GB9220616D0 - Releasably bound propionic acid - Google Patents
Releasably bound propionic acidInfo
- Publication number
- GB9220616D0 GB9220616D0 GB929220616A GB9220616A GB9220616D0 GB 9220616 D0 GB9220616 D0 GB 9220616D0 GB 929220616 A GB929220616 A GB 929220616A GB 9220616 A GB9220616 A GB 9220616A GB 9220616 D0 GB9220616 D0 GB 9220616D0
- Authority
- GB
- United Kingdom
- Prior art keywords
- propionic acid
- releasably bound
- bound propionic
- releasably
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 title 2
- 235000019260 propionic acid Nutrition 0.000 title 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 title 1
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB929220616A GB9220616D0 (en) | 1992-09-30 | 1992-09-30 | Releasably bound propionic acid |
| EP93307486A EP0590856B1 (en) | 1992-09-30 | 1993-09-22 | Releasably bound carboxylic acids |
| DK93307486.6T DK0590856T3 (en) | 1992-09-30 | 1993-09-22 | Freely bound carboxylic acids |
| ES93307486T ES2093934T3 (en) | 1992-09-30 | 1993-09-22 | LIBERABLY FIXED CARBOXYLIC ACIDS. |
| DE69305714T DE69305714T2 (en) | 1992-09-30 | 1993-09-22 | Removable carboxylic acids |
| US08/126,050 US5380939A (en) | 1992-09-30 | 1993-09-23 | Releasably bound carboxylic acids |
| CA002107163A CA2107163A1 (en) | 1992-09-30 | 1993-09-28 | Releasably bound carboxylic acids |
| JP5244390A JPH06192166A (en) | 1992-09-30 | 1993-09-30 | Composition to store and to use acetic acid or propionic acid |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB929220616A GB9220616D0 (en) | 1992-09-30 | 1992-09-30 | Releasably bound propionic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB9220616D0 true GB9220616D0 (en) | 1992-11-11 |
Family
ID=10722752
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB929220616A Pending GB9220616D0 (en) | 1992-09-30 | 1992-09-30 | Releasably bound propionic acid |
Country Status (1)
| Country | Link |
|---|---|
| GB (1) | GB9220616D0 (en) |
-
1992
- 1992-09-30 GB GB929220616A patent/GB9220616D0/en active Pending
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU9303349D0 (en) | Clamp dog | |
| HU9401917D0 (en) | Propionic acid derivatives | |
| ZA937474B (en) | Quinolonecarboxylic acids | |
| ZA94332B (en) | Quinolone- and naphtyridonecarboxylic acid derivatives | |
| SG54218A1 (en) | 2-keto-3-methyl-4-hydroxy-valeric acid | |
| ZA93190B (en) | Benzofuranyl- and thiophenylmethylthio-alkanecarboxylic acid derivatives | |
| ZA95225B (en) | alpha-pyrimidinyl acrylic acid derivatives | |
| ZA938988B (en) | Substituted benzoic acids | |
| HU9403116D0 (en) | Epoxy-succinic acid derivatives | |
| GB2263148B (en) | Structural connection | |
| GB9203624D0 (en) | Towing connection | |
| GR3030629T3 (en) | Clavulanic acid salts | |
| HU9400720D0 (en) | Acyl-oxy-hexanic acid derivatives | |
| GB9311538D0 (en) | Filter device for acid | |
| ZA931367B (en) | Sulphonylbenzyl-substituted imidazolylpropenoic acid derivatives | |
| GB9220616D0 (en) | Releasably bound propionic acid | |
| GB9301532D0 (en) | Releasably bound hydroxycarboxylic acids | |
| ZW7994A1 (en) | 2-oximino-2-thienyl-acetic acid derivatives | |
| GB9221528D0 (en) | Releasably bound acetic acid | |
| ZA93125B (en) | Quinolone- and naphthyridone-carboxylic acid derivatives | |
| HU9301617D0 (en) | New thio-semicarbazone acid esters | |
| ZA941923B (en) | Phenoxyphenylacetic acid derivatives | |
| GB9125744D0 (en) | Releasably bound formic acid | |
| GB2271184B (en) | Drive system | |
| GB9215269D0 (en) | Hook adaptor |