FR1336070A - Phenoxazine derivatives and their preparation - Google Patents
Phenoxazine derivatives and their preparationInfo
- Publication number
- FR1336070A FR1336070A FR835540A FR835540A FR1336070A FR 1336070 A FR1336070 A FR 1336070A FR 835540 A FR835540 A FR 835540A FR 835540 A FR835540 A FR 835540A FR 1336070 A FR1336070 A FR 1336070A
- Authority
- FR
- France
- Prior art keywords
- preparation
- phenoxazine derivatives
- phenoxazine
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000001644 phenoxazinyl group Chemical class C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/34—1,4-Oxazines; Hydrogenated 1,4-oxazines condensed with carbocyclic rings
- C07D265/38—[b, e]-condensed with two six-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR835540A FR1336070A (en) | 1960-08-10 | 1960-08-10 | Phenoxazine derivatives and their preparation |
| FR866948A FR81408E (en) | 1960-08-10 | 1961-07-04 | Phenoxazine derivatives and their preparation |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR835540A FR1336070A (en) | 1960-08-10 | 1960-08-10 | Phenoxazine derivatives and their preparation |
| FR866948A FR81408E (en) | 1960-08-10 | 1961-07-04 | Phenoxazine derivatives and their preparation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| FR1336070A true FR1336070A (en) | 1963-08-30 |
Family
ID=32963950
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR835540A Expired FR1336070A (en) | 1960-08-10 | 1960-08-10 | Phenoxazine derivatives and their preparation |
| FR866948A Expired FR81408E (en) | 1960-08-10 | 1961-07-04 | Phenoxazine derivatives and their preparation |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR866948A Expired FR81408E (en) | 1960-08-10 | 1961-07-04 | Phenoxazine derivatives and their preparation |
Country Status (1)
| Country | Link |
|---|---|
| FR (2) | FR1336070A (en) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2011246374A (en) * | 2010-05-26 | 2011-12-08 | Daiso Co Ltd | Method for producing phenoxazine derivative |
-
1960
- 1960-08-10 FR FR835540A patent/FR1336070A/en not_active Expired
-
1961
- 1961-07-04 FR FR866948A patent/FR81408E/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2011246374A (en) * | 2010-05-26 | 2011-12-08 | Daiso Co Ltd | Method for producing phenoxazine derivative |
Also Published As
| Publication number | Publication date |
|---|---|
| FR81408E (en) | 1963-09-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BE606063A (en) | Thiadiazine derivatives and their preparation. | |
| FR1271180A (en) | Cyclododecylguanidine and its derivatives and their preparation | |
| BE602888A (en) | New 8-benzylxanthine derivatives and their preparation. | |
| BE611000A (en) | Benzazocine derivatives and their preparation | |
| BE607171A (en) | Alanine derivatives and their preparation | |
| FR81408E (en) | Phenoxazine derivatives and their preparation | |
| FR1288907A (en) | Cysteine derivatives and their preparation | |
| BE610736A (en) | New piperidine derivatives and their preparation | |
| BE597554A (en) | New derivatives of substituted flavones and their preparation. | |
| OA00151A (en) | New pyrazolidinic derivatives and their preparation. | |
| BE604996A (en) | 1,2,3,4-tetrahydroquinazolinone derivatives and their preparation | |
| BE619835A (en) | Thiamine derivatives and their preparation | |
| BE600673A (en) | Phenylalanine derivatives and their preparation | |
| BE611048A (en) | Derivatives of 1-emetine and their preparation | |
| BE610737A (en) | New piperidine derivatives and their preparation | |
| FR1292920A (en) | Pyrimidine derivatives and their preparation | |
| BE604163A (en) | 11b-benzo (a) -quinolizine derivatives and their preparation | |
| FR1388605A (en) | Serine derivatives and their preparation | |
| BE603545A (en) | Phenylalanine derivatives and their preparation | |
| BE603114A (en) | New dialkylxanthine derivatives and their preparation | |
| FR1375300A (en) | Benzophenone derivatives and their preparation | |
| FR1363116A (en) | New benzothiatriazine derivatives and their preparation | |
| FR1371770A (en) | Choline derivatives and their preparation | |
| FR1463760A (en) | Diphenylalkane derivatives and their preparation | |
| BE602887A (en) | New 8-benzylxanthine derivatives and their preparation. |