FI49032C - Menetelmä terapeuttisesti aktiivisten 7-nitro-8-hydroksi-kinoliini-est erien valmistamiseksi. - Google Patents
Menetelmä terapeuttisesti aktiivisten 7-nitro-8-hydroksi-kinoliini-est erien valmistamiseksi.Info
- Publication number
- FI49032C FI49032C FI700296A FI29670A FI49032C FI 49032 C FI49032 C FI 49032C FI 700296 A FI700296 A FI 700296A FI 29670 A FI29670 A FI 29670A FI 49032 C FI49032 C FI 49032C
- Authority
- FI
- Finland
- Prior art keywords
- nitro
- preparation
- therapeutically active
- hydroxyquinoline
- esters
- Prior art date
Links
- RPJWQGVDVSVGPQ-UHFFFAOYSA-N 7-nitroquinolin-8-ol Chemical class C1=CN=C2C(O)=C([N+]([O-])=O)C=CC2=C1 RPJWQGVDVSVGPQ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
- C07D215/32—Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
- C07D215/28—Alcohols; Ethers thereof with halogen atoms or nitro radicals in positions 5, 6 or 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1267669 | 1969-02-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI49032B FI49032B (forum.php) | 1974-12-02 |
| FI49032C true FI49032C (fi) | 1975-03-10 |
Family
ID=11142657
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI700296A FI49032C (fi) | 1969-02-10 | 1970-02-03 | Menetelmä terapeuttisesti aktiivisten 7-nitro-8-hydroksi-kinoliini-est erien valmistamiseksi. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3793314A (forum.php) |
| AT (1) | AT298489B (forum.php) |
| BE (1) | BE745258A (forum.php) |
| CH (1) | CH511229A (forum.php) |
| DE (1) | DE2005959C3 (forum.php) |
| ES (1) | ES376391A1 (forum.php) |
| FI (1) | FI49032C (forum.php) |
| FR (1) | FR2034532B1 (forum.php) |
| GB (1) | GB1299753A (forum.php) |
| IL (1) | IL33560A (forum.php) |
| NL (1) | NL7000974A (forum.php) |
| NO (1) | NO130727C (forum.php) |
| SE (1) | SE349803B (forum.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH528214A (de) * | 1970-02-13 | 1972-09-30 | Ciba Geigy Ag | Schädlingsbekämpfungsmittel |
| US3984417A (en) * | 1971-12-27 | 1976-10-05 | Ajinomoto Co., Inc. | Method of producing active amino acid esters |
| US4168311A (en) * | 1973-12-10 | 1979-09-18 | Hoechst Aktiengesellschaft | Hydroxyquinoline carbamates and n-oxide hydroxyquinoline carbamates and their use as insecticides |
| CH577265B5 (forum.php) * | 1974-05-29 | 1976-07-15 | Ciba Geigy Ag | |
| US3997542A (en) * | 1975-06-23 | 1976-12-14 | Sterling Drug Inc. | 1-(Halogenated-acetyl)-1,2,3,4-tetrahydro-6-quinolinols and esters thereof |
| DE3621540A1 (de) * | 1986-06-27 | 1988-01-07 | Basf Ag | Chinolinderivate, verfahren zu ihrer herstellung, diese enthaltende mikrobizide und ihre verwendung zur bekaempfung von bakterien und pilzen |
| EP4349815A4 (en) * | 2021-05-31 | 2025-06-25 | Jiangsu Yahong Meditech Co., Ltd. | 7-NITRO-8-HYDROXYQUINOLINE DERIVATIVE, MANUFACTURING PROCESS THEREOF AND MEDICINAL USE THEREOF |
| CN118546129B (zh) * | 2024-05-15 | 2025-05-16 | 中国热带农业科学院环境与植物保护研究所 | 含硫醚喹啉的香豆素类衍生物及其合成方法、应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1148405A (en) * | 1966-08-18 | 1969-04-10 | Produits Chemiques Soc Et | Esters derived from nitroquinoline |
-
1969
- 1969-12-18 IL IL6933560A patent/IL33560A/xx unknown
-
1970
- 1970-01-19 US US00004065A patent/US3793314A/en not_active Expired - Lifetime
- 1970-01-23 NL NL7000974A patent/NL7000974A/xx unknown
- 1970-01-28 GB GB4092/70A patent/GB1299753A/en not_active Expired
- 1970-01-30 BE BE745258D patent/BE745258A/xx unknown
- 1970-02-03 FI FI700296A patent/FI49032C/fi active
- 1970-02-06 FR FR707004270A patent/FR2034532B1/fr not_active Expired
- 1970-02-09 AT AT116270A patent/AT298489B/de not_active IP Right Cessation
- 1970-02-09 ES ES376391A patent/ES376391A1/es not_active Expired
- 1970-02-09 SE SE01589/70A patent/SE349803B/xx unknown
