FR1312M - Medicinal product based on a derivative of podophyllic acid. - Google Patents
Medicinal product based on a derivative of podophyllic acid.Info
- Publication number
- FR1312M FR1312M FR867997A FR867997A FR1312M FR 1312 M FR1312 M FR 1312M FR 867997 A FR867997 A FR 867997A FR 867997 A FR867997 A FR 867997A FR 1312 M FR1312 M FR 1312M
- Authority
- FR
- France
- Prior art keywords
- derivative
- product based
- medicinal product
- podophyllic acid
- podophyllic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XRBSKUSTLXISAB-XVVDYKMHSA-N (5r,6r,7r,8r)-8-hydroxy-7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylic acid Chemical class COC1=C(OC)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@H](O)[C@@H](CO)[C@@H]2C(O)=O)=C1 XRBSKUSTLXISAB-XVVDYKMHSA-N 0.000 title 1
- 229940126601 medicinal product Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/70—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with ring systems containing two or more relevant rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR867997A FR1312M (en) | 1959-08-20 | 1961-07-13 | Medicinal product based on a derivative of podophyllic acid. |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR803221A FR1341473A (en) | 1959-08-20 | 1959-08-20 | New hydrazides and their preparation process |
| FR867997A FR1312M (en) | 1959-08-20 | 1961-07-13 | Medicinal product based on a derivative of podophyllic acid. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| FR1312M true FR1312M (en) | 1962-05-14 |
Family
ID=8718444
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR803221A Expired FR1341473A (en) | 1959-08-20 | 1959-08-20 | New hydrazides and their preparation process |
| FR867997A Expired FR1312M (en) | 1959-08-20 | 1961-07-13 | Medicinal product based on a derivative of podophyllic acid. |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR803221A Expired FR1341473A (en) | 1959-08-20 | 1959-08-20 | New hydrazides and their preparation process |
Country Status (1)
| Country | Link |
|---|---|
| FR (2) | FR1341473A (en) |
-
1959
- 1959-08-20 FR FR803221A patent/FR1341473A/en not_active Expired
-
1961
- 1961-07-13 FR FR867997A patent/FR1312M/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1341473A (en) | 1963-11-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR1177733A (en) | Amidophosphoric acid derivatives | |
| FR1981M (en) | Anti-ulcer drug based on esters of farnesyl-acetic acid. | |
| FR1748M (en) | Medicinal product based on a substituted benzoic acid amide. | |
| FR1544M (en) | Medicinal product based on a derivative of glucosamine. | |
| FR1197430A (en) | Imido-diphosphoric acid derivatives | |
| BE576408A (en) | Synthesis of l-glutamic acid. | |
| FR2886M (en) | Medicinal product based on anthranilic acid derivatives. | |
| FR1312M (en) | Medicinal product based on a derivative of podophyllic acid. | |
| FR3026M (en) | Narcotic drug based on 3-methoxy-4-n-ethyloxy-n-ethylcarbaminomethoxyphenylacetic acid n-propyl ester. | |
| FR1093M (en) | Medicinal product based on a derivative of phenoxyacetic acid. | |
| FR100M (en) | Choleretic drug based on 1-ketocyclododecyl-2-acetic acid. | |
| FR1471M (en) | Medicinal product based on a derivative of lysergic acid. | |
| FR3228M (en) | Medicinal product based on derivatives of mandelic acid. | |
| FR1178M (en) | Medicinal product based on a derivative of glycyrrhetinic acid. | |
| FR375M (en) | Medicinal product based on chloro-choline-phosphoric acid salt. | |
| FR263M (en) | Medicinal product based on a lysergic acid derivative. | |
| BE615260A (en) | Recovery of glutamic acid | |
| FR2379M (en) | Medicinal product based on derivative of acrylic acid. | |
| FR24M (en) | Medicinal product based on hyoscyamine derivative. | |
| FR1813M (en) | Medicinal product based on a derivative of diphenyl-propylamino-propane. | |
| FR1256M (en) | Nicotinic acid n-oxide-based hypocholesterolemic drug. | |
| FR2038M (en) | Medicinal product based on an acethyl-salicylic acid derivative. | |
| FR2841M (en) | Coronarodilator drug based on esters of mandelic acid. | |
| FR1333M (en) | Vasodilator drug based on comanic acid derivative. | |
| FR1747M (en) | Medicinal product based on a derivative of dibenzo-cycloheptane. |