HU176308B - Process for producing phosphate-fertilizers - Google Patents
Process for producing phosphate-fertilizers Download PDFInfo
- Publication number
- HU176308B HU176308B HU77PO643A HUPO000643A HU176308B HU 176308 B HU176308 B HU 176308B HU 77PO643 A HU77PO643 A HU 77PO643A HU PO000643 A HUPO000643 A HU PO000643A HU 176308 B HU176308 B HU 176308B
- Authority
- HU
- Hungary
- Prior art keywords
- phosphate
- phosphorus
- fertilizers
- water
- soluble
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 17
- 239000003337 fertilizer Substances 0.000 title claims abstract description 16
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims abstract description 18
- 229910019142 PO4 Inorganic materials 0.000 claims abstract description 13
- 229910052500 inorganic mineral Inorganic materials 0.000 claims abstract description 11
- 239000011707 mineral Substances 0.000 claims abstract description 11
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims abstract description 11
- 239000010452 phosphate Substances 0.000 claims abstract description 11
- 238000004519 manufacturing process Methods 0.000 claims abstract description 5
- 239000000203 mixture Substances 0.000 claims description 12
- 239000002994 raw material Substances 0.000 claims description 10
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 claims description 4
- 239000002245 particle Substances 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 abstract description 15
- 239000011574 phosphorus Substances 0.000 abstract description 15
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 abstract description 14
- 239000007789 gas Substances 0.000 abstract description 13
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 14
- 235000021317 phosphate Nutrition 0.000 description 11
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical class [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 8
- 239000002426 superphosphate Substances 0.000 description 8
- 239000001506 calcium phosphate Substances 0.000 description 5
- 229910052585 phosphate mineral Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- VSIIXMUUUJUKCM-UHFFFAOYSA-D pentacalcium;fluoride;triphosphate Chemical group [F-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O VSIIXMUUUJUKCM-UHFFFAOYSA-D 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 3
- 235000019731 tricalcium phosphate Nutrition 0.000 description 3
- 229940078499 tricalcium phosphate Drugs 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 229910052586 apatite Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 230000029087 digestion Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 150000003018 phosphorus compounds Chemical class 0.000 description 2
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-L calcium bis(dihydrogenphosphate) Chemical compound [Ca+2].OP(O)([O-])=O.OP(O)([O-])=O YYRMJZQKEFZXMX-UHFFFAOYSA-L 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- 229910000150 monocalcium phosphate Inorganic materials 0.000 description 1
- 235000019691 monocalcium phosphate Nutrition 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000002686 phosphate fertilizer Substances 0.000 description 1
- -1 phosphorus compound Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B1/00—Superphosphates, i.e. fertilisers produced by reacting rock or bone phosphates with sulfuric or phosphoric acid in such amounts and concentrations as to yield solid products directly
- C05B1/02—Superphosphates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL1976188587A PL101814B1 (pl) | 1976-04-08 | 1976-04-08 | Method of manufacturing phosphatic fertilizers sposob wytwarzania nawozu fosforowego |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU176308B true HU176308B (en) | 1981-01-28 |
Family
ID=19976319
