GR33859B - Μεθοδοι παρασκευης υποκατεστημενων σαλικυλανιλιδιων. - Google Patents
Μεθοδοι παρασκευης υποκατεστημενων σαλικυλανιλιδιων.Info
- Publication number
- GR33859B GR33859B GR670133859A GR670133859A GR33859B GR 33859 B GR33859 B GR 33859B GR 670133859 A GR670133859 A GR 670133859A GR 670133859 A GR670133859 A GR 670133859A GR 33859 B GR33859 B GR 33859B
- Authority
- GR
- Greece
- Prior art keywords
- alkyl
- aryl
- hydroxy
- halogen
- formula
- Prior art date
Links
- -1 mercapto, hydroxy Chemical group 0.000 abstract 5
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 229910052736 halogen Inorganic materials 0.000 abstract 3
- 150000002367 halogens Chemical group 0.000 abstract 3
- 125000001188 haloalkyl group Chemical group 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 239000001257 hydrogen Substances 0.000 abstract 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000005236 alkanoylamino group Chemical group 0.000 abstract 1
- 125000003282 alkyl amino group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 230000003993 interaction Effects 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- WKEDVNSFRWHDNR-UHFFFAOYSA-N salicylanilide Chemical compound OC1=CC=CC=C1C(=O)NC1=CC=CC=C1 WKEDVNSFRWHDNR-UHFFFAOYSA-N 0.000 abstract 1
- 229950000975 salicylanilide Drugs 0.000 abstract 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical class OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 abstract 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 abstract 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 abstract 1
- 229910052717 sulfur Inorganic materials 0.000 abstract 1
- 239000011593 sulfur Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US55569466A | 1966-06-07 | 1966-06-07 | |
| US57347466A | 1966-08-19 | 1966-08-19 | |
| US63444267A | 1967-04-28 | 1967-04-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GR33859B true GR33859B (el) | 1968-02-09 |
Family
ID=27415707
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GR670133859A GR33859B (el) | 1966-06-07 | 1967-05-22 | Μεθοδοι παρασκευης υποκατεστημενων σαλικυλανιλιδιων. |
Country Status (10)
| Country | Link |
|---|---|
| BE (1) | BE699632A (enExample) |
| BR (1) | BR6790160D0 (enExample) |
| DE (1) | DE1618709B2 (enExample) |
| DK (1) | DK146016C (enExample) |
| ES (1) | ES341316A1 (enExample) |
| FR (1) | FR1605533A (enExample) |
| GB (1) | GB1183641A (enExample) |
| GR (1) | GR33859B (enExample) |
| IL (1) | IL27982A (enExample) |
| NL (1) | NL141088B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7012496A (enExample) * | 1969-09-08 | 1971-03-10 | ||
| FR2181790A1 (en) * | 1972-03-07 | 1973-12-07 | Janssen Pharmaceutica Nv | Salicylic acid anilides - from salicylic halides and aniline derivs, anthel-mintics, coccidiostatics |
| US4005218A (en) * | 1975-03-18 | 1977-01-25 | Janssen Pharmaceutica N.V. | Antiparasitic salicylanilide derivatives |
| US4470979A (en) * | 1982-09-17 | 1984-09-11 | Janssen Pharmaceutica N.V. | Chemical sterilization of insects with salicylanilides |
| ATE23419T1 (de) * | 1982-09-17 | 1986-11-15 | Janssen Pharmaceutica Nv | Salicylaniliden zur chemischen sterilisierung von insekten. |
| US4587361A (en) * | 1984-05-07 | 1986-05-06 | Smithkline Beckman Corporation | Anthelmintic benzamides |
| GB2247884B (en) * | 1990-09-11 | 1994-05-11 | Chanelle Chemicals Ltd | Manufacture of a salicylanilide derivative |
| WO2022076565A1 (en) | 2020-10-07 | 2022-04-14 | Sorrento Therapeutics, Inc. | Salicylanilide analogs for use in the treatment of coronavirus |
