IE34822B1 - Process for producing 6-amino penicillanic acid - Google Patents
Process for producing 6-amino penicillanic acidInfo
- Publication number
- IE34822B1 IE34822B1 IE1609/70A IE160970A IE34822B1 IE 34822 B1 IE34822 B1 IE 34822B1 IE 1609/70 A IE1609/70 A IE 1609/70A IE 160970 A IE160970 A IE 160970A IE 34822 B1 IE34822 B1 IE 34822B1
- Authority
- IE
- Ireland
- Prior art keywords
- producing
- penicillanic acid
- amino penicillanic
- amino
- acid
- Prior art date
Links
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 title 1
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10026969 | 1969-12-26 | ||
| JP913970A JPS5022037B1 (enExample) | 1970-02-02 | 1970-02-02 | |
| JP1237870A JPS5111119B1 (enExample) | 1970-02-13 | 1970-02-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE34822L IE34822L (en) | 1971-06-26 |
| IE34822B1 true IE34822B1 (en) | 1975-08-20 |
Family
ID=27278343
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1609/70A IE34822B1 (en) | 1969-12-26 | 1970-12-15 | Process for producing 6-amino penicillanic acid |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3809699A (enExample) |
| BE (1) | BE760837A (enExample) |
| CH (1) | CH568327A5 (enExample) |
| DK (1) | DK133046C (enExample) |
| FR (1) | FR2074286A5 (enExample) |
| GB (1) | GB1340208A (enExample) |
| IE (1) | IE34822B1 (enExample) |
| NL (1) | NL151710B (enExample) |
| SE (1) | SE379352B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5035079B1 (enExample) * | 1970-10-17 | 1975-11-13 | ||
| GB1391437A (en) * | 1971-04-07 | 1975-04-23 | Glaxo Lab Ltd | Preparation of antibiotic compounds |
| IL39062A (en) * | 1971-04-15 | 1975-02-10 | Toyama Chemical Co Ltd | A process for producing an antibiotic substance of the penicillin and cephalosporin series |
| US4035352A (en) * | 1971-04-17 | 1977-07-12 | Gist-Brocades N.V. | Preparation of 7-substituted amino-desacetoxycephalosporanic acid compounds |
| GB1388267A (en) * | 1971-06-17 | 1975-03-26 | Glaxo Lab Ltd | Preparation of antibiotic compounds |
| US3896110A (en) * | 1971-10-04 | 1975-07-22 | American Home Prod | Process for preparation of 6-aminopenicillanic acid |
| US3962215A (en) * | 1971-10-04 | 1976-06-08 | American Home Products Corporation | Intermediates for preparing semi-synthetic penicillins and processes relating thereto |
| US3912750A (en) * | 1971-11-09 | 1975-10-14 | American Home Prod | Intermediates for producing semi-synthetic penicillins |
| BE791099A (fr) * | 1971-11-09 | 1973-05-08 | American Home Prod | Intermediaires pour la production de penicillines semi-synthetiques et procedes pour les obtenir |
| US3875152A (en) * | 1971-11-09 | 1975-04-01 | American Home Prod | Intermediates for producing semi-synthetic cephalosporins and methods of production |
| US3935186A (en) * | 1971-11-09 | 1976-01-27 | American Home Products Corporation | Intermediates for producing semi-synthetic penicillins and cephalosporins and methods of production |
| US3994911A (en) * | 1971-11-09 | 1976-11-30 | American Home Products Corporation | Intermediate for producing semi-synthetic penicillins and cephalosporins |
| US3929767A (en) * | 1971-11-16 | 1975-12-30 | Yamanouchi Pharma Co Ltd | Process of producing semi-synthetic penicillin |
| DE2222094A1 (de) * | 1972-05-05 | 1973-11-15 | Hoechst Ag | Verfahren zur herstellung von aminoazetidinonen |
| DE2243242A1 (de) * | 1972-09-02 | 1974-03-28 | Hoechst Ag | Verfahren zur herstellung von 7-amino3-cephem-4-carbonsaeurederivaten |
| GB1472746A (en) * | 1973-07-05 | 1977-05-04 | Glaxo Lab Ltd | Cephalosporin compounds |
| US3933810A (en) * | 1973-08-02 | 1976-01-20 | American Home Products Corporation | Intermediates for producing semi-synthetic cephalosporins |
| US4072676A (en) * | 1974-02-15 | 1978-02-07 | American Home Products Corporation | Process for preparation of 6-aminopenicillanic acid derivatives |
| US3951982A (en) * | 1974-11-21 | 1976-04-20 | Parke, Davis & Company | Trialkylsilyl esters of 6(substituted amino)phenyl-1,-dihydro-2-oxonicotinic acid, methods for their production and conversion to the corresponding acid chlorides |
| IT1124802B (it) * | 1979-10-29 | 1986-05-14 | Dobfar Spa | Derivati boronati dell'acido 6-amino penicillanico e procedimento per la loro preparazione |
| NL7908867A (nl) * | 1979-12-10 | 1981-07-01 | Gist Brocades Nv | Werkwijze voor het bereiden van 6-aminopenicillaanzuur- -1,1-dioxide en zijn zouten. |
-
1970
- 1970-12-15 IE IE1609/70A patent/IE34822B1/xx unknown
- 1970-12-16 US US00098907A patent/US3809699A/en not_active Expired - Lifetime
- 1970-12-18 DK DK643870A patent/DK133046C/da not_active IP Right Cessation
- 1970-12-23 SE SE7017489A patent/SE379352B/xx unknown
- 1970-12-23 CH CH1904470A patent/CH568327A5/xx not_active IP Right Cessation
- 1970-12-23 GB GB6110370A patent/GB1340208A/en not_active Expired
- 1970-12-24 FR FR7046685A patent/FR2074286A5/fr not_active Expired
- 1970-12-24 BE BE760837A patent/BE760837A/xx not_active IP Right Cessation
- 1970-12-24 NL NL707018816A patent/NL151710B/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH568327A5 (enExample) | 1975-10-31 |
| GB1340208A (en) | 1973-12-12 |
| SE379352B (enExample) | 1975-10-06 |
| BE760837A (fr) | 1971-05-27 |
| IE34822L (en) | 1971-06-26 |
| DK133046C (da) | 1976-08-16 |
| DK133046B (da) | 1976-03-15 |
| US3809699A (en) | 1974-05-07 |
| NL151710B (nl) | 1976-12-15 |
| NL7018816A (enExample) | 1971-06-29 |
| FR2074286A5 (enExample) | 1971-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE34822B1 (en) | Process for producing 6-amino penicillanic acid | |
| YU35600B (en) | Process for preparing 6-aminopenicillanic acid | |
| AU2117470A (en) | Process for production of phosphorus. | |
| ZA704925B (en) | Process for the production of benzthiazyl-sulphenamides | |
| ZA705342B (en) | Process for producing 5-alkylidene-2-norbornenes | |
| YU35449B (en) | Process for producing 7-amino-cephalosporanic acid | |
| ZA706778B (en) | Process for the production of urea | |
| ZA708464B (en) | Process for producing 6-aminopenicillanic acid | |
| IL35901A0 (en) | Process for producing 6-aminopenicillanic acid | |
| YU34425B (en) | Process for preparing 6-aminopenicillanic acid | |
| YU276270A (en) | Process for obtaining 7-aminocephalosporinic acid | |
| AU427912B2 (en) | Process for producing 6-aminopenicillanic acid | |
| YU20374A (en) | Process for producing 6-amino penicillanic acid derivatives | |
| AU2352170A (en) | Process for producing 6-aminopenicillanic acid | |
| YU63472A (en) | Improved process for producing 6-amino penicillanic acid | |
| IL34779A (en) | Process for the production of n-trityl-imidazoles and-triazoles | |
| ZA707224B (en) | Process for the production of hydroquinolines | |
| YU36522B (en) | Process for obtaining new penicillanic acid derivatives | |
| AU425419B2 (en) | Process for producing 6 aminoacylamido penicillanic acids | |
| CA935105A (en) | Method for the production of 6-aminopenicillanic acid | |
| CA827120A (en) | Process for producing l-glumatic acid | |
| IL34780A0 (en) | Process for the production of n-trityl-imidazoles and-triazoles | |
| IL32806A0 (en) | Process for the production of 6-amino-penicillanic acid | |
| AU1357470A (en) | Process for producing 6 aminoacylamido penicillanic acids | |
| CA809173A (en) | Process for producing fumaric acid |