DK590175A - Fremgangsmade til fremstilling af rent 1-nitroantraquinon - Google Patents
Fremgangsmade til fremstilling af rent 1-nitroantraquinonInfo
- Publication number
- DK590175A DK590175A DK590175A DK590175A DK590175A DK 590175 A DK590175 A DK 590175A DK 590175 A DK590175 A DK 590175A DK 590175 A DK590175 A DK 590175A DK 590175 A DK590175 A DK 590175A
- Authority
- DK
- Denmark
- Prior art keywords
- nitroanthraquinone
- procedure
- preparing pure
- pure
- preparing
- Prior art date
Links
- YCANAXVBJKNANM-UHFFFAOYSA-N 1-nitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2[N+](=O)[O-] YCANAXVBJKNANM-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742461648 DE2461648A1 (de) | 1974-12-27 | 1974-12-27 | Verfahren zur herstellung von reinem 1-nitro-anthrachinon |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK590175A true DK590175A (da) | 1976-06-28 |
Family
ID=5934667
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK590175A DK590175A (da) | 1974-12-27 | 1975-12-23 | Fremgangsmade til fremstilling af rent 1-nitroantraquinon |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5811938B2 (cg-RX-API-DMAC7.html) |
| AT (1) | AT339291B (cg-RX-API-DMAC7.html) |
| BE (1) | BE837052A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7508650A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1042884A (cg-RX-API-DMAC7.html) |
| CH (1) | CH615148A5 (cg-RX-API-DMAC7.html) |
| DD (1) | DD124248A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2461648A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK590175A (cg-RX-API-DMAC7.html) |
| ES (1) | ES443876A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2295946A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1490419A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1052622B (cg-RX-API-DMAC7.html) |
| LU (1) | LU74079A1 (cg-RX-API-DMAC7.html) |
| NL (1) | NL7515007A (cg-RX-API-DMAC7.html) |
| RO (1) | RO70394A (cg-RX-API-DMAC7.html) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS603056B2 (ja) * | 1976-06-21 | 1985-01-25 | 住友化学工業株式会社 | 1−ニトロアントラキノンの製法 |
| DE2654649C2 (de) * | 1976-12-02 | 1985-01-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 1-Nitroanthrachinon |
| JPS5387345A (en) * | 1977-01-06 | 1978-08-01 | Sumitomo Chem Co Ltd | Method of preparing 1-nitroanthraquinone |
| AT385577B (de) * | 1984-10-31 | 1988-04-25 | Zumtobel Ag | Bettleseleuchte, insbesondere fuer krankenzimmer |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1359347A (en) * | 1970-12-22 | 1974-07-10 | Sandoz Ltd | Process for the production of1-nitroanthraquinone |
| CH554302A (de) * | 1971-04-30 | 1974-09-30 | Sandoz Ag | Verfahren und apparatur zur durchfuehrung von nitrierungen. |
-
1974
- 1974-12-27 DE DE19742461648 patent/DE2461648A1/de not_active Withdrawn
-
1975
- 1975-10-24 GB GB4382175A patent/GB1490419A/en not_active Expired
- 1975-12-19 DD DD19036875A patent/DD124248A5/xx unknown
- 1975-12-19 LU LU74079A patent/LU74079A1/xx unknown
- 1975-12-22 CH CH1661575A patent/CH615148A5/de not_active IP Right Cessation
- 1975-12-23 IT IT5284475A patent/IT1052622B/it active
- 1975-12-23 NL NL7515007A patent/NL7515007A/xx unknown
- 1975-12-23 DK DK590175A patent/DK590175A/da unknown
- 1975-12-23 AT AT980575A patent/AT339291B/de not_active IP Right Cessation
