IE37443B1 - Apovincaminic acid amides and acid addition salts thereof - Google Patents
Apovincaminic acid amides and acid addition salts thereofInfo
- Publication number
- IE37443B1 IE37443B1 IE466/73A IE46673A IE37443B1 IE 37443 B1 IE37443 B1 IE 37443B1 IE 466/73 A IE466/73 A IE 466/73A IE 46673 A IE46673 A IE 46673A IE 37443 B1 IE37443 B1 IE 37443B1
- Authority
- IE
- Ireland
- Prior art keywords
- addition salts
- acid
- apovincaminic
- acid addition
- amides
- Prior art date
Links
- 239000002253 acid Substances 0.000 title abstract 2
- ZFCQLDAGNBFMJQ-QUCCMNQESA-N apovincaminic acid Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C=C(C(O)=O)N5C2=C1 ZFCQLDAGNBFMJQ-QUCCMNQESA-N 0.000 title abstract 2
- 150000003839 salts Chemical class 0.000 title abstract 2
- 230000002526 effect on cardiovascular system Effects 0.000 abstract 1
- -1 heterocyclic amides Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D461/00—Heterocyclic compounds containing indolo [3,2,1-d,e] pyrido [3,2,1,j] [1,5]-naphthyridine ring systems, e.g. vincamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7209951A FR2176516B1 (enExample) | 1972-03-22 | 1972-03-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE37443L IE37443L (en) | 1973-09-22 |
| IE37443B1 true IE37443B1 (en) | 1977-07-20 |
Family
ID=9095606
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE466/73A IE37443B1 (en) | 1972-03-22 | 1973-03-22 | Apovincaminic acid amides and acid addition salts thereof |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3891640A (enExample) |
| JP (1) | JPS4911899A (enExample) |
| BE (1) | BE797017A (enExample) |
| CH (1) | CH566336A5 (enExample) |
| DE (1) | DE2314335A1 (enExample) |
| ES (1) | ES412921A1 (enExample) |
| FR (1) | FR2176516B1 (enExample) |
| GB (1) | GB1392908A (enExample) |
| IE (1) | IE37443B1 (enExample) |
| LU (1) | LU67260A1 (enExample) |
| NL (1) | NL7304031A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2228479B1 (enExample) * | 1973-05-07 | 1976-05-14 | Synthelabo | |
| FR2276048A1 (fr) * | 1974-06-27 | 1976-01-23 | Synthelabo | Nouveaux esters du cyclohexanol, leurs sels, leur preparation et les medicaments qui les renferment |
| FR2283669A1 (fr) * | 1974-09-06 | 1976-04-02 | Elmu Sa | 2-cetoglutarate de vincamine et son procede de preparation |
| FI751840A7 (enExample) * | 1974-09-24 | 1976-03-25 | Synthelabo | |
| GB1525885A (en) * | 1976-05-11 | 1978-09-20 | Soc D Etudes Prod Chimique | Vincamine salt of pyridoxal phosphate |
| HU191938B (en) * | 1984-07-11 | 1987-04-28 | Andras Vedres | Process for production of new derivatives of 9 and 11 nitro-apovincamin acid |
| HU207074B (en) * | 1990-12-07 | 1993-03-01 | Richter Gedeon Vegyeszet | Process for producing optically active cis and trans 14-(n-substituted-aminomethyl)-eburnane derivatives and pharmaceutical compositions comprising same |
| HU209678B (en) * | 1992-06-09 | 1994-10-28 | Richter Gedeon Vegyeszet | Process for producing biologically active eburnamenin-14-carbonyl-amino derivatives and pharmaceutical compositions containing them |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU163143B (enExample) * | 1971-05-07 | 1973-06-28 |
-
1972
- 1972-03-22 FR FR7209951A patent/FR2176516B1/fr not_active Expired
-
1973
- 1973-03-19 BE BE128993A patent/BE797017A/xx unknown
- 1973-03-21 LU LU67260A patent/LU67260A1/xx unknown
- 1973-03-21 CH CH411273A patent/CH566336A5/xx not_active IP Right Cessation
