IE37868B1 - Novel cyclohexane-2,6-dione-1-carboxylic acid anilides and thioanilides a process for their preparation and their use as insecticides acaricides and fungicides - Google Patents
Novel cyclohexane-2,6-dione-1-carboxylic acid anilides and thioanilides a process for their preparation and their use as insecticides acaricides and fungicidesInfo
- Publication number
- IE37868B1 IE37868B1 IE1104/73A IE110473A IE37868B1 IE 37868 B1 IE37868 B1 IE 37868B1 IE 1104/73 A IE1104/73 A IE 1104/73A IE 110473 A IE110473 A IE 110473A IE 37868 B1 IE37868 B1 IE 37868B1
- Authority
- IE
- Ireland
- Prior art keywords
- hydrogen
- alkyl
- halogen
- dione
- formula
- Prior art date
Links
- 230000000895 acaricidal effect Effects 0.000 title abstract 3
- 239000000642 acaricide Substances 0.000 title abstract 2
- 239000000417 fungicide Substances 0.000 title abstract 2
- 239000002917 insecticide Substances 0.000 title abstract 2
- UDJIPUWKNJRKBB-UHFFFAOYSA-N 2,6-dioxo-N-phenylcyclohexane-1-carboxamide Chemical class O=C(Nc1ccccc1)C1C(=O)CCCC1=O UDJIPUWKNJRKBB-UHFFFAOYSA-N 0.000 title 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 6
- 239000001257 hydrogen Substances 0.000 abstract 6
- 125000000217 alkyl group Chemical group 0.000 abstract 5
- 150000001875 compounds Chemical class 0.000 abstract 4
- 229910052736 halogen Inorganic materials 0.000 abstract 4
- 150000002367 halogens Chemical class 0.000 abstract 4
- 239000003085 diluting agent Substances 0.000 abstract 3
- 150000002431 hydrogen Chemical class 0.000 abstract 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 2
- 125000004414 alkyl thio group Chemical group 0.000 abstract 2
- HJSLFCCWAKVHIW-UHFFFAOYSA-N cyclohexane-1,3-dione Chemical class O=C1CCCC(=O)C1 HJSLFCCWAKVHIW-UHFFFAOYSA-N 0.000 abstract 2
- 238000004821 distillation Methods 0.000 abstract 2
- 125000004438 haloalkoxy group Chemical group 0.000 abstract 2
- 125000001188 haloalkyl group Chemical group 0.000 abstract 2
- 150000002825 nitriles Chemical class 0.000 abstract 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Chemical group 0.000 abstract 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000004104 aryloxy group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 239000011230 binding agent Substances 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 150000001721 carbon Chemical group 0.000 abstract 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract 1
- 150000001768 cations Chemical class 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 230000000855 fungicidal effect Effects 0.000 abstract 1
- 125000002541 furyl group Chemical group 0.000 abstract 1
- 239000007789 gas Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 230000000749 insecticidal effect Effects 0.000 abstract 1
- 239000012948 isocyanate Substances 0.000 abstract 1
- 150000002513 isocyanates Chemical class 0.000 abstract 1
- 150000002540 isothiocyanates Chemical class 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 239000007787 solid Substances 0.000 abstract 1
- 239000004094 surface-active agent Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2232730A DE2232730A1 (de) | 1972-07-04 | 1972-07-04 | Substituierte cyclohexan-2,6-dion-1carbonsaeureanilide und -thioanilide, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und fungizide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE37868L IE37868L (en) | 1974-01-04 |
| IE37868B1 true IE37868B1 (en) | 1977-10-26 |
Family
ID=5849630
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1104/73A IE37868B1 (en) | 1972-07-04 | 1973-07-03 | Novel cyclohexane-2,6-dione-1-carboxylic acid anilides and thioanilides a process for their preparation and their use as insecticides acaricides and fungicides |
Country Status (14)
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2601780B2 (de) * | 1976-01-20 | 1979-07-26 | Bayer Ag, 5090 Leverkusen | N-Phenyl-N'-benzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE3476195D1 (en) * | 1983-05-18 | 1989-02-23 | Ciba Geigy Ag | Cyclohexanedione-carboxylic-acid derivatives having a herbicidal and plant growth regulating activity |
| ZA843727B (en) * | 1983-05-18 | 1985-01-30 | Ciba Geigy Ag | Cyclohexanedionecarboxylic acid derivatives with herbicidal and plant growth regulating properties |
| DE3569104D1 (en) * | 1984-10-02 | 1989-05-03 | Ciba Geigy Ag | Process for the preparation of cyclohexane dione carboxylic-acid derivatives with a herbicidal and plant-growth regulating effect |
