-ethyl-cis-crotonylurea |
| GB824713A (en) * | 1956-12-05 | 1959-12-02 | Mead Johnson & Co | New pyrrolidylmethyl substituted arylindenes and arylindanes and process for preparing same |
| GB953194A (en) * | 1960-11-08 | 1964-03-25 | Smith Kline French Lab | New benzylindene derivatives and method of preparing the same |
-
1963
- 1963-12-07 DE DE19631470055 patent/DE1470055A1/de active Pending
-
1964
- 1964-09-28 CH CH1256364A patent/CH460771A/de unknown
- 1964-11-09 GB GB45650/64A patent/GB1039450A/en not_active Expired
- 1964-11-12 NL NL6413199A patent/NL6413199A/xx unknown
- 1964-11-18 IL IL22473A patent/IL22473A/xx unknown
- 1964-12-04 US US416133A patent/US3328411A/en not_active Expired - Lifetime
- 1964-12-07 SE SE14759/64A patent/SE323678B/xx unknown
- 1964-12-07 BE BE656720D patent/BE656720A/xx unknown
- 1964-12-07 BR BR165106/64A patent/BR6465106D0/pt unknown
- 1964-12-07 FR FR997702A patent/FR4098M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1039450A (en) | 1966-08-17 |
| FR4098M (fr) | 1966-04-18 |
| CH460771A (de) | 1968-08-15 |
| BR6465106D0 (pt) | 1973-08-02 |
| SE323678B (fr) | 1970-05-11 |
| DE1470055A1 (de) | 1969-07-17 |
| NL6413199A (fr) | 1965-06-08 |
| BE656720A (fr) | 1965-06-08 |
| US3328411A (en) | 1967-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL24787A (en) | 4-aryl-isoflavanoids and their preparation | |
| IL24971A (en) | Piperidine derivatives and their preparation | |
| IL26812A (en) | 1-benzoylpropyl-4-phenyl-piperidin-4-ol derivatives and their preparation | |
| IL22410A (en) | Benzomorphan derivatives | |
| IL33557A (en) | Benzothiazinones,benzoxazinethiones and benzothiazinethiones and their preparation | |
| MY6800041A (en) | Tricycloundecane derivatives | |
| IL28433A (en) | 2-phenylhydrazino-imidazolines and processes for their preparation | |
| IL22473A (en) | Phenyl-piperidyl-indane,-hydro-naphthalene,-benzosuberone and-thionaphthene derivatives and their preparation | |
| IL22697A (en) | Pyrazino-isoquinoline derivatives and their preparation | |
| IL23236A (en) | Dibenzocycloheptadiene derivatives and their preparation | |
| MY6900074A (en) | 3-(3-hydroxypenyl)-1-phenacyl-piperidine compounds and their preparation | |
| IL25265A (en) | Estrane derivatives and their preparation | |
| IL23628A (en) | Dibenzocycloheptadiene derivatives and their preparation | |
| IL25976A (en) | Dibenzocycloheptatriene derivatives and their preparation | |
| IL26015A (en) | N11-substituted pyridobenzodiazepines and their preparation | |
| IL32335A (en) | 6-amino-1-vinyl-1-tetralols and their preparation | |
| MY6900117A (en) | New nitrofuryl derivatives | |
| IL27674A (en) | 1-sulphanilyl-2-imino-imidazolidine derivatives and their preparation | |
| AU291380B2 (en) | 8-1B0-17c-THYNYL-ESTRADIOLS AND THEIR PREPARATION | |
| CA674625A (en) | Mercaptopurines and their preparation | |
| IL29386A (en) | 1-alkyl-2-hydroxymethyl-5-nitroimidazole compounds and their preparation | |
| IL28258A (en) | 16-methyl-4-pregnen-3beta-ol-20-ones and their preparation | |
| MY6900147A (en) | New thiamine derivatives and the preparation thereof | |
| CA672696A (en) | 1-dichloromethyl-4-trifluoromethyl-mercaptobenzene and preparation | |
| IL22593A (en) | Preparation of diakylphenols |