IE38184B1 - Penicillins - Google Patents
PenicillinsInfo
- Publication number
- IE38184B1 IE38184B1 IE1530/73A IE153073A IE38184B1 IE 38184 B1 IE38184 B1 IE 38184B1 IE 1530/73 A IE1530/73 A IE 1530/73A IE 153073 A IE153073 A IE 153073A IE 38184 B1 IE38184 B1 IE 38184B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid
- hydrogen
- group
- penicillins
- silyl
- Prior art date
Links
- 229930182555 Penicillin Natural products 0.000 title abstract 3
- 150000002960 penicillins Chemical class 0.000 title abstract 3
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 abstract 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 abstract 4
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 abstract 3
- GCOOGCQWQFRJEK-UHFFFAOYSA-N 2-thiophen-3-ylpropanedioic acid Chemical compound OC(=O)C(C(O)=O)C=1C=CSC=1 GCOOGCQWQFRJEK-UHFFFAOYSA-N 0.000 abstract 2
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 abstract 2
- 239000002253 acid Substances 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 150000001805 chlorine compounds Chemical class 0.000 abstract 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract 2
- WWYDYZMNFQIYPT-UHFFFAOYSA-N ru78191 Chemical compound OC(=O)C(C(O)=O)C1=CC=CC=C1 WWYDYZMNFQIYPT-UHFFFAOYSA-N 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 abstract 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- VVRNZYATQDBNKZ-UHFFFAOYSA-N 3-[(5,6-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)oxy]-3-oxo-2-phenylpropanoic acid Chemical compound O1C(=O)C=2C=C(OC)C(OC)=CC=2C1OC(=O)C(C(O)=O)C1=CC=CC=C1 VVRNZYATQDBNKZ-UHFFFAOYSA-N 0.000 abstract 1
- OROGUZVNAFJPHA-UHFFFAOYSA-N 3-hydroxy-2,4-dimethyl-2H-thiophen-5-one Chemical compound CC1SC(=O)C(C)=C1O OROGUZVNAFJPHA-UHFFFAOYSA-N 0.000 abstract 1
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 abstract 1
- 239000004215 Carbon black (E152) Substances 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Substances 0.000 abstract 1
- 238000006136 alcoholysis reaction Methods 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000002837 carbocyclic group Chemical group 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- -1 cyclealkyl Chemical group 0.000 abstract 1
- 125000004122 cyclic group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 229930195733 hydrocarbon Natural products 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- 230000007062 hydrolysis Effects 0.000 abstract 1
- 238000006460 hydrolysis reaction Methods 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 150000002596 lactones Chemical class 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- JKNKNWJNCOJPLI-UHFFFAOYSA-N o-phthalaldehydic acid Chemical compound C1=CC=C2C(O)OC(=O)C2=C1 JKNKNWJNCOJPLI-UHFFFAOYSA-N 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 229920006395 saturated elastomer Polymers 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4175672A GB1450043A (en) | 1972-09-08 | 1972-09-08 | Penicillins |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE38184L IE38184L (en) | 1974-03-08 |
| IE38184B1 true IE38184B1 (en) | 1978-01-18 |
Family
ID=10421239
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1530/73A IE38184B1 (en) | 1972-09-08 | 1973-08-30 | Penicillins |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3981866A (enExample) |
| JP (1) | JPS4992092A (enExample) |
| AT (1) | AT324564B (enExample) |
| AU (1) | AU469827B2 (enExample) |
| BE (1) | BE804617A (enExample) |
| CA (1) | CA1008448A (enExample) |
| DE (1) | DE2344765A1 (enExample) |
| ES (1) | ES418576A1 (enExample) |
| FR (1) | FR2198745B1 (enExample) |
| GB (1) | GB1450043A (enExample) |
| IE (1) | IE38184B1 (enExample) |
| NL (1) | NL7312343A (enExample) |
| ZA (1) | ZA736026B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1209145B (it) * | 1979-11-23 | 1989-07-10 | Resfar Srl | Procedimento per migliorare le caratteristiche farmacologiche degli acidi aril-alcanoici adattivita' analgesica e anti-infiammatoria. |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3574189A (en) * | 1968-01-05 | 1971-04-06 | Pfizer | Synthetic penicillins |
