ES102230Y - Una bengala insecticida. - Google Patents
Una bengala insecticida.Info
- Publication number
- ES102230Y ES102230Y ES102230U ES102230U ES102230Y ES 102230 Y ES102230 Y ES 102230Y ES 102230 U ES102230 U ES 102230U ES 102230 U ES102230 U ES 102230U ES 102230 Y ES102230 Y ES 102230Y
- Authority
- ES
- Spain
- Prior art keywords
- bengal
- insecticide
- insecticide bengal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES102230U ES102230Y (es) | 1963-11-02 | 1963-11-02 | Una bengala insecticida. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES102230U ES102230Y (es) | 1963-11-02 | 1963-11-02 | Una bengala insecticida. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ES102230U ES102230U (es) | 1963-12-01 |
| ES102230Y true ES102230Y (es) | 1965-09-01 |
Family
ID=63243349
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES102230U Expired ES102230Y (es) | 1963-11-02 | 1963-11-02 | Una bengala insecticida. |
Country Status (1)
| Country | Link |
|---|---|
| ES (1) | ES102230Y (es) |
-
1963
- 1963-11-02 ES ES102230U patent/ES102230Y/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES102230U (es) | 1963-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK128607B (da) | Insekticidt aktive pyrethrinoider. | |
| DK111368B (da) | Hydrostatisk steriliseringsapparat. | |
| DK117868B (da) | Insecticid. | |
| DK133579B (da) | Insekticid. | |
| DK116481B (da) | Insecticid. | |
| DK109175C (da) | Herbicid. | |
| DK118584B (da) | Sterilisationsapparat. | |
| NL145457B (nl) | Steriliseerinrichting. | |
| FR3826M (fr) | Médicament fongicide. | |
| DK105133C (da) | Herbicid. | |
| DK120612B (da) | Desinfektionsmiddel. | |
| DK120686B (da) | Umagnetisk trædemine. | |
| DK120038B (da) | Desinfektionsmiddel. | |
| DK114418B (da) | Udløsemagnet. | |
| DK100755C (da) | Såmaskine. | |
| DK116253B (da) | Insekticid. | |
| DK116908B (da) | Insecticid. | |
| DK118694B (da) | Herbicid. | |
| FR3583M (fr) | Médicament fongicide. | |
| DK116104B (da) | Insecticid. | |
| DK107322C (da) | Såmaskine. | |
| DK113892B (da) | Insecticid. | |
| DK120672B (da) | Herbicid. | |
| DK115293B (da) | Insecticid. | |
| DK117326B (da) | Insecticid. |