GB1496844A - Stabilization of polymers - Google Patents
Stabilization of polymersInfo
- Publication number
- GB1496844A GB1496844A GB23352/75A GB2335275A GB1496844A GB 1496844 A GB1496844 A GB 1496844A GB 23352/75 A GB23352/75 A GB 23352/75A GB 2335275 A GB2335275 A GB 2335275A GB 1496844 A GB1496844 A GB 1496844A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alkyl
- tetrahydropyrimidine
- formula
- aralkyl
- alkynyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000642 polymer Polymers 0.000 title abstract 3
- 230000006641 stabilisation Effects 0.000 title 1
- 238000011105 stabilization Methods 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 5
- 125000003342 alkenyl group Chemical group 0.000 abstract 2
- 125000000304 alkynyl group Chemical group 0.000 abstract 2
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 239000003381 stabilizer Substances 0.000 abstract 2
- 125000006545 (C1-C9) alkyl group Chemical group 0.000 abstract 1
- VJQCDDCJGGYCDP-UHFFFAOYSA-N 2,2,4,6,6-pentaethyl-5-methyl-1,5-dihydropyrimidine Chemical compound CCC1=NC(CC)(CC)NC(CC)(CC)C1C VJQCDDCJGGYCDP-UHFFFAOYSA-N 0.000 abstract 1
- PLWSZFMXEYJTBC-UHFFFAOYSA-N 2,4,6-triethyl-2,6-dimethyl-1,5-dihydropyrimidine Chemical compound CCC1=NC(C)(CC)NC(C)(CC)C1 PLWSZFMXEYJTBC-UHFFFAOYSA-N 0.000 abstract 1
- SFURCKGWKWKOKM-UHFFFAOYSA-N 2,6-dimethyl-2,4,6-tripropyl-1,5-dihydropyrimidine Chemical compound CCCC1=NC(C)(CCC)NC(C)(CCC)C1 SFURCKGWKWKOKM-UHFFFAOYSA-N 0.000 abstract 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 abstract 1
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical class O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000004450 alkenylene group Chemical group 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 150000007942 carboxylates Chemical group 0.000 abstract 1
- 238000007796 conventional method Methods 0.000 abstract 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 abstract 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 abstract 1
- 125000004185 ester group Chemical group 0.000 abstract 1
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 230000007062 hydrolysis Effects 0.000 abstract 1
- 238000006460 hydrolysis reaction Methods 0.000 abstract 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 150000003053 piperidines Chemical class 0.000 abstract 1
- 238000006467 substitution reaction Methods 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3435—Piperidines
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB23352/75A GB1496844A (en) | 1975-05-28 | 1975-05-28 | Stabilization of polymers |
| DE19762621841 DE2621841A1 (de) | 1975-05-28 | 1976-05-17 | Lichtschutzmittel fuer polymere |
| US05/687,823 US4131599A (en) | 1975-05-28 | 1976-05-19 | Stabilization of poly(mono-olefins) |
| CH645076A CH602844A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-05-28 | 1976-05-21 | |
| FR7615927A FR2312533A1 (fr) | 1975-05-28 | 1976-05-26 | Stabilisation de matieres polymeres au moyen de derives polyalkyles de la piperidine |
| JP51061551A JPS51142046A (en) | 1975-05-28 | 1976-05-27 | Stabilized polymer composition |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB23352/75A GB1496844A (en) | 1975-05-28 | 1975-05-28 | Stabilization of polymers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1496844A true GB1496844A (en) | 1978-01-05 |
Family
ID=10194277
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB23352/75A Expired GB1496844A (en) | 1975-05-28 | 1975-05-28 | Stabilization of polymers |
Country Status (6)