- 1970-02-10 CH CH190970A patent/CH511229A/fr not_active IP Right Cessation
- 1970-02-10 NO NO462/70A patent/NO130727C/no unknown
- 1970-02-10 DE DE2005959A patent/DE2005959C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL33560A0 (en) | 1970-02-19 |
| DE2005959A1 (de) | 1970-08-06 |
| AT298489B (de) | 1972-05-10 |
| BE745258A (fr) | 1970-07-01 |
| GB1299753A (en) | 1972-12-13 |
| FR2034532A1 (forum.php) | 1970-12-11 |
| SE349803B (forum.php) | 1972-10-09 |
| CH511229A (fr) | 1971-08-15 |
| FR2034532B1 (forum.php) | 1973-08-10 |
| DE2005959C3 (de) | 1973-10-11 |
| IL33560A (en) | 1973-04-30 |
| NO130727B (forum.php) | 1974-10-21 |
| ES376391A1 (es) | 1972-04-01 |
| NL7000974A (forum.php) | 1970-08-12 |
| FI49032B (forum.php) | 1974-12-02 |
| US3793314A (en) | 1974-02-19 |
| NO130727C (forum.php) | 1975-01-29 |
| DE2005959B2 (de) | 1973-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI42712C (fi) | Menetelmä terapeuttisesti vaikuttavien bifenyylialkaanijohdannaisten valmistamiseksi | |
| SE385872B (sv) | Forfarande for framstellning av vissa angivna p-karbonyl - fenoxi - iso - smorsyraestrar | |
| FI49497C (fi) | Menetelmä terapeuttisesti vaikuttavien 1-fenoksi-2-3-alkyyliaminopropa anien valmistamiseksi. | |
| NO138629C (no) | Fremgangsmaate for fremstilling av 7beta-acylamidometyl-ceph-3-em-4-karboksylsyre-estere. | |
| FI50707C (fi) | Menetelmä uusien farmakologisesti vaikuttavien hydroksisykloheksyyliam iinien valmistamiseksi. | |
| DK113645B (da) | Fremgangsmåde til fremstilling af terapeutisk virksomme indolyl-3-alkan-carboxylsyrer. | |
| FI48728C (fi) | Analogiamenetelmä terapeuttisesti käytettävien fenyylietikkahappojohda nnaisten valmistamiseksi. | |
| FI49032C (fi) | Menetelmä terapeuttisesti aktiivisten 7-nitro-8-hydroksi-kinoliini-est erien valmistamiseksi. | |
| DK119659B (da) | Analogifremgangsmåde til fremstilling af terapeutisk virksomme estere eller syreadditionssalte deraf. | |
| FI49827C (fi) | Menetelmä terapeuttisesti vaikuttavien substituoitujen 3-hydroksimetyy li-isokinoliinien valmistamiseksi. | |
| FI45551C (fi) | Menetelmä terapeuttisesti käytettävän dehydroepiandrosteroniönantaatin valmistamiseksi. | |
| FI49718C (fi) | Menetelmä terapeuttisesti vaikuttavien 2-halogeenimetyyli-3-karbonihap poamidokinoksaliini-di-N-oksidien-(1,4) valmistamiseksi. | |
| FI51812C (fi) | Menetelmä alfa-aminobentsyylipenisilliinin asyylioksimetyyliestereiden valmistamiseksi. | |
| FI49413C (fi) | Menetelmä uusien terapeuttisesti vaikuttavien fentiatsiinijohdannaisie n valmistamiseksi. | |
| FI47189C (fi) | Tapa valmistaa terapeuttisesti vaikuttavia d-lysergiinihappo-N-fenyyli piperatsideja. | |
| FI48584C (fi) | Menetelmä uusien fluokinoloni-asetonidin estereiden valmistamiseksi. | |
| FI48576C (fi) | Menetelmä terapeuttisesti aktiivisten alfa-fluori-malonihappojohdannai sten valmistamiseksi. | |
| FI50879C (fi) | Menetelmä terapeuttisesti vaikuttavien substituoitujen 3-aminoasyyliam ino-tiofeenien valmistamiseksi. | |
| FI47100C (fi) | Menetelmä terapeuttisesti vaikuttavien 1-p-klooribentsoyyli-2-alempi-a lkyyli-5-alempi-alkoksi-3-indolyyli-etikkahapon valmistamiseksi. | |
| FI50875C (fi) | Menetelmä terapeuttisesti aktiivisten dihydro-2-aminoisokinoliinien va lmistamiseksi. | |
| FI50243C (fi) | Menetelmä terapeuttisesti vaikuttavien N-substituoitujen 3-hydroksi-9- atsamorfinaanien valmistamiseksi. | |
| FI48736C (fi) | Menetelmä 2-bentsimidatsolikarbamiinihappoesterien valmistamiseksi. | |
| FI50521C (fi) | Menetelmä terapeuttisesti käytettävien d-2-(6-substituoitu-2-naftyyli) -propanaalien valmistamiseksi | |
| SE404607B (sv) | Forfarande for framstellning av optiskt aktiva steroider | |
| FI47661C (fi) | Menetelmä terapeuttisesti vaikuttavien bentsofuraanijohdannaisten valm istamiseksi. |