GB8928444D0 - Flame retardant polymer composition - Google Patents
Flame retardant polymer compositionInfo
- Publication number
- GB8928444D0 GB8928444D0 GB898928444A GB8928444A GB8928444D0 GB 8928444 D0 GB8928444 D0 GB 8928444D0 GB 898928444 A GB898928444 A GB 898928444A GB 8928444 A GB8928444 A GB 8928444A GB 8928444 D0 GB8928444 D0 GB 8928444D0
- Authority
- GB
- United Kingdom
- Prior art keywords
- flame retardant
- polymer composition
- retardant polymer
- composition
- flame
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title 1
- 239000003063 flame retardant Substances 0.000 title 1
- 229920000642 polymer Polymers 0.000 title 1
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB898928444A GB8928444D0 (en) | 1989-12-16 | 1989-12-16 | Flame retardant polymer composition |
| US07/506,787 US5091453A (en) | 1989-04-21 | 1990-04-10 | Flame retardant polymer composition |
| CA002014357A CA2014357A1 (en) | 1989-04-21 | 1990-04-11 | Flame retardant polymer composition |
| DK90304046.7T DK0393959T3 (en) | 1989-04-21 | 1990-04-12 | Flame retardant polymer composition |
| EP90304046A EP0393959B1 (en) | 1989-04-21 | 1990-04-12 | Flame retardant polymer composition |
| ES90304046T ES2077644T3 (en) | 1989-04-21 | 1990-04-12 | FLAME RETARDING POLYMER COMPOSITIONS. |
| DE69023039T DE69023039T2 (en) | 1989-04-21 | 1990-04-12 | Refractory polymer composition. |
| AT90304046T ATE129272T1 (en) | 1989-04-21 | 1990-04-12 | FIREPROOF POLYMER COMPOSITION. |
| JP2097821A JP3037713B2 (en) | 1989-04-21 | 1990-04-16 | Flame retardant polymer composition |
| NZ233370A NZ233370A (en) | 1989-04-21 | 1990-04-19 | Flame retardent compositions comprising an ethylene containing copolymer, a silicone and an inorganic filler which is an alkaline-earth compound |
| NO901755A NO307791B1 (en) | 1989-04-21 | 1990-04-20 | Flame retardant polymer composition on ethylene polymer basis and use thereof |
| AU53720/90A AU627296B2 (en) | 1989-04-21 | 1990-04-20 | Flame retardant polymer composition |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB898928444A GB8928444D0 (en) | 1989-12-16 | 1989-12-16 | Flame retardant polymer composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB8928444D0 true GB8928444D0 (en) | 1990-02-21 |
Family
ID=10668056
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB898928444A Pending GB8928444D0 (en) | 1989-04-21 | 1989-12-16 | Flame retardant polymer composition |
Country Status (1)
| Country | Link |
|---|---|
| GB (1) | GB8928444D0 (en) |
-
1989
- 1989-12-16 GB GB898928444A patent/GB8928444D0/en active Pending
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB8611357D0 (en) | Flame retardent polymer compositions | |
| EP0534297A3 (en) | Flame retardant moulding composition | |
| EP0415371A3 (en) | Self-extinguishing polymeric compositions | |
| ZA887830B (en) | Flame retardant polymer composition | |
| ZA902379B (en) | Flame retardant composition | |
| EP0415070A3 (en) | Flame retardant aromatic polycarbonate compositions | |
| ZA902382B (en) | Flame retardant compositions | |
| GB2231333B (en) | Flame retardant polymer compositions | |
| GB8918881D0 (en) | Flame retardants | |
| EP0441134A3 (en) | Flame retardant polymeric compositions | |
| GB8811995D0 (en) | Flame retardant polymer composition | |
| GB9008652D0 (en) | Flame retardant compositions | |
| EP0227912A3 (en) | Flame retardant polymer compositions | |
| GB2186878B (en) | Flame retardant resin compositions | |
| EP0472035A3 (en) | Flame retardant crosslinkable polymeric compositions | |
| AU3168289A (en) | Flame retardant polymer compositions | |
| EP0462722A3 (en) | Flame retardant composition | |
| GB8823481D0 (en) | Flame retardant compositions | |
| AU622003B2 (en) | Flame retardant compositions | |
| GB8900060D0 (en) | Flame retardant composition | |
| EP0410221A3 (en) | Flame retardant compositions | |
| GB2180541B (en) | Flame retardant polymer compositions | |
| IL78935A (en) | Flame retardant polymer compositions | |
| EP0425894A3 (en) | Flame retardant polycarbonate blends | |
| EP0490354A3 (en) | Flame retardant compositions |