DK285177A - Kemiske mellemprodukter til fremstilling af cephalosporinderivater - Google Patents
Kemiske mellemprodukter til fremstilling af cephalosporinderivaterInfo
- Publication number
- DK285177A DK285177A DK285177A DK285177A DK285177A DK 285177 A DK285177 A DK 285177A DK 285177 A DK285177 A DK 285177A DK 285177 A DK285177 A DK 285177A DK 285177 A DK285177 A DK 285177A
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- chemical intermediates
- cephalosporine derivatives
- cephalosporine
- derivatives
- Prior art date
Links
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
- 239000000543 intermediate Substances 0.000 title 1
- 239000000126 substance Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB26684/76A GB1583543A (en) | 1976-06-26 | 1976-06-26 | 7-ketenimino-cephalosporins and their use as intermediates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK285177A true DK285177A (da) | 1977-12-27 |
Family
ID=10247557
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK285177A DK285177A (da) | 1976-06-26 | 1977-06-27 | Kemiske mellemprodukter til fremstilling af cephalosporinderivater |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US4202973A (Direct) |
| BE (1) | BE856168A (Direct) |
| CH (1) | CH636621A5 (Direct) |
| DE (1) | DE2728884A1 (Direct) |
| DK (1) | DK285177A (Direct) |
| FR (1) | FR2405951A1 (Direct) |
| GB (1) | GB1583543A (Direct) |
| IE (1) | IE45294B1 (Direct) |
| NL (1) | NL7707124A (Direct) |
| SE (1) | SE7707408L (Direct) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4324891A (en) * | 1980-08-15 | 1982-04-13 | Meiji Seika Kaisha, Ltd. | Process for the production of a 7-methoxycephalosporine derivative |
| JPS57169488A (en) * | 1981-04-13 | 1982-10-19 | Meiji Seika Kaisha Ltd | Cephem compound and its preparation |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE790860A (fr) * | 1971-11-02 | 1973-04-30 | Pfizer | Ceteniminepenicillines intermediaires dans la preparation de l'oxacilline |
| US3843641A (en) * | 1971-11-29 | 1974-10-22 | Merck & Co Inc | Process for preparing penicillin and cephalosporin compounds |
| US4014873A (en) * | 1973-05-03 | 1977-03-29 | Merck & Co., Inc. | Process for the production of 7-acylamidocephalosporins |
| US4058661A (en) * | 1973-05-03 | 1977-11-15 | Merck & Co., Inc. | 7-Diacyl cephalosporins |
| NL7412541A (nl) * | 1973-10-12 | 1975-04-15 | Merck & Co Inc | Werkwijze voor het bereiden van cefalosporinen, ijze ter bereiding van farmaceutische raten, alsmede de door toepassing daarvan ardigde voorwerpen. |
| US4051299A (en) * | 1974-03-15 | 1977-09-27 | Fiber Industries Inc. | Synthetic fibers of enhanced processability |
| US3960845A (en) * | 1974-03-22 | 1976-06-01 | Sankyo Company Limited | Process for preparing 7β-acylamino-7α-alkoxycephalosporins or 6β-acylamino-6α-alkoxypenicillins |
| JPS5113788A (en) * | 1974-07-24 | 1976-02-03 | Sankyo Co | Beetaaa rakutamukoseibutsushitsuno arukokishudotaino seiho |
| JPS5530714B2 (Direct) * | 1974-08-22 | 1980-08-13 |
-
1976
- 1976-06-26 GB GB26684/76A patent/GB1583543A/en not_active Expired
-
1977
- 1977-06-24 IE IE1292/77A patent/IE45294B1/en unknown
- 1977-06-27 CH CH786477A patent/CH636621A5/de not_active IP Right Cessation
- 1977-06-27 DK DK285177A patent/DK285177A/da not_active Application Discontinuation
- 1977-06-27 FR FR7719594A patent/FR2405951A1/fr active Granted
- 1977-06-27 DE DE19772728884 patent/DE2728884A1/de not_active Withdrawn
- 1977-06-27 SE SE7707408A patent/SE7707408L/ not_active Application Discontinuation
- 1977-06-27 US US05/810,330 patent/US4202973A/en not_active Expired - Lifetime
- 1977-06-27 BE BE178831A patent/BE856168A/xx unknown
- 1977-06-27 NL NL7707124A patent/NL7707124A/xx not_active Application Discontinuation
-
1979
- 1979-10-15 US US06/085,039 patent/US4260746A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IE45294L (en) | 1977-12-26 |
| CH636621A5 (de) | 1983-06-15 |
| IE45294B1 (en) | 1982-07-28 |
| FR2405951A1 (fr) | 1979-05-11 |
| DE2728884A1 (de) | 1977-12-29 |
| US4260746A (en) | 1981-04-07 |
| BE856168A (fr) | 1977-12-27 |
| NL7707124A (nl) | 1977-12-28 |
| US4202973A (en) | 1980-05-13 |
| GB1583543A (en) | 1981-01-28 |
| FR2405951B1 (Direct) | 1981-04-17 |
| SE7707408L (sv) | 1977-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK313477A (da) | Fremgangsmade til fremstilling af nitrogenholdige heterocycliske forbindelser | |
| DK63877A (da) | Fremgangsmade til fremstilling af cephalosporinantibiotika | |
| DK463288A (da) | Mellemprodukter til fremstilling af phenanthrenderivater | |
| DK30277A (da) | Fremgangsmade til fremstilling af substituerede phenylamidiner | |
| DK142372C (da) | Fremgangsmaade til fremstilling af androstan-17-on-derivater | |
| DK276177A (da) | Fremgangsmade til fremstilling af gammapyron-forbindelser | |
| DK577977A (da) | Fremgangsmaade til fremstilling af alfa-l-aspartyl-l-phenylalanin-methyler | |
| DK185577A (da) | Fremgangsmade til fremstilling af heterocycliske forbindelser | |
| DK53780A (da) | Fremgangsmaade til fremstilling af cephalosporinderivater | |
| DK271977A (da) | Fremgangsmade til fremstilling af dispeptidderivater | |
| DK118177A (da) | Fremgangsmade til fremstilling af isobutyramidderivater | |
| DK46577A (da) | Fremgangsmade til fremstilling af tetrahydroechinocandinderivater | |
| DK144377A (da) | Fremgangsmade til fremstilling af acylcyanider | |
| DK88777A (da) | Fremgangsmade til fremstilling af substituerede azapuriner | |
| DK528777A (da) | Fremgangsmaade til fremstilling af cephalosporinderivater | |
| DK271377A (da) | Fremgangsmade til fremstilling af substituerede arylacetamidocephalosporiner | |
| DK406579A (da) | Fremgangsmaade til fremstilling af cephalosporinderivater | |
| DK551577A (da) | Fremgangsmaade til fremstilling af nitrogenholdige heterocycliske forbindelser | |
| DK575277A (da) | Fremgangsmaade til fremstilling af basisk substituerede 0-propyloximer | |
| DK264377A (da) | Fremgangsmade til fremstilling af 1alfa-hydroxycholesterol-derivater | |
| DK285177A (da) | Kemiske mellemprodukter til fremstilling af cephalosporinderivater | |
| DK155008C (da) | Fremgangsmaade til fremstilling af 3-methylencepham-forbindelser | |
| DK123177A (da) | Fremgangsmade til fremstilling af 7-alkoxy-3-chlormethyl-3-cephem-forbindelser | |
| DK17477A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| DK145579A (da) | Fremgangsmaade til fremstilling af cephalosporinderivater |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AHS | Application shelved for other reasons than non-payment |