DK138539B - Fremgangsmåde til fremstilling af quinoxalin-1,4-dioxider. - Google Patents
Fremgangsmåde til fremstilling af quinoxalin-1,4-dioxider.Info
- Publication number
- DK138539B DK138539B DK452575AA DK452575A DK138539B DK 138539 B DK138539 B DK 138539B DK 452575A A DK452575A A DK 452575AA DK 452575 A DK452575 A DK 452575A DK 138539 B DK138539 B DK 138539B
- Authority
- DK
- Denmark
- Prior art keywords
- dioxides
- quinoxaline
- preparation
- Prior art date
Links
- CKIHZSGJPSDCNC-UHFFFAOYSA-N Quindoxin Chemical class C1=CC=C2N([O-])C=C[N+](=O)C2=C1 CKIHZSGJPSDCNC-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/50—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to ring nitrogen atoms
- C07D241/52—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/12—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/514,451 US3947438A (en) | 1974-10-15 | 1974-10-15 | Decarbonylation of quinoxalines |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK452575A DK452575A (es) | 1976-04-16 |
| DK138539B true DK138539B (da) | 1978-09-25 |
| DK138539C DK138539C (es) | 1979-02-26 |
Family
ID=24047201
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK452575AA DK138539B (da) | 1974-10-15 | 1975-10-08 | Fremgangsmåde til fremstilling af quinoxalin-1,4-dioxider. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3947438A (es) |
| JP (1) | JPS5341674B2 (es) |
| BE (1) | BE834294A (es) |
| CA (1) | CA1034951A (es) |
| DE (1) | DE2541427A1 (es) |
| DK (1) | DK138539B (es) |
| ES (1) | ES441597A1 (es) |
| FR (1) | FR2287906A1 (es) |
| GB (1) | GB1469190A (es) |
| IE (1) | IE41602B1 (es) |
| IT (1) | IT1057910B (es) |
| LU (1) | LU73555A1 (es) |
| NL (1) | NL158492B (es) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3493572A (en) * | 1968-07-05 | 1970-02-03 | Pfizer & Co C | Process for producing quinoxaline-di-n-oxides |
-
1974
- 1974-10-15 US US05/514,451 patent/US3947438A/en not_active Expired - Lifetime
-
1975
- 1975-08-18 IE IE1823/75A patent/IE41602B1/en unknown
- 1975-09-01 GB GB3599675A patent/GB1469190A/en not_active Expired
- 1975-09-17 DE DE19752541427 patent/DE2541427A1/de active Pending
- 1975-09-23 CA CA236,182A patent/CA1034951A/en not_active Expired
- 1975-10-06 NL NL7511718.A patent/NL158492B/xx unknown
- 1975-10-07 IT IT51678/75A patent/IT1057910B/it active
- 1975-10-08 DK DK452575AA patent/DK138539B/da unknown
- 1975-10-08 FR FR7530774A patent/FR2287906A1/fr active Granted
- 1975-10-08 ES ES441597A patent/ES441597A1/es not_active Expired
- 1975-10-08 BE BE1006936A patent/BE834294A/xx unknown
- 1975-10-09 JP JP12237175A patent/JPS5341674B2/ja not_active Expired
- 1975-10-09 LU LU73555A patent/LU73555A1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES441597A1 (es) | 1977-03-01 |
| DK138539C (es) | 1979-02-26 |
| NL158492B (nl) | 1978-11-15 |
| US3947438A (en) | 1976-03-30 |
| NL7511718A (nl) | 1976-04-21 |
| JPS5341674B2 (es) | 1978-11-06 |
| FR2287906A1 (fr) | 1976-05-14 |
| LU73555A1 (es) | 1976-08-19 |
| GB1469190A (en) | 1977-03-30 |
| IE41602L (en) | 1976-04-15 |
| BE834294A (fr) | 1976-04-08 |
| FR2287906B1 (es) | 1978-11-10 |
| IT1057910B (it) | 1982-03-30 |
| DK452575A (es) | 1976-04-16 |
| CA1034951A (en) | 1978-07-18 |
| IE41602B1 (en) | 1980-02-13 |
| JPS5165779A (es) | 1976-06-07 |
| DE2541427A1 (de) | 1976-04-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK136718B (da) | Analogifremgangsmåde til fremstilling af substituerede hexahydro-dibenzo(b,d)-pyran-9-oner. | |
| DK136719B (da) | Analogifremgangsmåde til fremstilling af substituerede hexahydro-dibenzo(b,d)-pyraner. | |
| DK136075B (da) | Analogifremgangsmåde til fremstilling af 11beta-hydroxy-16-methyl-3-oxo-17alfa-acyloxyandrosta-1,4,15-trien-17beta-carboxylater. | |
| DK135711B (da) | Analogifremgangsmåde til fremstilling af hidtil ukendte, hjerteaktive substituerede fenoxyisopropanolaminer. | |
| DK139678B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetramethyl-4-oxopiperidin. | |
| DK134031B (da) | Fremgangsmåde til fremstilling af et endo-beta-glucanase-præparat. | |
| DK138321B (da) | Analogifremgangsmåde til fremstilling af 5-halogen-2,3-kresotinsyrederivater. | |
| DK140406B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetramethyl-4-oxopiperidin. | |
| DK135768B (da) | Fremgangsmåde til fremstilling af 1-alkyl-3,5-diphenylpyrazoler. | |
| DK137389B (da) | Analogifremgangsmåde til fremstilling af 11beta-substituerede delta4-østrener. | |
| DK137639B (da) | Analogifremgangsmåde til fremstilling af 1-aminomethyl-2,2-diaryl-cyclopropancarboxamider. | |
| DK138389B (da) | Analogifremgangsmåde til fremstilling af quinoxalin-1,4-dioxydderivater. | |
| DK135723B (da) | Analogifremgangsmåde til fremstilling af 7alfa-acylthio-3-oxo-D-homo-21,24-dinor-17aalfa-chlo-4-en-23,17a-lactoner. | |
| DK132328B (da) | Analogifremgangsmåde til fremstilling af 17beta-hydroxy-16,16-dimethylestr-4-en-3-on. | |
| DK137449B (da) | Fremgangsmåde til fremstilling af N,N-diallyldichloracetamid. | |
| DK138694B (da) | Fremgangsmåde til fremstilling af phenylphosphonothiodichlorid. | |
| DK136619B (da) | Fremgangsmåde til fremstilling af dihydrokanadensolid. | |
| DK130987B (da) | Analogifremgangsmåde til fremstilling af 15alfa,16alfa-methylen-4-androsten-3-oner. | |
| DK140480B (da) | Analogifremgangsmåde til fremstilling af 2,8-substituerede D-6-alkylergoliner. | |
| DK137646B (da) | Fremgangsmåde til fremstilling af 6-chlor-2-chlormethyl-4-phenylquinazolin-3-oxid. | |
| DK137928B (da) | Fremgangsmåde til fremstilling af 5alfa-hydroxygona-9,11-diener. | |
| DK138539B (da) | Fremgangsmåde til fremstilling af quinoxalin-1,4-dioxider. | |
| DK136776B (da) | Analogifremgangsmåde til fremstilling af 17aalfa-alkanoyloxy-D-homopregn-4-en-3,20-dioner. | |
| DK132032B (da) | Analogifremgangsmåde til fremstilling af 15alfa,16alfa-methylen-4-pregnener. | |
| DK135133B (da) | Fremgangsmåde til fremstilling af 21-fluor-16alfa,17alfa-alkylidendioxy-20-oxo-steroider. |