-
1967
- 1967-05-14 IL IL2798267A patent/IL27982A/xx unknown
- 1967-05-22 GR GR670133859A patent/GR33859B/el unknown
- 1967-06-02 ES ES341316A patent/ES341316A1/es not_active Expired
- 1967-06-05 GB GB2576267A patent/GB1183641A/en not_active Expired
- 1967-06-06 NL NL6707849A patent/NL141088B/xx not_active IP Right Cessation
- 1967-06-06 DK DK295167A patent/DK146016C/da not_active IP Right Cessation
- 1967-06-06 BR BR19016067A patent/BR6790160D0/pt unknown
- 1967-06-07 BE BE699632D patent/BE699632A/xx not_active IP Right Cessation
- 1967-06-07 DE DE19671618709 patent/DE1618709B2/de active Granted
- 1967-06-07 FR FR109487A patent/FR1605533A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BR6790160D0 (pt) | 1973-04-12 |
| NL141088B (nl) | 1974-02-15 |
| NL6707849A (enExample) | 1967-12-08 |
| DE1618709C3 (enExample) | 1974-10-17 |
| FR1605533A (en) | 1979-02-23 |
| DK146016C (da) | 1983-10-24 |
| ES341316A1 (es) | 1968-09-01 |
| IL27982A (en) | 1971-06-23 |
| GB1183641A (en) | 1970-03-11 |
| DE1618709A1 (de) | 1971-01-21 |
| DE1618709B2 (de) | 1974-03-07 |
| BE699632A (enExample) | 1967-12-07 |
| DK146016B (da) | 1983-05-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT352986B (de) | Vorrichtung zur herstellung von angemachtem moertel od.dgl. | |
| GR33859B (el) | Μεθοδοι παρασκευης υποκατεστημενων σαλικυλανιλιδιων. | |
| ES420258A1 (es) | Procedimiento para preparar tetrahidro-1,3,5-triacin-2,6- dionas. | |
| AT301865B (de) | Blasform zur Herstellung von Bällen od.dgl. | |
| CH484184A (de) | Verfahren zur Herstellung von Derivaten des 2-Amino-4H-5,6-dihydro-1,3-thiazins | |
| AT278679B (de) | Vorrichtung zur Herstellung von Windeln, Binden od.dgl. | |
| CH454833A (de) | Verfahren zur Herstellung von Perchlormethylmerkaptan | |
| AT251626B (de) | Gasbrennerheizvorrichtung zur Beheizung von Eisenbahnschienen od. dgl. | |
| AT268640B (de) | Verfahren zur Herstellung flexibler Behälter od.dgl. | |
| CH432482A (de) | Verfahren zur Herstellung von reinen, gelben Phosphorsulfiden | |
| GB1089735A (en) | Preparation of sulfonyl semicarbozides | |
| GB1044460A (en) | Novel anticoccidial compositions and a process for the manufacture thereof | |
| ES445073A1 (es) | Procedimiento para preparar derivados de 5-nitrotiazolilimi-dazolidina. | |
| GR37151B (el) | Μεθοδσο δια την παρασκευην νεων ενωσεων θειου των1,2-διθειολ-3-ονων και η χρησιμοποιησις αυτων διατην καταπολεμησιν μικροοργανισμων. | |
| PH15011A (en) | Novel dihydrobenzanthracene derivatives | |
| GR25548B (el) | Μεθοδος δια την παρασκευην εστερων του θειοφωσφονικου οξεος. | |
| CH433319A (de) | Verfahren zur Herstellung von Derivaten des 2-Phenylamino-3H-5,6-dihydro-1,3-thiazins | |
| CH470370A (de) | Verfahren zur Herstellung von Tetraalkyl-thiuramdisulfiden | |
| AT184596B (de) | Mittel zur Vermauerung feuerfester magnesiahaltiger Steine | |
| ATA426375A (de) | Ausziehfuhrung fur schubladen od.dgl. | |
| AT266132B (de) | Verfahren zur Herstellung neuer Sulfinyl- oder Sulfonylpyridinverbindungen | |
| AT254889B (de) | Verfahren zur Herstellung von Derivaten des 2-Amino-4H-5,6-dihydro-1,3-thiazins und ihren Salzen | |
| AT342278B (de) | Vorrichtung zur langenverstellung von gerusten, stutzen od.dgl. | |
| BR7602707A (pt) | Sistema de alinhamento para estabelecimento do percurso de um transportador e respectivo transportador | |
| CH446339A (de) | Verfahren zur Herstellung von Derivaten des 2-Amino-4H-5,6-dihydro-1,3-thiazins |