| WO2023127808A1 (ja) * | 2021-12-28 | 2023-07-06 | 株式会社Adeka | アリールシクロヘキサンジオン誘導体又はその塩類及び該化合物を含有する有害生物防除剤並びにその使用方法 |
| EP4458807A1 (en) * | 2021-12-28 | 2024-11-06 | Adeka Corporation | Aryl cyclohexanedione derivative or salt thereof, pest control agent containing same, and method for use thereof |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1327154A (en) * | 1971-01-15 | 1973-08-15 | American Cyanamid Co | Dioxocyclohexenecarboxanilide insecticides and acaricides |
-
1972
- 1972-07-04 DE DE2232730A patent/DE2232730A1/de active Pending
-
1973
- 1973-05-29 LU LU67692A patent/LU67692A1/xx unknown
- 1973-06-29 BR BR4833/73A patent/BR7304833D0/pt unknown
- 1973-07-02 IT IT26104/73A patent/IT990867B/it active
- 1973-07-02 IL IL42638A patent/IL42638A0/xx unknown
- 1973-07-02 NL NL7309198A patent/NL7309198A/xx unknown
- 1973-07-02 AU AU57608/73A patent/AU5760873A/en not_active Expired
- 1973-07-02 CH CH963873A patent/CH568963A5/xx not_active IP Right Cessation
- 1973-07-03 BE BE133061A patent/BE801842A/xx unknown
- 1973-07-03 ZA ZA734470A patent/ZA734470B/xx unknown
- 1973-07-03 GB GB3157773A patent/GB1377319A/en not_active Expired
- 1973-07-03 IE IE1104/73A patent/IE37868B1/xx unknown
- 1973-07-04 JP JP48074948A patent/JPS49100225A/ja active Pending
- 1973-07-04 JP JP48074947A patent/JPS49100054A/ja active Pending
- 1973-07-04 FR FR737324599A patent/FR2190806B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ZA734470B (en) | 1974-05-29 |
| CH568963A5 (enrdf_load_stackoverflow) | 1975-11-14 |
| FR2190806A1 (enrdf_load_stackoverflow) | 1974-02-01 |
| LU67692A1 (enrdf_load_stackoverflow) | 1973-08-02 |
| FR2190806B1 (enrdf_load_stackoverflow) | 1977-02-18 |
| GB1377319A (en) | 1974-12-11 |
| BE801842A (fr) | 1974-01-03 |
| IL42638A0 (en) | 1973-10-25 |
| AU5760873A (en) | 1975-01-09 |
| NL7309198A (enrdf_load_stackoverflow) | 1974-01-08 |
| BR7304833D0 (pt) | 1974-08-15 |
| DE2232730A1 (de) | 1974-01-24 |
| JPS49100054A (enrdf_load_stackoverflow) | 1974-09-20 |
| JPS49100225A (enrdf_load_stackoverflow) | 1974-09-21 |
| IT990867B (it) | 1975-07-10 |
| IE37868L (en) | 1974-01-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3639474A (en) | N-substituted perfluoroalkane-sulfonamides | |
| GB1577702A (en) | Acylaminotetrahydro - 2 - furanone derivatives and their use as fungicides | |
| US3906024A (en) | Perfluoroalkanesulfonamidoaryl compounds | |
| GB1411213A (en) | 1,3-dithiolo-4,5-6- quinoxalines process for their preparation and their use as insecticides acaricides and fungicides | |
| IE37868B1 (en) | Novel cyclohexane-2,6-dione-1-carboxylic acid anilides and thioanilides a process for their preparation and their use as insecticides acaricides and fungicides | |
| US3187041A (en) | N-alkoxy phenylacetamides | |
| US4164412A (en) | Perfluoroalkylsulfonamidoaryl compounds | |
| US3689662A (en) | Nematocidel use of 3,4,4-trifluoro-3-butenylthio methylidene compounds | |
| US4233308A (en) | Microbicidal compositions | |
| US3956315A (en) | Herbicidal N-(3-cyano-4-alkylthien-2-yl) ureas | |
| US3896169A (en) | Method of making carbonoyl sulfoxide derivatives | |
| GB1377728A (en) | Isocyanophenyl and isocyanonaphthyl carbamates and insecticidal and acaricidal compositions containing them | |
| US4205168A (en) | N-Carbamylalkyl-2,6-dialkyl-α-haloacetanilides | |
| US3641062A (en) | Carbonate esters of 3 5-dihalo-4-hydroxy-benzonitriles | |
| US3997548A (en) | Hydroxy-2,1-benzisothiazoles | |
| US3242209A (en) | Iminomethyleneureas | |
| US3819701A (en) | Formamidine derivatives and the composition containing same | |
| US3705914A (en) | Pesticidal carbamate derivatives of naphthaquinones | |
| US3117855A (en) | Herbicidal nu-substituted alpha, alpha-diphenylacetamides | |
| GB1366832A (en) | N-sulphenylated oxime carbamates with insecticidal acaricidal and fungicidal activity | |
| US4179441A (en) | Fungidal and herbicidal 2-substituted-3-oxa-3aλ4, 4-dithia-6-halo-1,5-diazapentalene | |
| US3630714A (en) | Method for controlling undesirable vegetation using 2-nitro-3-pyridols or their salts or esters | |
| US3758481A (en) | Ridine m-(2,4-dichloro - 5-(haloalkoxy)-phenylcarbomoyl)-pyrrolidine or pipe | |
| US3478043A (en) | 3-oxa-tricyclo(4.2.1.0**2,5)nonanes | |
| GB1328947A (en) | Phenylhydrazones a process for their preparation and their use as insecticides acaricides and fungicides |