ES47596Y - Pasapurés simplificado - Google Patents
Pasapurés simplificadoInfo
- Publication number
- ES47596Y ES47596Y ES0047596U ES47596U ES47596Y ES 47596 Y ES47596 Y ES 47596Y ES 0047596 U ES0047596 U ES 0047596U ES 47596 U ES47596 U ES 47596U ES 47596 Y ES47596 Y ES 47596Y
- Authority
- ES
- Spain
- Prior art keywords
- buster
- simplified
- simplified buster
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- ZBMRKNMTMPPMMK-UHFFFAOYSA-N 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;azane Chemical compound [NH4+].CP(O)(=O)CCC(N)C([O-])=O ZBMRKNMTMPPMMK-UHFFFAOYSA-N 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES0047596U ES47596Y (es) | 1955-04-15 | 1955-04-15 | Pasapurés simplificado |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES0047596U ES47596Y (es) | 1955-04-15 | 1955-04-15 | Pasapurés simplificado |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ES47596U ES47596U (es) | 1955-06-16 |
| ES47596Y true ES47596Y (es) | 1955-12-16 |
Family
ID=51110818
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES0047596U Expired ES47596Y (es) | 1955-04-15 | 1955-04-15 | Pasapurés simplificado |
Country Status (1)
| Country | Link |
|---|---|
| ES (1) | ES47596Y (es) |
-
1955
- 1955-04-15 ES ES0047596U patent/ES47596Y/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES47596U (es) | 1955-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH346455A (fr) | Stylographe | |
| CH341735A (fr) | Stylographe | |
| BE760649Q (fr) | Thiazoleazodiphenylamines | |
| CH350686A (de) | Transfluxor | |
| CH340651A (fr) | Décélérographe | |
| ES47596Y (es) | Pasapurés simplificado | |
| CH340130A (it) | Foglio-busta | |
| ES51175Y (es) | Percha-soporte | |
| ES51280Y (es) | Caja-envase | |
| ES46306Y (es) | Ruleta-quiniela | |
| ES46786Y (es) | Libro-caja | |
| ES46865Y (es) | Caja-envase | |
| ES48042Y (es) | Dínamo-motor | |
| ES48043Y (es) | Escuadra-herramienta | |
| ES48830Y (es) | Monedero-billetero | |
| ES50031Y (es) | Corbata-perfeccionada | |
| ES50159Y (es) | Pañal-braga | |
| ES50182Y (es) | Placa-caja | |
| ES50429Y (es) | Punto-rotativo | |
| ES50637Y (es) | Velomotor | |
| ES50710Y (es) | Tapón-boquilla | |
| ES50950Y (es) | Escoba-cepillo | |
| ES50959Y (es) | Talquera-sonajero | |
| ES51012Y (es) | Cutivador | |
| AT189408B (de) | Bussole |