HUP9903783A2 - Dihydro- and tetrahydro-quinoline compounds, a process for their preparation and pharmaceutical compositions containing them - Google Patents
Dihydro- and tetrahydro-quinoline compounds, a process for their preparation and pharmaceutical compositions containing themInfo
- Publication number
- HUP9903783A2 HUP9903783A2 HU9903783A HUP9903783A HUP9903783A2 HU P9903783 A2 HUP9903783 A2 HU P9903783A2 HU 9903783 A HU9903783 A HU 9903783A HU P9903783 A HUP9903783 A HU P9903783A HU P9903783 A2 HUP9903783 A2 HU P9903783A2
- Authority
- HU
- Hungary
- Prior art keywords
- alkyl
- optionally substituted
- cycloalkyl
- aryl
- heterocycloalkyl
- Prior art date
Links
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 title abstract 3
- 125000000147 tetrahydroquinolinyl group Chemical class N1(CCCC2=CC=CC=C12)* 0.000 title abstract 3
- 239000008194 pharmaceutical composition Substances 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 20
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 10
- 125000003118 aryl group Chemical group 0.000 abstract 8
- 125000000592 heterocycloalkyl group Chemical group 0.000 abstract 8
- 125000001072 heteroaryl group Chemical group 0.000 abstract 7
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 6
- 125000003545 alkoxy group Chemical group 0.000 abstract 4
- 125000004446 heteroarylalkyl group Chemical group 0.000 abstract 4
- 125000003342 alkenyl group Chemical group 0.000 abstract 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 3
- 125000000304 alkynyl group Chemical group 0.000 abstract 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 3
- 125000001475 halogen functional group Chemical group 0.000 abstract 3
- 125000005885 heterocycloalkylalkyl group Chemical group 0.000 abstract 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 3
- 125000003107 substituted aryl group Chemical group 0.000 abstract 3
- -1 1-6C perhaloalkyl Chemical group 0.000 abstract 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 abstract 2
- 125000002947 alkylene group Chemical group 0.000 abstract 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 abstract 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 abstract 2
- 229910052757 nitrogen Inorganic materials 0.000 abstract 2
- 229910052760 oxygen Inorganic materials 0.000 abstract 2
- 229910052717 sulfur Inorganic materials 0.000 abstract 2
- DDVIUSBRMFDHGP-UHFFFAOYSA-N 7-methoxy-2,2-diphenyl-1h-quinoline Chemical compound N1C2=CC(OC)=CC=C2C=CC1(C=1C=CC=CC=1)C1=CC=CC=C1 DDVIUSBRMFDHGP-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000004450 alkenylene group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000004419 alkynylene group Chemical group 0.000 abstract 1
- 125000004103 aminoalkyl group Chemical group 0.000 abstract 1
- 235000010290 biphenyl Nutrition 0.000 abstract 1
- 239000004305 biphenyl Substances 0.000 abstract 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 125000001624 naphthyl group Chemical group 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Abstract
Dihydro- and tetrahydro-quinoline derivatives (I) are new. Dihydro- and tetrahydro-quinoline derivatives of formula (I) and their acid or base addition salts are new. R1 = H or a group of formula (i); A = H or -B'NZ1Z2; B' = 1-6C alkylene; Z1, Z2 = H, alkyl, 3-8C cycloalkyl or optionally substituted aryl; or NZ1Z2 = heterocycloalkyl or heteroaryl (optionally substituted); R2, R3 = alkyl, 3-8C cycloalkyl, heterocycloalkyl, optionally substituted aryl, optionally substituted heteroaryl, cycloalkylalkyl, heterocycloalkylalkyl, optionally substituted arylalkyl, optionally substituted heteroarylalkyl or aminoalkyl (optionally substituted on N with 1 or 2 alkyl, cycloalkyl, aryl or arylalkyl); or R2 + R3 = form with C of quinoline, 3-8C cycloalkyl or heterocycloalkyl (optionally substituted with alkyl, cycloalkyl, cycloalkylalkyl, aryl or arylalkyl); R40 = alkyl, 2-6C alkenyl, 2-6C alkynyl (all optionally substituted), H, Q or -V'-Q; V' = 1-6C alkylene, 2-6C alkenylene or 2-6C alkynylene; Q = 3-8C cycloalkyl, aryl, heterocycloalkyl, heteroaryl (all optionally substituted); R5, R41 = H; or R5 + R41 = bond; R6-R9 = H, halo, alkyl, 3-8C cycloalkyl or -OW'; W' = aryl, heteroaryl, arylalkyl, heteroarylalkyl (all optionally substituted), H, alkyl, acyl, 3-8C cycloalkyl or heterocycloalkyl; alkyl = 1-6C; aryl = phenyl, naphthyl or biphenyl; heterocycloalkyl = partially unsaturated 4- to 11-membered mono- or bi-cyclic ring containing 1-6 N, S or O; heteroaryl = aromatic or partially aromatic 4- to 11-membered mono- or bi-cyclic ring containing 1-6 N, S or O; substituted aryl, arylalkyl = aryl or arylalkyl substituted with at least one halo, alkyl, 1-6C alkoxy, 1-6C perhaloalkyl, amino (optionally substituted by 1 or 2 alkyl), CN, carboxy, 1-6C alkoxycarbonyl, aminocarbonyl (optionally substituted with 1 or 2 alkyl on N), nitro or OH; substituted alkyl, alkenyl, alkynyl and cycloalkyl = alkyl, alkenyl, alkynyl and cycloalkyl substituted with at least one OH, 1-6C alkoxy, 1-6C alkylthio, amino (optionally substituted with 1 or 2 alkyl), carboxy, nitro, CN, 1-6C alkoxycarbonyl or aminocarbonyl (optionally substituted with 1 or 2 alkyl on N); substituted heterocycloalkyl, heterocycloalkylalkyl, heteroaryl, heteroarylalkyl = heterocycloalkyl, heterocycloalkylalkyl, heteroaryl, heteroarylalkyl substituted with at least one halo, alkyl, 1-6C alkoxy, 1-6C perhaloalkyl, amino (optionally substituted with 1 or 2 alkyl), CN, carboxy, 1-6C alkoxycarbonyl, aminocarbonyl (optionally substituted with 1 or 2 alkyl on N), nitro, OH or oxo; and provided that R6-R9 are not all H and at least one of R6-R9 is -OW', that R2 and R3 are alkyl when R6-R9 are H, alkyl, alkoxy, R41 and R5 form a bond, R40 is other than H or alkyl; when (I) has one OH and R40 is other than H; when (I) has one methoxy and R40 is other than hydroxyalkyl; and (I) is other than 7-methoxy-2,2-diphenyl-1,2-dihydroquinoline. An Independent claim is also included for the preparation of (I).
