IE52010B1 - Naphthyridine derivatives - Google Patents
Naphthyridine derivativesInfo
- Publication number
- IE52010B1 IE52010B1 IE310081A IE310081A IE52010B1 IE 52010 B1 IE52010 B1 IE 52010B1 IE 310081 A IE310081 A IE 310081A IE 310081 A IE310081 A IE 310081A IE 52010 B1 IE52010 B1 IE 52010B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- pharmaceutically acceptable
- oxo
- naphthyridine
- acceptable salt
- Prior art date
Links
- 150000005054 naphthyridines Chemical class 0.000 title 1
- 150000003839 salts Chemical class 0.000 claims abstract description 53
- 229940030600 antihypertensive agent Drugs 0.000 claims abstract description 5
- 239000002220 antihypertensive agent Substances 0.000 claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims description 95
- 125000004432 carbon atom Chemical group C* 0.000 claims description 36
- 125000000217 alkyl group Chemical group 0.000 claims description 26
- 239000002253 acid Substances 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 17
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 13
- 150000004702 methyl esters Chemical class 0.000 claims description 13
- -1 3-aminocrotonate ester Chemical class 0.000 claims description 9
- 239000008194 pharmaceutical composition Substances 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 6
- UKVYVZLTGQVOPX-IHWYPQMZSA-N (z)-3-aminobut-2-enoic acid Chemical compound C\C(N)=C\C(O)=O UKVYVZLTGQVOPX-IHWYPQMZSA-N 0.000 claims description 5
- 239000002775 capsule Substances 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- ZUSWDTWYONAOPH-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]hydrazine;hydrochloride Chemical group [Cl-].[NH3+]NC1=CC=CC=C1C(F)(F)F ZUSWDTWYONAOPH-UHFFFAOYSA-N 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 230000003276 anti-hypertensive effect Effects 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 239000002585 base Substances 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 230000003472 neutralizing effect Effects 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 238000005915 ammonolysis reaction Methods 0.000 claims description 2
- 238000006073 displacement reaction Methods 0.000 claims description 2
- 125000002632 imidazolidinyl group Chemical group 0.000 claims description 2
- GLTDGGCSKDPOHJ-UHFFFAOYSA-N methyl 4-(2-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1h-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CNCC2=O)=C2C1C1=CC=CC=C1F GLTDGGCSKDPOHJ-UHFFFAOYSA-N 0.000 claims description 2
- 238000006386 neutralization reaction Methods 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000538 pentafluorophenyl group Chemical group FC1=C(F)C(F)=C(*)C(F)=C1F 0.000 claims description 2
- 125000004193 piperazinyl group Chemical group 0.000 claims description 2
- 125000005936 piperidyl group Chemical group 0.000 claims description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 3
- 238000011065 in-situ storage Methods 0.000 claims 1
- IBMIAKGHPSCWCZ-UHFFFAOYSA-N methyl 2-oxo-1h-1,7-naphthyridine-3-carboxylate Chemical compound C1=NC=C2NC(=O)C(C(=O)OC)=CC2=C1 IBMIAKGHPSCWCZ-UHFFFAOYSA-N 0.000 claims 1
- AXGAABGTCKIJKA-UHFFFAOYSA-N methyl 7-benzyl-2-methyl-4-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=CC=CC=C1C AXGAABGTCKIJKA-UHFFFAOYSA-N 0.000 claims 1
- 125000002757 morpholinyl group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 157
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 55
- 239000007787 solid Substances 0.000 description 41
- 239000000203 mixture Substances 0.000 description 30
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 23
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 23
- 239000000243 solution Substances 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 238000001914 filtration Methods 0.000 description 18
