ES95174Y - Hidrorreductor - Google Patents
HidrorreductorInfo
- Publication number
- ES95174Y ES95174Y ES95174U ES95174U ES95174Y ES 95174 Y ES95174 Y ES 95174Y ES 95174 U ES95174 U ES 95174U ES 95174 U ES95174 U ES 95174U ES 95174 Y ES95174 Y ES 95174Y
- Authority
- ES
- Spain
- Prior art keywords
- hydro
- reducer
- hydro reducer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003638 chemical reducing agent Substances 0.000 title 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES95174U ES95174Y (es) | 1962-09-20 | 1962-09-20 | Hidrorreductor |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES95174U ES95174Y (es) | 1962-09-20 | 1962-09-20 | Hidrorreductor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ES95174U ES95174U (es) | 1962-10-16 |
| ES95174Y true ES95174Y (es) | 1963-03-01 |
Family
ID=63441179
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES95174U Expired ES95174Y (es) | 1962-09-20 | 1962-09-20 | Hidrorreductor |
Country Status (1)
| Country | Link |
|---|---|
| ES (1) | ES95174Y (es) |
-
1962
- 1962-09-20 ES ES95174U patent/ES95174Y/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES95174U (es) | 1962-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH397148A (fr) | Trachéotome | |
| AT237955B (de) | Heuwerbegerät | |
| FR81659E (fr) | Robinet | |
| CH400820A (fr) | Gelenkloses Scharnier | |
| CH396068A (fr) | Vibro-finisseur | |
| CH394992A (fr) | Haveuse | |
| AT241188B (de) | Heuwerbemaschine | |
| FR1335039A (fr) | Robinet | |
| CH393861A (it) | Rubinetto | |
| CH401870A (it) | Sportjacke | |
| ES95174Y (es) | Hidrorreductor | |
| FR81486E (fr) | Tuyauterie | |
| FR1350042A (fr) | Robinet | |
| BE637189R (fr) | Telecommunicatiesysteem | |
| BE675043Q (fr) | Sieraad | |
| BE633541A (fr) | Diazabicyclo-octanes | |
| CH412008A (de) | Parametron | |
| ES95381Y (es) | Moto-reductor de velocidad | |
| FR1334200A (fr) | Robinet | |
| FR1318380A (fr) | Robinet | |
| ES92597Y (es) | Grifo | |
| ES92312Y (es) | Cierre-resbalón | |
| ES92197Y (es) | Tapón-pincel | |
| ES95369Y (es) | Bolsa-envase | |
| ES95251Y (es) | Alpargata |