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU77PO643A HU176308B (en) | 1976-04-08 | 1977-04-08 | Process for producing phosphate-fertilizers |
Country Status (15)
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4501724A (en) * | 1984-02-01 | 1985-02-26 | Goers Associates Inc. | Method for the wet process manufacture of phosphoric acid |
| DE102015115119A1 (de) * | 2015-09-09 | 2017-03-09 | Wehrle-Werk Ag | Verfahren zur Phosphorrückgewinnung |
| CN112938917B (zh) * | 2021-01-28 | 2022-11-04 | 北京大学 | 高效纳米磷肥的制备方法以及纳米磷肥 |
-
1976
- 1976-04-08 PL PL1976188587A patent/PL101814B1/pl unknown
-
1977
- 1977-03-28 SU SU772463651A patent/SU849996A3/ru active
- 1977-03-30 DE DE19772714211 patent/DE2714211A1/de not_active Withdrawn
- 1977-03-30 GB GB13332/77A patent/GB1570947A/en not_active Expired
- 1977-03-31 BE BE176317A patent/BE853114A/xx unknown
- 1977-04-03 EG EG183/77A patent/EG12736A/xx active
- 1977-04-05 ES ES457542A patent/ES457542A1/es not_active Expired
- 1977-04-05 FR FR7710283A patent/FR2347324A1/fr not_active Withdrawn
- 1977-04-05 IT IT48835/77A patent/IT1115905B/it active
- 1977-04-06 CS CS772279A patent/CS197290B2/cs unknown
- 1977-04-06 DD DD7700198273A patent/DD129122A5/xx unknown
- 1977-04-07 NL NL7703828A patent/NL7703828A/xx active Search and Examination
- 1977-04-07 OA OA56130A patent/OA05626A/xx unknown
- 1977-04-08 JP JP4026777A patent/JPS52122564A/ja active Granted
- 1977-04-08 HU HU77PO643A patent/HU176308B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DD129122A5 (de) | 1977-12-28 |
| OA05626A (fr) | 1981-04-30 |
| BE853114A (fr) | 1977-07-18 |
| SU849996A3 (ru) | 1981-07-23 |
| FR2347324A1 (fr) | 1977-11-04 |
| JPS52122564A (en) | 1977-10-14 |
| DE2714211A1 (de) | 1977-10-20 |
| EG12736A (en) | 1980-07-31 |
| PL101814B1 (pl) | 1979-02-28 |
| ES457542A1 (es) | 1978-08-16 |
| CS197290B2 (en) | 1980-04-30 |
| IT1115905B (it) | 1986-02-10 |
| JPS5437119B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1979-11-13 |
| GB1570947A (en) | 1980-07-09 |
| NL7703828A (nl) | 1977-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2683075A (en) | Digestion of phosphate rock | |
| WO2017151017A1 (en) | Phosphorus-potassium-nitrogen-containing npk-fertilizer and a method for the preparation of granulated phosphorus-potassium-nitrogen-containing npk-fertilizer | |
| US3241946A (en) | Ammonium phosphate fertilizer solids derived from anhydrous liquid phosphoric acid | |
| US3107145A (en) | Process for defluorinating phosphatic materials | |
| HU176308B (en) | Process for producing phosphate-fertilizers | |
| US2504544A (en) | Process of manufacturing phosphoric acid | |
| US2108940A (en) | Process for making di-calcium phosphate | |
| CN103466583A (zh) | 一种磷铁氧化渣制取磷酸铁的方法 | |
| US2565351A (en) | Production of defluorinated tricalcium phosphate | |
| CN103588543B (zh) | 一种多营养脲硫酸硫基复合肥的生产方法 | |
| US2680679A (en) | Manufacture of fertilizers | |
| US3243279A (en) | Ammonium phosphate solids derived from anhydrous liquid phosphoric acid | |
| US1776595A (en) | Manufacture of phosphoric acid | |
| US1146222A (en) | Fertilizer. | |
| US3212874A (en) | Process for the production of phosphate fertilizer | |
| US2778712A (en) | Digestion of phosphate rock | |
| US2555634A (en) | Production of phosphate materials | |
| US2874036A (en) | Ammoniated superphosphates and process of producing same | |
| US2898207A (en) | Acidulation of phosphate | |
| US1326533A (en) | Process of making dicalcium phosphate and fertilizer material produced therein. | |
| US2992914A (en) | Phosphatic materials and methods for the production thereof | |
| JPH0345037B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| US2985527A (en) | Nitric acid process for the production of soluble phosphates | |
| US2643948A (en) | Method of producing a fertilizer from phosphate rock | |
| US1459124A (en) | Continuous process of making superphosphate |