| US3847913A (en) * | 1968-01-30 | 1974-11-12 | Leo Pharm Prod Ltd | Cephalosporanic acid esters |
| US3697507A (en) * | 1968-09-26 | 1972-10-10 | Leo Pharm Prod Ltd | Esters of {60 -aminobenzylpenicillin |
| BE754141A (fr) * | 1969-08-04 | 1971-02-01 | Pfizer | Esters d'alpha-carboxyarylmethyl penicillines |
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
| BE793191A (fr) * | 1971-12-28 | 1973-06-22 | Toyama Chemical Co Ltd | Procede pour produire des acides 7-acylamido-3-cephem-4- carboxyliques |
| US3925372A (en) * | 1973-02-23 | 1975-12-09 | Lilly Co Eli | Alpha-aminoacyl-3-halo cephalosporins |
-
1972
- 1972-09-08 GB GB4175672A patent/GB1450043A/en not_active Expired
-
1973
- 1973-08-30 IE IE1530/73A patent/IE38184B1/xx unknown
- 1973-08-31 AU AU59897/73A patent/AU469827B2/en not_active Expired
- 1973-08-31 ZA ZA736026A patent/ZA736026B/xx unknown
- 1973-09-05 DE DE19732344765 patent/DE2344765A1/de not_active Withdrawn
- 1973-09-05 AT AT771273A patent/AT324564B/de not_active IP Right Cessation
- 1973-09-07 NL NL7312343A patent/NL7312343A/xx not_active Application Discontinuation
- 1973-09-07 CA CA180,506A patent/CA1008448A/en not_active Expired
- 1973-09-07 BE BE135455A patent/BE804617A/xx unknown
- 1973-09-07 FR FR7332256A patent/FR2198745B1/fr not_active Expired
- 1973-09-07 ES ES418576A patent/ES418576A1/es not_active Expired
- 1973-09-08 JP JP48101609A patent/JPS4992092A/ja active Pending
- 1973-09-21 US US05/399,326 patent/US3981866A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CA1008448A (en) | 1977-04-12 |
| AU469827B2 (en) | 1976-02-26 |
| BE804617A (fr) | 1974-03-07 |
| NL7312343A (enExample) | 1974-03-12 |
| AT324564B (de) | 1975-09-10 |
| AU5989773A (en) | 1975-03-06 |
| US3981866A (en) | 1976-09-21 |
| FR2198745B1 (enExample) | 1977-11-10 |
| ZA736026B (en) | 1974-08-28 |
| FR2198745A1 (enExample) | 1974-04-05 |
| ES418576A1 (es) | 1976-04-01 |
| IE38184L (en) | 1974-03-08 |
| DE2344765A1 (de) | 1974-03-21 |
| GB1450043A (en) | 1976-09-22 |
| JPS4992092A (enExample) | 1974-09-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| LV10456A (lv) | Triazolpiridazina atvasinajumi to iegusanas panemiens un pielietojums | |
| NL7505375A (nl) | Nieuwe penicilline en cefalosporinederivaten en werkwijze voor de bereiding daarvan. | |
| GB1382782A (en) | Alkylarylketones processes for their preparation and compositions incorporating them | |
| GB1203149A (en) | Piperidine derivatives | |
| GB1463666A (en) | Process for preparing fused carbocyclic ring derivatives of pyridine | |
| IE38184B1 (en) | Penicillins | |
| GB1367957A (en) | Process for preparing cephalosporins | |
| GB1303491A (enExample) | ||
| GB1391139A (en) | Berbine derivatives and a process for producing the same | |
| GB1377573A (en) | Acrloxyalkyl ester derivatives of penicillin and cephalosporin | |
| GB1429454A (en) | Process for produicing alpha-sulphophenylacetic acid derivative and certain alpha-sulphophenylacetic acid derivatives | |
| GB1130370A (en) | Esters of 6-aminopenicillanic acid | |
| GB1411700A (en) | Penicillins and production thereof | |
| ES395922A1 (es) | Un procedimiento para la produccion de acidos 7-aminocefa- losporanicos. | |
| GB1512660A (en) | Cephalosporin esters | |
| ES399014A1 (es) | Procedimiento para la preparacion de derivados de acido 6-amino-penicilanico. | |
| GB1374374A (en) | Isoxazolopyrimidine derivatives | |
| GB1298642A (en) | Halopyrazoles | |
| GB1390754A (en) | Penicillin and cephalosporin esters | |
| GB1347979A (en) | Penicillins | |
| GB1413286A (en) | Thiocarboxy esters and their use as herbicides | |
| GB1426557A (en) | Production of substituted monomalonate esters and their use in the production of alpha-carboxy penicillins and cephalosporins | |
| GB1489231A (en) | Process for the recovery of cephalosporin c and derivatives thereof | |
| SE7907814L (sv) | Cefalosporinforeningar | |
| GB1285790A (en) | Acylaminopenicillanic acids and process for preparing them |