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2335190A (en) * | 1998-03-09 | 1999-09-15 | Ciba Geigy Ag | 1-Alkoxy-polyalkyl-piperidine derivatives and their use as polymerization regulators |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4210578A (en) * | 1975-05-28 | 1980-07-01 | Ciba-Geigy Corporation | 4-Siloxy derivatives of polyalkylated piperidines |
| US4292237A (en) * | 1977-11-14 | 1981-09-29 | The B. F. Goodrich Company | Polymeric ultraviolet light stabilizers containing hindered alkyl amines |
| JPS60197775A (ja) | 1984-03-21 | 1985-10-07 | Adeka Argus Chem Co Ltd | 熱硬化性合成樹脂塗料組成物 |
| EP0518197B1 (en) * | 1991-06-03 | 1994-12-21 | Mitsubishi Chemical Corporation | Piperidine derivatives |
| US5260443A (en) * | 1991-06-03 | 1993-11-09 | Mitsubishi Petrochemical Company Limited | Piperidine derivatives as photostabilizer |
| EP0559611B1 (de) * | 1992-03-05 | 1999-11-17 | Ciba SC Holding AG | Stabilisierung von Pyrrolopyrrolpigmenten |
| EP0559613B1 (de) * | 1992-03-05 | 1999-12-15 | Ciba SC Holding AG | Stabilisierung von organischen Pigmenten |
| ES2111887T3 (es) * | 1993-02-23 | 1998-03-16 | Ciba Geigy Ag | Dicetopirrolopirroles que contienen grupos nitroxilo. |
| EP0638616A1 (de) * | 1993-08-13 | 1995-02-15 | Ciba-Geigy Ag | Pigmentsalze |
| TW546311B (en) * | 1999-11-25 | 2003-08-11 | Ciba Sc Holding Ag | Composition and method for color improvement of nitroxyl containing polymers |
| ATE499375T1 (de) | 2000-05-19 | 2011-03-15 | Basf Se | Verfahren zur kontrollierten erhöhung des molekulargewichts von polyethylen und polyethylenmischungen |
| ATE490993T1 (de) | 2006-10-02 | 2010-12-15 | Borealis Tech Oy | Polyolefinzusammensetzung mit verbesserter resistenz gegenüber cio2-enthaltenden wasser |
| CN105358528B (zh) | 2013-07-08 | 2021-07-20 | 巴斯夫欧洲公司 | 新型光稳定剂 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE565983A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | ||||
| NL101733C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1957-02-13 | |||
| US3103542A (en) * | 1959-11-25 | 1963-09-10 | Natural rubber stabilized with alkyl | |
| FR1274238A (fr) | 1959-11-25 | 1961-10-20 | Ici Ltd | Application de composés hétérocycliques alkyl-substitués comme agents anti-ozone |
| NL154241C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1971-01-29 | 1900-01-01 | ||
| US3992390A (en) * | 1971-11-30 | 1976-11-16 | Brian Holt | Esters of piperidinols |
| GB1398412A (en) * | 1972-07-28 | 1975-06-18 | Ciba Geigy Ag | Piperidine derivatives |
| GB1398413A (en) * | 1972-07-28 | 1975-06-18 | Ciba Geigy Ag | Piperidine derivatives |
| US3998784A (en) * | 1972-07-28 | 1976-12-21 | Ciba-Geigy Corporation | Compositions stabilized with piperidine derivatives |
| US3975357A (en) * | 1973-04-19 | 1976-08-17 | Sankyo Company Limited | Stabilized synthetic polymer compositions |
| CH589056A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1973-12-10 | 1977-06-30 | Ciba Geigy Ag |
-
1975
- 1975-05-28 GB GB23352/75A patent/GB1496844A/en not_active Expired
-
1976
- 1976-05-17 DE DE19762621841 patent/DE2621841A1/de active Pending
- 1976-05-19 US US05/687,823 patent/US4131599A/en not_active Expired - Lifetime
- 1976-05-21 CH CH645076A patent/CH602844A5/xx not_active IP Right Cessation
- 1976-05-26 FR FR7615927A patent/FR2312533A1/fr active Granted
- 1976-05-27 JP JP51061551A patent/JPS51142046A/ja active Pending
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2335190A (en) * | 1998-03-09 | 1999-09-15 | Ciba Geigy Ag | 1-Alkoxy-polyalkyl-piperidine derivatives and their use as polymerization regulators |