- 1973-03-22 US US343681A patent/US3891640A/en not_active Expired - Lifetime
- 1973-03-22 NL NL7304031A patent/NL7304031A/xx unknown
- 1973-03-22 ES ES412921A patent/ES412921A1/es not_active Expired
- 1973-03-22 JP JP48033042A patent/JPS4911899A/ja active Pending
- 1973-03-22 IE IE466/73A patent/IE37443B1/xx unknown
- 1973-03-22 DE DE19732314335 patent/DE2314335A1/de active Pending
- 1973-03-22 GB GB1391173A patent/GB1392908A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4911899A (enExample) | 1974-02-01 |
| US3891640A (en) | 1975-06-24 |
| LU67260A1 (enExample) | 1973-05-22 |
| IE37443L (en) | 1973-09-22 |
| GB1392908A (en) | 1975-05-07 |
| BE797017A (fr) | 1973-07-16 |
| FR2176516A1 (enExample) | 1973-11-02 |
| FR2176516B1 (enExample) | 1975-03-14 |
| ES412921A1 (es) | 1976-01-16 |
| CH566336A5 (enExample) | 1975-09-15 |
| NL7304031A (enExample) | 1973-09-25 |
| DE2314335A1 (de) | 1973-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA943129A (en) | Process for the production of n-(1,1,1-trisubstituted)-methylazoles | |
| PH9202A (en) | N-substituted-4-diphenylmethylpiperidine derivatives,the compositions and method of use thereof | |
| JPS5227767A (en) | Imidazole or 1*2*44triazole derivatives * production thereof and pasteurizing composition containing the same | |
| AU467793B2 (en) | Novel heterocyclic flavoring compositions and processes | |
| IL39346A (en) | 2,4-diamino-pyrimidine-5-carboxylic acid amide derivatives and herbicidal compositions containing them | |
| PH11825A (en) | N-(1'alkoxycarbonyl-ethyl)-n-haloacetyl-2,6-dialkylanilines for the control of phytopathogenic fungi and bacteria | |
| IE37443B1 (en) | Apovincaminic acid amides and acid addition salts thereof | |
| CA925863A (en) | Process for the preparation of amides, hydrazides and esters and of alpha-aminobenzypenicillin and n-substituted derivatives | |
| CA979443A (en) | Quaternary ammonium salt, production of the same and composition thereof | |
| AU2027970A (en) | PROCESS AND APPARATUS FOR THE PRODuCTION OF SPECIAL STEELS, SUPERLLOYS AND TITANIUM OR VANADIUM BASE ALLOYS | |
| AT347844B (de) | Kassette zur entnahmegerechten verwahrung und verpackung von karten, blaettern u. dgl. | |
| NL161740C (nl) | Werkwijze voor het bereiden van 1-aminoantrachinon en/of 1,5- en/of 1,8-diaminoantrachinon. | |
| BG23745A3 (en) | Method of obtaining n-(2-amino-3,5-dibrombenzyl)-n-methylcyclohexylamine | |
| CA789017A (en) | .delta.8,9-ergolene-8-carboxylic acid amide derivatives | |
| IE39852B1 (en) | Benzimidazole-1-carboxylic acid amides | |
| CA1014169A (en) | 11,12-secoprostaglandins and processes | |
| CA1001157A (en) | 3,6-bis-(aminoacylamino) - acridines and processes for production thereof | |
| YU142173A (en) | Process for the manufacture of 2-alkoxy-4,5-substituted benzamides | |
| IE37956B1 (en) | 1,4-ethano-2,3-dihydroquinoline derivatives | |
| CA1017357A (en) | N-(triaryl-methyl)-amidines, process for the preparation thereof and compositions containing the same | |
| CA967577A (en) | Heterocyclic benzamide compounds, processes for making them and compositions containing them | |
| CA991573A (en) | Microbiological reduction of 1,3-dioxo-2-alkylcycloalkanes | |
| AU481968B2 (en) | 92-pyridimidinylthio) alkanoim acids, estersm amides and hydrazides | |
| CA878507A (en) | Amides of the 3,4,5-trimethoxyphenoxyacetic acid | |
| CA790063A (en) | .delta.8,9-ergolene-8-carboxylic acid amide derivatives |