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- XKORCTIIRYKLLG-ARJAWSKDSA-N methyl (z)-3-aminobut-2-enoate Chemical compound COC(=O)\C=C(\C)N XKORCTIIRYKLLG-ARJAWSKDSA-N 0.000 description 15
- 238000001953 recrystallisation Methods 0.000 description 15
- 229920006395 saturated elastomer Polymers 0.000 description 15
- 239000000706 filtrate Substances 0.000 description 12
- 239000011575 calcium Substances 0.000 description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- 229940127291 Calcium channel antagonist Drugs 0.000 description 8
- 239000005557 antagonist Substances 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 7
- 210000001519 tissue Anatomy 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 230000036772 blood pressure Effects 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- YZNHGFBTNUJVQD-UHFFFAOYSA-N 1-benzyl-5-hydroxy-2,6-dihydropyridin-3-one Chemical class C1C(O)=CC(=O)CN1CC1=CC=CC=C1 YZNHGFBTNUJVQD-UHFFFAOYSA-N 0.000 description 4
- 108090000312 Calcium Channels Proteins 0.000 description 4
- 102000003922 Calcium Channels Human genes 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- 241000283973 Oryctolagus cuniculus Species 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 239000000480 calcium channel blocker Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000994 depressogenic effect Effects 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 229940073584 methylene chloride Drugs 0.000 description 3
- 210000000056 organ Anatomy 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 2
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 2
- CXFIWPAUNODACX-KQQUZDAGSA-N 4-[(1e,3e)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1\C=C\C=C\C1=CC=C(N(C)C)C=C1 CXFIWPAUNODACX-KQQUZDAGSA-N 0.000 description 2
- KKJPYQYRYUUTFS-UHFFFAOYSA-N 5-hydroxy-2,6-dihydro-1h-pyridin-3-one Chemical class OC1=CC(=O)CNC1 KKJPYQYRYUUTFS-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 206010002383 Angina Pectoris Diseases 0.000 description 2
- 108091006146 Channels Proteins 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 208000021642 Muscular disease Diseases 0.000 description 2
- 201000009623 Myopathy Diseases 0.000 description 2
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- 206010003119 arrhythmia Diseases 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 230000009460 calcium influx Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 210000000170 cell membrane Anatomy 0.000 description 2
- 230000008602 contraction Effects 0.000 description 2
- 201000011634 coronary artery vasospasm Diseases 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 2
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229960002748 norepinephrine Drugs 0.000 description 2
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000002831 pharmacologic agent Substances 0.000 description 2
- 229910001414 potassium ion Inorganic materials 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- QJXCFMJTJYCLFG-UHFFFAOYSA-N 2,3,4,5,6-pentafluorobenzaldehyde Chemical compound FC1=C(F)C(F)=C(C=O)C(F)=C1F QJXCFMJTJYCLFG-UHFFFAOYSA-N 0.000 description 1
- UIFVCPMLQXKEEU-UHFFFAOYSA-N 2,3-dimethylbenzaldehyde Chemical compound CC1=CC=CC(C=O)=C1C UIFVCPMLQXKEEU-UHFFFAOYSA-N 0.000 description 1
- DMIYKWPEFRFTPY-UHFFFAOYSA-N 2,6-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(Cl)=C1C=O DMIYKWPEFRFTPY-UHFFFAOYSA-N 0.000 description 1
- ZDVRPKUWYQVVDX-UHFFFAOYSA-N 2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC=C1C=O ZDVRPKUWYQVVDX-UHFFFAOYSA-N 0.000 description 1
- HPHPTGDPZSEYMB-UHFFFAOYSA-N 2-[benzyl(methyl)amino]ethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCN(C)CC1=CC=CC=C1 HPHPTGDPZSEYMB-UHFFFAOYSA-N 0.000 description 1
- IIBAAYFFTSJSFH-UHFFFAOYSA-N 2-butylbenzaldehyde Chemical compound CCCCC1=CC=CC=C1C=O IIBAAYFFTSJSFH-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- VEZRDIBFZNMRRR-UHFFFAOYSA-N 2-oxo-1h-1,7-naphthyridine-3-carboxylic acid Chemical compound C1=NC=C2NC(=O)C(C(=O)O)=CC2=C1 VEZRDIBFZNMRRR-UHFFFAOYSA-N 0.000 description 1