| GB2335190B (en) * | 1998-03-09 | 2000-05-31 | Ciba Sc Holding Ag | 1-Alkoxy-polyalkyl-piperidine derivatives and their use as polymerization regulators |
| SG82601A1 (en) * | 1998-03-09 | 2001-08-21 | Ciba Sc Holding Ag | 1-alkoxy-polyalkyl-piperidine derivatives and their use as polymerization regulators |
| US6353107B1 (en) | 1998-03-09 | 2002-03-05 | Ciba Specialty Chemicals Corporation | 1-alkoxy-polyallkyl-piperidine derivatives and their use as polymerization regulators |
| AU754927B2 (en) * | 1998-03-09 | 2002-11-28 | Ciba Specialty Chemicals Holding Inc. | 1-Alkoxy-polyalkyl-piperidine derivatives and their use as polymerization regulators |
| US6683142B2 (en) | 1998-03-09 | 2004-01-27 | Ciba Specialty Chemicals Corporation | 1-alkoxy-polyalkyl-piperidine derivatives and their use as polymerization regulators |
| US6927295B2 (en) | 1998-03-09 | 2005-08-09 | Ciba Specialty Chemicals Corp. | 1-alkoxy-polyalkyl-piperidine derivatives and their use as polymerization regulators |
| US7402639B2 (en) | 1998-03-09 | 2008-07-22 | Ciba Specialty Chemicals Corp. | 1-alkoxy-polyalkyl-piperidine derivatives and their use as polymerization regulators |
| DE19909767B4 (de) * | 1998-03-09 | 2015-04-30 | Ciba Holding Inc. | 1-Alkoxypolyalkylpiperidinderivate und ihre Verwendung als Polymerisationsregler |
Also Published As
| Publication number | Publication date |
|---|---|
| US4131599A (en) | 1978-12-26 |
| CH602844A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1978-08-15 |
| FR2312533B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1978-11-17 |
| FR2312533A1 (fr) | 1976-12-24 |
| DE2621841A1 (de) | 1976-12-16 |
| JPS51142046A (en) | 1976-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1496844A (en) | Stabilization of polymers | |
| GB1498199A (en) | Fungicidal agents | |
| AU6690686A (en) | Piperdine derivative and pharmaceutical composition | |
| GB1442100A (en) | Hydroxybenzylmalonic acid derivatives and their use as stabilisers for synthetic polymers | |
| GB1496454A (en) | Stabilization of polymers | |
| AU563683B2 (en) | Substituted acyl derivative of 1,2,3,4-tetrahydroiso- quinoline-3-carboxylic acid | |
| GB1492494A (en) | Derivatives of 4-aminopiperidine | |
| IE39578L (en) | Imidazolyl-o,n-acetals | |
| GB1394952A (en) | Piperidine derivatives and their use as polymer stabilizers | |
| IE40409B1 (en) | Novel 2,6-dusubstituted phenyl-aminoguanidine compounds | |
| IE860411L (en) | N, n - disubstituted aminoacidamides | |
| GB1478261A (en) | Derivatives of 4-oxopiperidines | |
| MY101142A (en) | 1, 4-dihydropyridine derivative, process for production thereof, and pharmaceutical use thereof. | |
| GB1464324A (en) | 1,4-dihydropyridines and ''ocesses for their manufacture | |
| GB1369248A (en) | Amides the preparation thereof and their use in pharmacjeutical compositions | |
| IE43847L (en) | N-substituted phenylpiperidine derivatives. | |
| GB1403942A (en) | Piperidine derivatives | |
| SE7503520L (sv) | Mikrobiocider. | |
| GB1402889A (en) | Piperidine derivatives | |
| GB1417835A (en) | Piperidine derivatives for the stabilization of synthetic polymers | |
| SE7407449L (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| GB1139135A (en) | Aminoalkyl-substituted indanes and pharmaceutical compositions containing them | |
| HK18082A (en) | Hexahydroazepine, piperidine and pyrrolidine derivatives | |
| ES8703442A1 (es) | Procedimiento para preparar derivados monobasicos de disobu-tamida | |
| ES8405020A1 (es) | Un procedimiento para la preparacion de derivados de fosfolipidos. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |