DK446575A - Fremgangsmade til fremstilling af cephalosporansyrederivater - Google Patents
Fremgangsmade til fremstilling af cephalosporansyrederivaterInfo
- Publication number
- DK446575A DK446575A DK446575A DK446575A DK446575A DK 446575 A DK446575 A DK 446575A DK 446575 A DK446575 A DK 446575A DK 446575 A DK446575 A DK 446575A DK 446575 A DK446575 A DK 446575A
- Authority
- DK
- Denmark
- Prior art keywords
- procedure
- preparation
- acid derivatives
- cephalosporanic acid
- cephalosporanic
- Prior art date
Links
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49116976A JPS5143785A (en) | 1974-10-11 | 1974-10-11 | Shinsefuarosuhorinkanrenkagobutsuno goseiho |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK446575A true DK446575A (da) | 1976-04-12 |
Family
ID=14700403
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK446575A DK446575A (da) | 1974-10-11 | 1975-10-03 | Fremgangsmade til fremstilling af cephalosporansyrederivater |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4036834A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5143785A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2544243A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK446575A (cg-RX-API-DMAC10.html) |
| ES (1) | ES441703A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2287230A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1519187A (cg-RX-API-DMAC10.html) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH634848A5 (de) * | 1976-08-17 | 1983-02-28 | Fujisawa Pharmaceutical Co | Verfahren zur herstellung neuer 7-(n-substituierter 2-phenylglycinamido)-3-substituierte-3-cephem-4-carbonsaeuren. |
| JPS5344585A (en) * | 1976-10-02 | 1978-04-21 | Meiji Seika Kaisha Ltd | Cephalosporin derivatives and their preparation |
| GB1597036A (en) * | 1977-03-07 | 1981-09-03 | Lilly Co Eli | Cephalosporin synthesis |
| JPS5428635A (en) * | 1977-08-05 | 1979-03-03 | Sharp Corp | Transfer type recorder |
| US5244892A (en) * | 1990-10-16 | 1993-09-14 | Kyorin Pharmaceutical Co., Ltd. | Cephem compounds, and antibacterial agents |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3843642A (en) * | 1972-11-13 | 1974-10-22 | Lilly Co Eli | Cephalosporin c derivatives |
| US3948903A (en) * | 1972-12-15 | 1976-04-06 | Parke, Davis & Company | Substituted N-(1,2-dihydro-2-oxonicotinyl)-cephalexins and -cephaloglycins |
| US3946015A (en) * | 1974-07-11 | 1976-03-23 | Parke, Davis & Company | Process for the preparation of acid chlorides |
-
1974
- 1974-10-11 JP JP49116976A patent/JPS5143785A/ja active Pending
-
1975
- 1975-10-03 DK DK446575A patent/DK446575A/da unknown
- 1975-10-03 DE DE19752544243 patent/DE2544243A1/de not_active Withdrawn
- 1975-10-08 US US05/620,552 patent/US4036834A/en not_active Expired - Lifetime
- 1975-10-10 FR FR7531193A patent/FR2287230A1/fr active Granted
- 1975-10-10 ES ES441703A patent/ES441703A1/es not_active Expired
- 1975-10-13 GB GB41874/75A patent/GB1519187A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4036834A (en) | 1977-07-19 |
| JPS5143785A (en) | 1976-04-14 |
| FR2287230B1 (cg-RX-API-DMAC10.html) | 1979-09-14 |
| GB1519187A (en) | 1978-07-26 |
| ES441703A1 (es) | 1977-04-01 |
| FR2287230A1 (fr) | 1976-05-07 |
| DE2544243A1 (de) | 1976-04-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK283175A (da) | Fremgangsmade til fremstilling af benzocycloamid-derivater | |
| DK239075A (da) | Fremgangsmade til fremstilling af iodbenzenderivater | |
| DK289175A (da) | Fremgangsmade til fremstilling af cyclohexylestere af vincaminsyrederivater | |
| DK143801C (da) | Analogifremgangsmaade til fremstilling af dihydrolysergsyrederivater | |
| DK591975A (da) | Fremgangsmade til fremstilling af phenyleddikesyrederivater | |
| DK416975A (da) | Fremgangsmade til fremstilling af 5-fluor-2-methyl-1-(paramethylsulfinylbenzyliden)-indenyl-3-eddikesyre | |
| DK343275A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| DK446978A (da) | Fremgangsmaade til fremstilling af cephalosporansyrederivater | |
| DK442577A (da) | Fremgangsmade til fremstilling af aminosyrederivater | |
| DK211075A (da) | Fremgangsmade til fremstilling af abietamidderivater | |
| DK145696C (da) | Fremgangsmaade til fremstilling af 2-arylamino-2-imidazolin-derivater | |
| DK499075A (da) | Fremgangsmade til fremstilling af cephalosporiner | |
| DK376975A (da) | Fremgangsmade til fremstilling af abietamidderivater | |
| DK552675A (da) | Fremgangsmade til fremstilling af 2-acyl-4-oxopyrazinoisoquinolinderivater | |
| DK271975A (da) | Fremgangsmade til fremstilling af acylderivater | |
| DK364775A (da) | Fremgangsmade for fremstilling af cephalosporiner | |
| DK296175A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| DK446575A (da) | Fremgangsmade til fremstilling af cephalosporansyrederivater | |
| DK435375A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| DK153554C (da) | Fremgangsmaade til fremstilling af 7-aminocephalosporansyrederivater | |
| DK220375A (da) | Fremgangsmade til fremstilling af cephalosporiner | |
| DK198175A (da) | Fremgangsmade til fremstilling af indolkinolizidinderivater | |
| DK180375A (da) | Fremgangsmade til fremstilling af cephalosporiner | |
| DK143939C (da) | Fremgangsmaade til fremstilling af prostaglandin-fbeta-derivater | |
| DK507275A (da) | Fremgangsmade til fremstilling af aminomethylarylmethylpenicillin-derivater |