ES200418Y - Acoplamiento perfeccionado entre tuberias. - Google Patents
Acoplamiento perfeccionado entre tuberias.Info
- Publication number
- ES200418Y ES200418Y ES1974200418U ES200418U ES200418Y ES 200418 Y ES200418 Y ES 200418Y ES 1974200418 U ES1974200418 U ES 1974200418U ES 200418 U ES200418 U ES 200418U ES 200418 Y ES200418 Y ES 200418Y
- Authority
- ES
- Spain
- Prior art keywords
- pipes
- perfected coupling
- perfected
- coupling
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- IHPYMWDTONKSCO-UHFFFAOYSA-N 2,2'-piperazine-1,4-diylbisethanesulfonic acid Chemical compound OS(=O)(=O)CCN1CCN(CCS(O)(=O)=O)CC1 IHPYMWDTONKSCO-UHFFFAOYSA-N 0.000 title 1
- 239000007990 PIPES buffer Substances 0.000 title 1
- 230000008878 coupling Effects 0.000 title 1
- 238000010168 coupling process Methods 0.000 title 1
- 238000005859 coupling reaction Methods 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES1974200418U ES200418Y (es) | 1974-02-12 | 1974-02-12 | Acoplamiento perfeccionado entre tuberias. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES1974200418U ES200418Y (es) | 1974-02-12 | 1974-02-12 | Acoplamiento perfeccionado entre tuberias. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ES200418U ES200418U (es) | 1975-09-01 |
| ES200418Y true ES200418Y (es) | 1976-01-16 |
Family
ID=8368012
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES1974200418U Expired ES200418Y (es) | 1974-02-12 | 1974-02-12 | Acoplamiento perfeccionado entre tuberias. |
Country Status (1)
| Country | Link |
|---|---|
| ES (1) | ES200418Y (es) |
-
1974
- 1974-02-12 ES ES1974200418U patent/ES200418Y/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES200418U (es) | 1975-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL7512692A (nl) | Pijpkoppeling. | |
| NL160928C (nl) | Pijpstuk. | |
| NL7610807A (nl) | Pijpkoppeling. | |
| NL162464C (nl) | Pijpvervormingsklem. | |
| SE7508443L (sv) | Vetskedrivkoppling for flekt. | |
| NL7504642A (nl) | Buigzame buisleiding. | |
| NL7404779A (nl) | Koppelstrip. | |
| NL7514374A (nl) | Buigzame buisleiding. | |
| NL172727C (nl) | Gewrichtsendoprothese. | |
| NL7511780A (nl) | Buiskoppeling. | |
| NL7506626A (nl) | Pijpkoppeling. | |
| NL7511302A (nl) | Pijpklem. | |
| NL186342C (nl) | Buiskoppeling. | |
| NL7612968A (nl) | Pijpkoppeling. | |
| NL7511020A (nl) | Pijpverbindingsstuk. | |
| NL7514704A (nl) | Pijpverbinding. | |
| NL7508412A (nl) | Aansluitklem. | |
| NL7504533A (nl) | Buisverbinding. | |
| SE7505248L (sv) | Kopplingsanordning. | |
| NL161056C (nl) | Totaal-gewrichtsendoprothese. | |
| NL7506028A (nl) | Klampverbinding. | |
| NL7504238A (nl) | Pijpkoppeling. | |
| NL7600101A (nl) | Buiskoppelingen. | |
| NL7510897A (nl) | Slangklem. | |
| ES200418Y (es) | Acoplamiento perfeccionado entre tuberias. |