GB0029393D0 - Hydroxamic and carboxylic acid derivatives - Google Patents
Hydroxamic and carboxylic acid derivativesInfo
- Publication number
- GB0029393D0 GB0029393D0 GB0029393A GB0029393A GB0029393D0 GB 0029393 D0 GB0029393 D0 GB 0029393D0 GB 0029393 A GB0029393 A GB 0029393A GB 0029393 A GB0029393 A GB 0029393A GB 0029393 D0 GB0029393 D0 GB 0029393D0
- Authority
- GB
- United Kingdom
- Prior art keywords
- hydroxamic
- carboxylic acid
- acid derivatives
- derivatives
- carboxylic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 title 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 title 1
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB0029393A GB0029393D0 (en) | 2000-12-01 | 2000-12-01 | Hydroxamic and carboxylic acid derivatives |
| CA002409035A CA2409035A1 (en) | 2000-05-15 | 2001-05-15 | Hydroxamic acid derivatives |
| DE60101224T DE60101224T2 (en) | 2000-05-15 | 2001-05-15 | Hydroxamic acid derivatives |
| EP01931847A EP1282614B1 (en) | 2000-05-15 | 2001-05-15 | Hydroxamic acid derivatives |
| AT01931847T ATE254118T1 (en) | 2000-05-15 | 2001-05-15 | HYDROXAMIC ACID DERIVATIVES |
| PCT/GB2001/002151 WO2001087870A1 (en) | 2000-05-15 | 2001-05-15 | Hydroxamic acid derivatives |
| ES01931847T ES2208595T3 (en) | 2000-05-15 | 2001-05-15 | DERIVATIVES OF HYDROXAMIC ACID. |
| AU58540/01A AU778368B2 (en) | 2000-05-15 | 2001-05-15 | Hydroxamic acid derivatives |
| JP2001584266A JP2003533521A (en) | 2000-05-15 | 2001-05-15 | Hydroxamic acid derivative |
| US09/858,106 US6809100B2 (en) | 2000-05-15 | 2001-05-15 | Hydroxamic acid derivatives |
| US10/460,894 US6787536B2 (en) | 2000-05-15 | 2003-06-12 | Hydroxamic acid derivatives |
| US10/902,753 US20040266764A1 (en) | 2000-05-15 | 2004-07-29 | Hydroxamic acid derivatives |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB0029393A GB0029393D0 (en) | 2000-12-01 | 2000-12-01 | Hydroxamic and carboxylic acid derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB0029393D0 true GB0029393D0 (en) | 2001-01-17 |
Family
ID=9904300
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB0029393A Ceased GB0029393D0 (en) | 2000-05-15 | 2000-12-01 | Hydroxamic and carboxylic acid derivatives |
Country Status (1)
| Country | Link |
|---|---|
| GB (1) | GB0029393D0 (en) |
-
2000
- 2000-12-01 GB GB0029393A patent/GB0029393D0/en not_active Ceased
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU3312100A (en) | Hydroxamic and carboxylic acid derivatives | |
| IL193071A0 (en) | Cyclopropyl carboxylic acid esters and derivatives | |
| IL154031A0 (en) | Substituted sulfonylaminomethylbenzoic acid derivatives and preparation | |
| EP1216980A4 (en) | Carboxylic acid derivatives and drugs containing the same | |
| PL367196A1 (en) | Carboxylic acid derivative and salt thereof | |
| HUP0200119A3 (en) | Sulfamato hydroxamic acid metalloprotease inhibitor | |
| HUP0100597A3 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB9911071D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| IL147216A0 (en) | Arylsulfonamido-substituted hydroxamic acid derivatives | |
| HUP0303694A3 (en) | Aza-amino acid derivatives and pharmaceutical | |
| GB9929979D0 (en) | Hydroxamic acid derivatives | |
| IL154633A0 (en) | Substituted phenylcyclohexane carboxylic acid amides and the use thereof | |
| GB9911075D0 (en) | HYdroxamic and carboxylic acid derivatives | |
| GB9911073D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB0011720D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB0029393D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB0107359D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB0107362D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB9927782D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB9911072D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB9906585D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB9906581D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| IL148669A0 (en) | 7-acylamino-3-heteroarylthio-3-cephem carboxylic acid antibiotics and prodrugs thereof | |
| GB9813932D0 (en) | Hydroxamic and carboxylic acid derivatives | |
| GB9819570D0 (en) | Hydroxamic and carboxylic acid derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AT | Applications terminated before publication under section 16(1) |