- QXJDJDJVOLAJBA-UHFFFAOYSA-N 5-hydroxy-1-methyl-2,6-dihydropyridin-3-one Chemical compound CN1CC(O)=CC(=O)C1 QXJDJDJVOLAJBA-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 108010049175 N-substituted Glycines Proteins 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- 206010049418 Sudden Cardiac Death Diseases 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000048 adrenergic agonist Substances 0.000 description 1
- 239000000695 adrenergic alpha-agonist Substances 0.000 description 1
- 102000004305 alpha Adrenergic Receptors Human genes 0.000 description 1
- 108090000861 alpha Adrenergic Receptors Proteins 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 210000000709 aorta Anatomy 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000002999 depolarising effect Effects 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000004064 dysfunction Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 150000002332 glycine derivatives Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000005555 hypertensive agent Substances 0.000 description 1
- 230000004941 influx Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- SYPLQYLHBKUIMV-UHFFFAOYSA-N methyl 4-(2,3-dimethylphenyl)-2,7-dimethyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC=CC(C)=C1C SYPLQYLHBKUIMV-UHFFFAOYSA-N 0.000 description 1
- XFYMRMNCEJYPFG-UHFFFAOYSA-N methyl 4-(2,5-dimethylphenyl)-2,7-dimethyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC(C)=CC=C1C XFYMRMNCEJYPFG-UHFFFAOYSA-N 0.000 description 1
- ORCGNIDKCTUSQH-UHFFFAOYSA-N methyl 4-(3-cyanophenyl)-2,7-dimethyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC=CC(C#N)=C1 ORCGNIDKCTUSQH-UHFFFAOYSA-N 0.000 description 1
- BVDCOHZLAIFGJB-UHFFFAOYSA-N methyl 7-benzyl-2-methyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate;hydrochloride Chemical compound Cl.COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=C(F)C(F)=C(F)C(F)=C1F BVDCOHZLAIFGJB-UHFFFAOYSA-N 0.000 description 1
- HTJJZVPGRQYIRP-UHFFFAOYSA-N methyl 7-benzyl-2-methyl-5-oxo-4-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate;hydrochloride Chemical compound Cl.COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=CC=CC(C(F)(F)F)=C1 HTJJZVPGRQYIRP-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 210000002464 muscle smooth vascular Anatomy 0.000 description 1
- 230000002107 myocardial effect Effects 0.000 description 1
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- KIBFBTVPDRASNT-UHFFFAOYSA-N piperidine-3,5-dione Chemical compound O=C1CNCC(=O)C1 KIBFBTVPDRASNT-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000004648 relaxation of smooth muscle Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/238,911 US4321384A (en) | 1981-02-27 | 1981-02-27 | Antihypertensive agents |
| US06/297,645 US4365063A (en) | 1981-08-31 | 1981-08-31 | Antihypertensive agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE813100L IE813100L (en) | 1981-08-27 |
| IE52010B1 true IE52010B1 (en) | 1987-05-13 |
Family
ID=26932072
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE310081A IE52010B1 (en) | 1981-02-27 | 1981-12-31 | Naphthyridine derivatives |
Country Status (7)
| Country | Link |
|---|---|
| EP (1) | EP0059291B1 (enExample) |
| CA (1) | CA1150256A (enExample) |
| DE (1) | DE3169626D1 (enExample) |
| DK (1) | DK87382A (enExample) |
| GB (1) | GB2093834B (enExample) |
| GR (1) | GR74727B (enExample) |
| IE (1) | IE52010B1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3327650A1 (de) * | 1983-07-30 | 1985-02-14 | Gödecke AG, 1000 Berlin | 1,6-naphthyridinon-derivate, verfahren zu deren herstellung und deren verwendung bei der bekaempfung von gefaesserkrankungen |
| DE3431303A1 (de) * | 1984-08-25 | 1986-02-27 | Goedecke Ag | 1,6-naphthyridin-derivate, verfahren zu deren herstellung und deren verwendung |
| US4710557A (en) * | 1985-02-01 | 1987-12-01 | Eastman Kodak Company | Polymers of thiophenyl thioacrylate and thiomethacrylate monomers |
| US4606864A (en) * | 1985-02-01 | 1986-08-19 | Eastman Kodak Company | Thiophenyl thioacrylate and thiomethacrylate monomers |
| US6642222B2 (en) | 1998-10-28 | 2003-11-04 | Abbott Laboratories | Pyrano, piperidino, and thiopyrano compounds and methods of use |
| US6191140B1 (en) * | 1998-10-28 | 2001-02-20 | Abbott Laboratories | Pyrano, piperidino, and thiopyrano compounds and methods of use |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1022214A (en) * | 1963-01-31 | 1966-03-09 | Sterling Drug Inc | Novel 1,3-disubstituted-1,4-dihydro-4-oxo-1,7-naphthyridines and their preparation |
| SE7804318L (sv) * | 1977-05-02 | 1978-11-03 | Merck & Co Inc | Nya naftyridiner |
-
1981
- 1981-12-24 DE DE8181306136T patent/DE3169626D1/de not_active Expired
- 1981-12-24 GB GB8138903A patent/GB2093834B/en not_active Expired
- 1981-12-24 EP EP19810306136 patent/EP0059291B1/en not_active Expired
- 1981-12-30 CA CA000393428A patent/CA1150256A/en not_active Expired
- 1981-12-31 IE IE310081A patent/IE52010B1/en unknown
-
1982
- 1982-01-20 GR GR76063A patent/GR74727B/el unknown
- 1982-02-26 DK DK87382A patent/DK87382A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| GR74727B (enExample) | 1984-07-10 |
| GB2093834A (en) | 1982-09-08 |
| EP0059291A1 (en) | 1982-09-08 |
| DK87382A (da) | 1982-08-28 |
| EP0059291B1 (en) | 1985-03-27 |
| GB2093834B (en) | 1984-08-15 |
| IE813100L (en) | 1981-08-27 |
| CA1150256A (en) | 1983-07-19 |
| DE3169626D1 (en) | 1985-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20010047003A1 (en) | Thiourea derivatives of dihydropyridine NPY antagonists | |
| JPH02104526A (ja) | 高血圧症治療用組成物 | |
| RU2241701C1 (ru) | Камзилат амлодипина, способ его получения и фармацевтическая композиция на его основе | |
| CA1326672C (en) | Dihydropyridines | |
| AU2002327924C1 (en) | Novel crystalline polymorphic forms of lercanidipine hydrochloride and process for their preparation | |
| AU2002243069A1 (en) | Novel amlodipine camsylate and method for preparing thereof | |
| IE832058L (en) | 1,4-dihydropyridine derivatives | |
| US4321384A (en) | Antihypertensive agents | |
| IE52010B1 (en) | Naphthyridine derivatives | |
| US4551534A (en) | Aralkyl or aryloxyalkyl 1,7-naphthyridine-3-carboxylic acid esters | |
| EP1537083A1 (en) | S-(-)-amlodipine nicotinate and process for the preparation thereof | |
| EP1587792B1 (en) | Stable amorphous amlodipine camsylate, process for preparing same and composition for oral administration thereof | |
| US4365063A (en) | Antihypertensive agents | |
| AU2007276038B2 (en) | (S)-(-)-amlodipine camsylate or hydrate thereof and pharmaceutical composition comprising same | |
| US20030204093A1 (en) | Amide derivative of amlodipine | |
| IE59653B1 (en) | Pyrrolo[1,2-a][4,1]benzoxyzepine derivatives, process for their preparation, compounds and their therapeutic use | |
| CA1285945C (en) | N-¬¬¬1-(2)naphthylenemethyl or quinol-6-ylmethyl)-4- piperidinyl|amino|-carbonyl|-6-quinolinecarboxamide compounds | |
| JPS6289662A (ja) | 1,4−ジヒドロピリジン誘導体 | |
| US4596873A (en) | 1,4,5,6,7,8-Hexahydro-2-alkyl-4-aryl-5-oxo-1,7-naphthyridine-3-carboxylic acid aromatic esters and pharmaceutically acceptable acid addition salts thereof useful as antihypertensive agents | |
| EP0087853B1 (en) | 4-diphenylmethyl-1-(oxoalkyl)imino)methyl-piperidines and their derivatives | |
| EP0411549A1 (en) | 1,4-dihydropyridine derivative, process for preparing the same and pharmaceutical composition containing the same | |
| EP0216542B1 (en) | Dihydropyridine derivatives | |
| US4912223A (en) | 1,4-Dihydropyridines | |
| NZ207716A (en) | 3-(2-furoyl)-5-alkoxy-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine derivatives and pharmaceutical compositions | |
| AU2001100439A4 (en) | Amide derivative of amlodipine |