ES54847A1 - Aeromotor "Spir". - Google Patents
Aeromotor "Spir".Info
- Publication number
- ES54847A1 ES54847A1 ES54847A ES54847A ES54847A1 ES 54847 A1 ES54847 A1 ES 54847A1 ES 54847 A ES54847 A ES 54847A ES 54847 A ES54847 A ES 54847A ES 54847 A1 ES54847 A1 ES 54847A1
- Authority
- ES
- Spain
- Prior art keywords
- aeromotor
- spir
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KUVIULQEHSCUHY-XYWKZLDCSA-N Beclometasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(Cl)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)COC(=O)CC)(OC(=O)CC)[C@@]1(C)C[C@@H]2O KUVIULQEHSCUHY-XYWKZLDCSA-N 0.000 title 1
- 101150008563 spir gene Proteins 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES54847A ES54847A1 (es) | 1913-02-01 | 1913-02-01 | Aeromotor "Spir". |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES54847A ES54847A1 (es) | 1913-02-01 | 1913-02-01 | Aeromotor "Spir". |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES54847A1 true ES54847A1 (es) | 1913-04-01 |
Family
ID=64230434
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES54847A Expired ES54847A1 (es) | 1913-02-01 | 1913-02-01 | Aeromotor "Spir". |
Country Status (1)
| Country | Link |
|---|---|
| ES (1) | ES54847A1 (es) |
-
1913
- 1913-02-01 ES ES54847A patent/ES54847A1/es not_active Expired
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES54847A1 (es) | Aeromotor "Spir". | |
| CH64453A (de) | Kötzerspulmaschine | |
| FI5291A (fi) | Tramp-eller motorsläde, benämnd "Sax-bilen" | |
| FR458122A (fr) | Fausset perfectionné | |
| FI5300A (fi) | Tvättpulver benämndt "Mehnerit" | |
| FI5326A (fi) | Sädtorkningsapparat "Såka" | |
| FI5429A (fi) | Självmatande ostskärare "Sanitas" | |
| FI5436A (fi) | Skoltavla "Reformi" | |
| CH64354A (de) | Selbstverkäufer | |
| DK17752C (da) | Paksadel. | |
| DK21528C (da) | Møtriklaas. | |
| AT68311B (de) | Coquillenboden. | |
| DK16954C (da) | Motorplov. | |
| DK16995C (da) | Hattenaal. | |
| DK17140C (da) | Bæreknægt. | |
| DK17223C (da) | Dejæltemaskine. | |
| DK17371C (da) | Motorplov. | |
| DK17414C (da) | Hattenaal. | |
| DK17583C (da) | Karlukke. | |
| DK17657C (da) | Mansketlaas. | |
| DK17680C (da) | Kogrime. | |
| DK17751C (da) | Toradsroeoptager. | |
| DK17762C (da) | Kupolovn. | |
| DK17765C (da) | Motorplov. | |
| DK17802C (da) | Vippelem. |