HUP0002035A2 - Sulfonamidoalkyl-carbonyl-(carbomoyl-oxy)phenylalanine derivatives and pharmaceutical compositions containing them - Google Patents
Sulfonamidoalkyl-carbonyl-(carbomoyl-oxy)phenylalanine derivatives and pharmaceutical compositions containing themInfo
- Publication number
- HUP0002035A2 HUP0002035A2 HU0002035A HUP0002035A HUP0002035A2 HU P0002035 A2 HUP0002035 A2 HU P0002035A2 HU 0002035 A HU0002035 A HU 0002035A HU P0002035 A HUP0002035 A HU P0002035A HU P0002035 A2 HUP0002035 A2 HU P0002035A2
- Authority
- HU
- Hungary
- Prior art keywords
- optionally substituted
- alkyl
- conh
- butoxy
- tert
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title 1
- -1 N-succinimidyloxy, adamantylamino, cholest-5-en-3beta-yloxy Chemical group 0.000 abstract 6
- 125000000217 alkyl group Chemical group 0.000 abstract 6
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 abstract 4
- 125000000623 heterocyclic group Chemical group 0.000 abstract 4
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 abstract 4
- 125000003118 aryl group Chemical group 0.000 abstract 3
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 3
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 abstract 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 abstract 2
- ONIBWKKTOPOVIA-SCSAIBSYSA-N D-Proline Chemical compound OC(=O)[C@H]1CCCN1 ONIBWKKTOPOVIA-SCSAIBSYSA-N 0.000 abstract 1
- COLNVLDHVKWLRT-MRVPVSSYSA-N D-phenylalanine Chemical compound OC(=O)[C@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-MRVPVSSYSA-N 0.000 abstract 1
- 229930182832 D-phenylalanine Natural products 0.000 abstract 1
- 229930182820 D-proline Natural products 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 125000003435 aroyl group Chemical group 0.000 abstract 1
- 125000000732 arylene group Chemical group 0.000 abstract 1
- 125000000392 cycloalkenyl group Chemical group 0.000 abstract 1
- 125000000000 cycloalkoxy group Chemical group 0.000 abstract 1
- 125000001072 heteroaryl group Chemical group 0.000 abstract 1
- 125000005549 heteroarylene group Chemical group 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 102000004196 processed proteins & peptides Human genes 0.000 abstract 1
- 108090000765 processed proteins & peptides Proteins 0.000 abstract 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Landscapes
- Peptides Or Proteins (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Abstract
Sulphonyl di- and tri- peptides of formula (I), and their salts, are new: Q = C(=X)NR7; X = O or S; R1 = alkyl, aryl, cycloalkyl, heterocyclyl, or heteroaryl (all optionally substituted); R2 = R1, H, or cycloalkenyl (optionally substituted; R3 = R1 or H; or R1+R2 or R2+R3 = a heterocyclyl group; R5 = (CH2)x-Ar-R4; R4 = O-Z-NR8R81 or O-Z-R12; Ar = arylene or heteroarylene (both optionally substituted); x = 1-4; Z = CO or SO2; R6 = OH, amino, alkoxy or cycloalkoxy (both optionally substituted), N-succinimidyloxy, adamantylamino, cholest-5-en-3beta-yloxy, NHOY, NH(CH2)pCOOY, OCH2NR9R10, or NHSO2Z1; R7 = H or alkyl; R8, R81 = H, or alkyl, cycloalkyl, or heterocyclyl (all optionally substituted); or NR8R81 = optionally substituted azacyclyl group; R12 = optionally substituted heterocyclyl; Y = H, or alkyl or aryl (both optionally substituted); p = 1-8; R9 = optionally substituted aroyl group; R10 = H or CH2COOR11; R11 = alkyl; and Z1 = R1; provided that: (a) when R1R2 complete a saccharin-2-yl group, Q = CONH, R3 = Me, and R5 = 4-dimethylcarbamoyloxybenzyl, then R6 is not tert-butoxy; (b) when R1 = p-tolyl, Q = CONH, NR2R3 and adjacent C atom = a pyrrolidinyl ring derived from D-proline, and R5 = 4-(4-methylpiperazin-1-ylcarbonyloxy)benzyl derived from D-phenylalanine, then R6 is not tert-butoxy; (c) when R1 = pyrimidin-2-yl, Q = CONH, NR2R3 and adjacent C atom = pyrrolidinyl, and R5 = 4-dimethylaminocarbamoyloxybenzyl, then R6 is not tert-butoxy; and (d) when R1 = p-tolyl, Q = CONH, NR2R3 and adjacent C = (2S)-piperazin-2-carbonyl, and R5 = 4-dimethylaminocarbamoyloxybenzyl, then R6 is not tert-butoxy. All alkyl, alkenyl, alkynyl, and alkylene are up to 10C, aryl 6-14C and cycloalkyl is 3-8C.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5445397P | 1997-08-01 | 1997-08-01 | |
