FR2235114A1 - 2-(Di-substd-amino)-4-nitro-phenyl N-substd carbamates - pesticides, esp. insecticides, used to control plant and animal pests - Google Patents
2-(Di-substd-amino)-4-nitro-phenyl N-substd carbamates - pesticides, esp. insecticides, used to control plant and animal pestsInfo
- Publication number
- FR2235114A1 FR2235114A1 FR7421564A FR7421564A FR2235114A1 FR 2235114 A1 FR2235114 A1 FR 2235114A1 FR 7421564 A FR7421564 A FR 7421564A FR 7421564 A FR7421564 A FR 7421564A FR 2235114 A1 FR2235114 A1 FR 2235114A1
- Authority
- FR
- France
- Prior art keywords
- substd
- alkyl
- nitro
- esp
- carbamates
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 241000607479 Yersinia pestis Species 0.000 title 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
- 239000000575 pesticide Substances 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 6
- 125000003342 alkenyl group Chemical group 0.000 abstract 2
- 125000000304 alkynyl group Chemical group 0.000 abstract 2
- 125000001589 carboacyl group Chemical group 0.000 abstract 2
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- -1 cyano, nitro thiocyanato, carboxyl Chemical group 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/26—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring
- C07C271/28—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring to a carbon atom of a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C269/00—Preparation of derivatives of carbamic acid, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C269/04—Preparation of derivatives of carbamic acid, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups from amines with formation of carbamate groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/16—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/20—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/22—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/40—Esters of carbamic acids having oxygen atoms of carbamate groups bound to carbon atoms of six-membered aromatic rings
- C07C271/42—Esters of carbamic acids having oxygen atoms of carbamate groups bound to carbon atoms of six-membered aromatic rings with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/44—Esters of carbamic acids having oxygen atoms of carbamate groups bound to carbon atoms of six-membered aromatic rings with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/04—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms
- C07C275/20—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an unsaturated carbon skeleton
- C07C275/24—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3039473 | 1973-06-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2235114A1 true FR2235114A1 (en) | 1975-01-24 |
| FR2235114B3 FR2235114B3 (enrdf_load_stackoverflow) | 1977-04-22 |
Family
ID=10306993
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR7421564A Granted FR2235114A1 (en) | 1973-06-26 | 1974-06-21 | 2-(Di-substd-amino)-4-nitro-phenyl N-substd carbamates - pesticides, esp. insecticides, used to control plant and animal pests |
Country Status (11)
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53134086A (en) * | 1977-07-18 | 1978-11-22 | Dainippon Printing Co Ltd | Photopolymerizable composition |
| JPS58167606A (ja) * | 1982-03-27 | 1983-10-03 | Toagosei Chem Ind Co Ltd | ラジカル共重合によるグラフト共重合体の製造方法 |
| US4504629A (en) * | 1983-07-20 | 1985-03-12 | Loctite Corporation | Polymers with graft α-alkylacrylate functionality |
| JPS60123518A (ja) * | 1983-12-09 | 1985-07-02 | Toagosei Chem Ind Co Ltd | シリコ−ン系グラフト共重合体の製造方法 |
-
1974
- 1974-06-17 ZA ZA00743852A patent/ZA743852B/xx unknown
- 1974-06-18 IL IL45061A patent/IL45061A0/xx unknown
- 1974-06-20 BE BE145675A patent/BE816621A/xx unknown
- 1974-06-21 FR FR7421564A patent/FR2235114A1/fr active Granted
- 1974-06-24 AU AU70400/74A patent/AU7040074A/en not_active Expired
- 1974-06-24 DE DE2430207A patent/DE2430207A1/de active Pending
- 1974-06-25 DD DD185579A patent/DD118417A5/xx unknown
- 1974-06-25 BR BR5203/74A patent/BR7405203D0/pt unknown
- 1974-06-25 DD DD179460A patent/DD114497A5/xx unknown
- 1974-06-25 DK DK341374A patent/DK341374A/da unknown
- 1974-06-25 NL NL7408508A patent/NL7408508A/xx unknown
- 1974-06-26 JP JP49072434A patent/JPS5031041A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IL45061A0 (en) | 1974-09-10 |
| DD118417A5 (enrdf_load_stackoverflow) | 1976-03-05 |
| DE2430207A1 (de) | 1975-01-16 |
| ZA743852B (en) | 1975-10-29 |
| NL7408508A (enrdf_load_stackoverflow) | 1974-12-30 |
| BE816621A (fr) | 1974-12-20 |
| BR7405203D0 (pt) | 1975-01-07 |
| FR2235114B3 (enrdf_load_stackoverflow) | 1977-04-22 |
| AU7040074A (en) | 1976-01-08 |
| JPS5031041A (enrdf_load_stackoverflow) | 1975-03-27 |
| DK341374A (enrdf_load_stackoverflow) | 1975-02-24 |
| DD114497A5 (enrdf_load_stackoverflow) | 1975-08-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BR7402416D0 (pt) | Seringa para injecoes de utilizacao unica | |
| DK142411C (da) | Fungicidt virksomme imidazolderivater og salte deraf til anvendelse ved plantebeskyttelse og andre tekniske formaal | |
| MY7800043A (en) | Carboxyethyl ester of n-phosphono-methyl glycine salts thereof,and their use as herbicides | |
| FR2235114A1 (en) | 2-(Di-substd-amino)-4-nitro-phenyl N-substd carbamates - pesticides, esp. insecticides, used to control plant and animal pests | |
| BE797897A (fr) | Compositions herbicides ameliorees | |
| BE771928A (fr) | Compositions antidotes et procede pour les utiliser avec des herbicide | |
| BR7501160A (pt) | Dispositivo aperfeicoado para montagem de rolos transportadores | |
| RO63674A (fr) | Compositions herbicides sinergetiques | |
| BE820131A (fr) | Agents herbicides | |
| FI52861C (fi) | Menetelmä antimikrobisesti vaikuttavien 2-(5-nitro-2-imidatsolyyli)-be ntsimidatsolien valmistamiseksi. | |
| IT1020330B (it) | Laser perfezionato | |
| BE806600A (fr) | Compositions herbicides | |
| BE822529A (fr) | Herbicides heterocycliques | |
| FI46502C (fi) | Herbisidaalisesti vaikuttavat 2,6-diklooritiobentsohydratsidit ja mene telmä niiden valmistamiseksi. | |
| BE821043A (fr) | Nouvelles compositions herbicides | |
| BE807594A (fr) | Agents herbicides | |
| BR7306118D0 (pt) | Carreta e maquina para pulverizacao de inseticidas | |
| FR1466702A (fr) | 2-(2, 6-dihalogénophényl)-4-hydroxy-5-carboxyméthylthiazoles et leurs esters alcoyliques comme herbicides | |
| AR207967A1 (es) | Procedimiento microbiologico para preparar 2-(6'-carbometoxihexil)-4(r)-hidroxiciclopentano-1,3-diona | |
| BE821017A (fr) | Articles insecticides pour animaux | |
| BE813178A (nl) | Opslagplaats voor hooi. | |
| AR195833A1 (es) | Composicion herbicida para malezas | |
| ES207540Y (es) | Jaula perfeccionada para animales domesticos. | |
| ES181328Y (es) | Bebedero perfeccionado para animales. | |
| FR2280318B1 (fr) | Compositions herbicides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ST | Notification of lapse |