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU9903783A HUP9903783A3 (en) | 1998-10-23 | 1999-10-22 | Dihydro- and tetrahydro-quinoline compounds, a process for their preparation and pharmaceutical compositions containing them |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR9813306A FR2784988B1 (en) | 1998-10-23 | 1998-10-23 | NOVEL DIHYDRO AND TETRAHYDROQUINOLEINIC COMPOUNDS, PROCESS FOR THEIR PREPARATION AND THE PHARMACEUTICAL COMPOSITIONS CONTAINING THEM |
| HU9903783A HUP9903783A3 (en) | 1998-10-23 | 1999-10-22 | Dihydro- and tetrahydro-quinoline compounds, a process for their preparation and pharmaceutical compositions containing them |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HU9903783D0 HU9903783D0 (en) | 1999-12-28 |
| HUP9903783A2 true HUP9903783A2 (en) | 2000-09-28 |
| HUP9903783A3 HUP9903783A3 (en) | 2001-06-28 |
Family
ID=89999806
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU9903783A HUP9903783A3 (en) | 1998-10-23 | 1999-10-22 | Dihydro- and tetrahydro-quinoline compounds, a process for their preparation and pharmaceutical compositions containing them |
Country Status (1)
| Country | Link |
|---|---|
| HU (1) | HUP9903783A3 (en) |
-
1999
- 1999-10-22 HU HU9903783A patent/HUP9903783A3/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HUP9903783A3 (en) | 2001-06-28 |
| HU9903783D0 (en) | 1999-12-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA996667B (en) | Dihydro-and tetrahydro-quinoline compounds, a process for their preparation and pharmaceutical compositions containing them. | |
| HK1053834A1 (en) | N-heterocyclic derivatives as nos inhibitors | |
| NZ334954A (en) | Substituted heterocycles as anti-tumor agents | |
| MXPA02012033A (en) | 2-aminocarbonyl-9h-purine derivatives. | |
| AU5062996A (en) | Novel pyridine compounds, processes for their preparation and the pharmaceutical compositions which contain them | |
| DE60212949D1 (en) | ANTIVIRAL PYRAZOLOPYRIDINE COMPOUNDS | |
| HU904956D0 (en) | Process for producing benzopyrane derivatives and pharmaceutical preparatives containing such active agents | |
| NZ503912A (en) | Piperidinylaminomethyl trifluoromethyl cyclic ether compounds and their use as substance P antagonists | |
| MX9705559A (en) | Neuraminic acid derivatives. | |
| NZ236293A (en) | 1-(alkyl or alkoxyalkyl)-4-phenyl piperidine-4-carboxylic acid amide derivatives; preparatory processes and pharmaceutical compositions | |
| MY124078A (en) | Eletriptan hydrobromide monohydrate | |
| MY120237A (en) | Method for the synthesis of quinoline derivatives | |
| HUP9903783A2 (en) | Dihydro- and tetrahydro-quinoline compounds, a process for their preparation and pharmaceutical compositions containing them | |
| DE60201074D1 (en) | Pyrazolopyridinderivate | |
| IE863374L (en) | Indoles. | |
| HUP0400436A2 (en) | Novel tricyclic dihydro-quinoline derivatives, method for preparing same and pharmaceutical compositions containing same | |
| AU1076802A (en) | Selective glucocorticoid receptor agonists | |
| ES2085234A1 (en) | Agent acting on the central nervous system, process for its preparation and pharmaceutical compositions containing it | |
| HK1024244A1 (en) | 8h-thieno-(2,3-b)pyrrolizin-8-one compounds, a process for their preir preparation and pharmaceutical compositions containing them | |
| IL147767A0 (en) | Processes for the preparation of 2-arylvinyl alkyl ether and 1,4-diaryl-2-fluoro-2-butene compounds | |
| AU6675694A (en) | Pyrido(1,2,3-de)quinoxaline derivatives, process for preparing the same and their use in medicaments | |
| AU1773497A (en) | Novel 2,3-benzodiazepine derivatives | |
| TH51098B (en) | Quinnoline derivatives as an alpha-1 antagonist | |
| MY128457A (en) | 2-aminocarbonyl-9h-purine derivatives | |
| TH51098A (en) | Quinoline derivatives as an alpha-1 antagonist |