ES78726Y - Poncho impermeable perfeccionado - Google Patents
Poncho impermeable perfeccionadoInfo
- Publication number
- ES78726Y ES78726Y ES0078726U ES78726U ES78726Y ES 78726 Y ES78726 Y ES 78726Y ES 0078726 U ES0078726 U ES 0078726U ES 78726 U ES78726 U ES 78726U ES 78726 Y ES78726 Y ES 78726Y
- Authority
- ES
- Spain
- Prior art keywords
- poncho
- perfected
- waterproof
- waterproof poncho
- perfected waterproof
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- PGOOBECODWQEAB-UHFFFAOYSA-N (E)-clothianidin Chemical compound [O-][N+](=O)\N=C(/NC)NCC1=CN=C(Cl)S1 PGOOBECODWQEAB-UHFFFAOYSA-N 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES0078726U ES78726Y (es) | 1960-02-09 | 1960-02-09 | Poncho impermeable perfeccionado |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES0078726U ES78726Y (es) | 1960-02-09 | 1960-02-09 | Poncho impermeable perfeccionado |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ES78726U ES78726U (es) | 1960-05-16 |
| ES78726Y true ES78726Y (es) | 1960-12-16 |
Family
ID=52721048
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES0078726U Expired ES78726Y (es) | 1960-02-09 | 1960-02-09 | Poncho impermeable perfeccionado |
Country Status (1)
| Country | Link |
|---|---|
| ES (1) | ES78726Y (es) |
-
1960
- 1960-02-09 ES ES0078726U patent/ES78726Y/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES78726U (es) | 1960-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR1315237A (fr) | Cultivateur perfectionné | |
| ES78726Y (es) | Poncho impermeable perfeccionado | |
| FR1275848A (fr) | Hourdis perfectionné | |
| CH384598A (de) | Drucktuch | |
| FR1268503A (fr) | Perfectionnements aux bineuses | |
| FR1313270A (fr) | Guêtre perfectionnée | |
| ES89517Y (es) | Impermeable | |
| ES94410Y (es) | Guante impermeable perfeccionado | |
| ES70509Y (es) | Pantalón impermeable hermético perfeccionado | |
| ES79755Y (es) | Bota impermeable perfeccionada | |
| ES77058Y (es) | Impermeable | |
| ES79228Y (es) | Botafunda impermeable | |
| ES93641Y (es) | Pitillera impermeable perfeccionada | |
| ES89652Y (es) | Capucha impermeable | |
| FR1260687A (fr) | Boutonnière étanche | |
| ES83814Y (es) | Almohada perfeccionada | |
| ES71830Y (es) | Envase impermeable perfeccionado | |
| ES73200Y (es) | Envase impermeable perfeccionado | |
| FR1259022A (fr) | Vêtement perfectionné | |
| ES84896Y (es) | Camisa perfeccionada | |
| ES82151Y (es) | Calcomanía perfeccionada | |
| ES81479Y (es) | Baldosa perfeccionada | |
| ES81134Y (es) | Teja perfeccionada | |
| ES81262Y (es) | Teja perfeccionada | |
| ES79960Y (es) | Teja perfeccionada |