| PCT/US1998/015324 WO1999006390A1 (en) | 1997-07-31 | 1998-07-31 | Carbamyloxy compounds which inhibit leukocyte adhesion mediated by vla-4 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUP0002035A2 true HUP0002035A2 (en) | 2000-11-28 |
| HUP0002035A3 HUP0002035A3 (en) | 2002-07-29 |
Family
ID=21991170
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU0002035A HUP0002035A3 (en) | 1997-08-01 | 1998-07-31 | Sulfonamidoalkyl-carbonyl-(carbomoyl-oxy)phenylalanine derivatives and pharmaceutical compositions containing them |
Country Status (1)
| Country | Link |
|---|---|
| HU (1) | HUP0002035A3 (en) |
-
1998
- 1998-07-31 HU HU0002035A patent/HUP0002035A3/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HUP0002035A3 (en) | 2002-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TR199701427T1 (en) | Bicyclic amines used as insecticides. | |
| IL154893A0 (en) | Aliphatic nitrogen-containing cyclic compounds, methods for the preparation thereof and pharmaceutical compositions containing the same | |
| NZ505666A (en) | 1,2,3,4-tetrahydronaphthalene and 1,2,3,4-tetrahydro-2-naphthalenol derivatives and pharmaceuticals thereof, and their use as potassium channel inhibitors useful for treating cardiac arrhythmias | |
| MY125749A (en) | Aralkyl and aralkylidene heterocyclic lactams and imides | |
| IL114156A0 (en) | Substituted azaindolylidene compounds process for their preparation pharmaceutical compositions containing them and their uses | |
| HUP9801435A2 (en) | 1-phenylpyrazole-3-carboxamides acting on neurotensin receptors, process for producing them and pharmaceutical compositions containing them | |
| MX9705590A (en) | Substituted heterocyclic compounds, preparation method therefor and pharmaceutical compositions containing same. | |
| YU21590A (en) | DERIVATIVES OF BENZOCONDENSED, N CONTAINING HETEROCYCLES AND PROCEDURE FOR THEIR PREPARATION | |
| PL322768A1 (en) | Novel derivatives of aryloglysinamide, methods of obtaining them and pharmaceutic compositions containing such compounds | |
| DK0773956T3 (en) | Purified form of streptogramins, their preparation and pharmaceutical compositions containing them | |
| HUP9902576A1 (en) | Novel erythromycin derivatives, method for preparing them, and use thereof as drugs | |
| TW342385B (en) | Bicyclic benzazepin, the process for their preparation and the pharmaceutical composition containing them | |
| PL308339A1 (en) | Novel biaromatic acetylene compounds incorporating adamantyl group, pharmaceutic and cosmetic compositions containing such compounds and their application | |
| PL308343A1 (en) | Novel bicyclic aromatic compounds, pharmaceutic and cosmetic compositions containing such compounds and method of using them | |
| ZA896645B (en) | Alpha a,alpha a-disubstituted n-cycloalkylalkylbenzylamines,process for their preparation,their use as a medicament and their synthesis intermediates | |
| GB2080296B (en) | 3,1-benzoxazin-2-ones the preparation and use thereof | |
| TW324007B (en) | N-substituted diazabicycloheptane derivative and its pharmaceutical use | |
| ES8205808A1 (en) | 2-penem-3-carboxylic acid derivatives and use | |
| GR3034516T3 (en) | PROCESS FOR THE PREPARATION OF AMIDINO PHENYL PYRROLIDINE -g(b)-ALANINE UREA ANALOGS | |
| AU1166988A (en) | New peptide derivatives having a polycyclic nitrogenous structure, process for the preparation thereof and pharmaceutical compositions containing them | |
| HUP0002035A2 (en) | Sulfonamidoalkyl-carbonyl-(carbomoyl-oxy)phenylalanine derivatives and pharmaceutical compositions containing them | |
| DE69002474D1 (en) | Carboxyalkyl-ether von 2-amino-7-hydroxytetralin. | |
| ZA912618B (en) | 3-aminochroman derivatives,process for preparing these and pharmaceutical compositions containing them | |
| MXPA02007973A (en) | Amino acid derivatives and use thereof as nep, ace and ece inhibitors. | |
| HUT43064A (en) | Process for producing 3-/acyl-amino-methyl/-imidazo-/1.2-a/-pyridine-derivatives and pharmaceutical preparations containing these components |