- 1975-12-24 CA CA242,597A patent/CA1042884A/en not_active Expired
- 1975-12-24 BE BE163088A patent/BE837052A/xx unknown
- 1975-12-25 JP JP15412675A patent/JPS5811938B2/ja not_active Expired
- 1975-12-26 BR BR7508650A patent/BR7508650A/pt unknown
- 1975-12-26 FR FR7539870A patent/FR2295946A1/fr active Granted
- 1975-12-26 RO RO7584324A patent/RO70394A/ro unknown
- 1975-12-26 ES ES443876A patent/ES443876A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES443876A1 (es) | 1977-05-01 |
| IT1052622B (it) | 1981-07-20 |
| DE2461648A1 (de) | 1976-07-08 |
| GB1490419A (en) | 1977-11-02 |
| DD124248A5 (cg-RX-API-DMAC7.html) | 1977-02-09 |
| BE837052A (fr) | 1976-06-24 |
| AT339291B (de) | 1977-10-10 |
| CH615148A5 (en) | 1980-01-15 |
| FR2295946B1 (cg-RX-API-DMAC7.html) | 1979-09-07 |
| NL7515007A (nl) | 1976-06-29 |
| JPS5188952A (en) | 1976-08-04 |
| FR2295946A1 (fr) | 1976-07-23 |
| JPS5811938B2 (ja) | 1983-03-05 |
| BR7508650A (pt) | 1976-09-08 |
| LU74079A1 (cg-RX-API-DMAC7.html) | 1976-11-11 |
| RO70394A (ro) | 1980-12-30 |
| ATA980575A (de) | 1977-02-15 |
| CA1042884A (en) | 1978-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK487475A (da) | Fremgangsmade til fremstilling af vandkveldende polyalkylenoxid | |
| DK150155C (da) | Analogifremgangsmaade til fremstilling af benzocycloamid-derivater | |
| DK409775A (da) | Fremgangsmade til fremstilling af peptider | |
| DK552377A (da) | Fremgangsmaade til fremstilling af alfa-beskyttede oxyimino-beta-oxo-gamma-halogen-smoersyrederivater | |
| DK244875A (da) | Fremgangsmade til fremstilling af chromanderivater | |
| DK558975A (da) | Fremgangsmade til fremstilling af polycarbonater | |
| DK463775A (da) | Fremgangsmade til fremstilling af dipeptidderivater | |
| DK292475A (da) | Fremgangsmade til fremstilling af derivater af 3-amino-2-hydroxy-1-phenoxy-propan | |
| DK351875A (da) | Fremgangsmade til fremstilling af 7-methoxy-6-thiatetracyliner | |
| DK164476A (da) | Fremgangsmade til fremstilling af piperazinylpyrazinforbindelser | |
| DK324776A (da) | Fremgangsmade til fremstilling af 3-cyanoimino-3-aminopropionitriler | |
| DK223175A (da) | Fremgangsmade til fremstilling af pyridobenzodiazepinoner | |
| DK247175A (da) | Fremgangsmade til fremstilling af decahydroisoquinolin-forbindelser | |
| DK145877C (da) | Fremgangsmaade til fremstilling af alfa-6-desoxy-5-hydroxytetracyclin | |
| DK442977A (da) | Fremgangsmade til fremstilling af gamma-l-glutamyltaurin | |
| DK305876A (da) | Fremgangsmade til fremstilling af l-pyroglutamyl-l-prolinamid | |
| DK154890C (da) | Fremgangsmaade til fremstilling af 7beta-acylamino-7alfa-alkoxycephalosporiner | |
| DK344175A (da) | Fremgangsmade til fremstilling af chromanderivater | |
| DK254275A (da) | Fremgangsmade til fremstilling af nye 2-arylamino-2-imidazolinderivater | |
| DK143281C (da) | Fremgangsmaade til fremstilling af phosphitchlorider | |
| DK143137C (da) | Fremgangsmaade til fremstilling af phosphitchlorider | |
| DK590175A (da) | Fremgangsmade til fremstilling af rent 1-nitroantraquinon | |
| DK197575A (da) | Fremgangsmade til fremstilling af peptider | |
| DK212875A (da) | Fremgangsmade til fremstilling af 5-phenyltetrazol-forbindelser | |
| DK139521C (da) | Fremgangsmaade til fremstilling af ren krystallinsk penicillinacylase |