DK138229B - Fremgangsmåde til fremstilling af (+)(-)-eburnamonin. - Google Patents
Fremgangsmåde til fremstilling af (+)(-)-eburnamonin.Info
- Publication number
- DK138229B DK138229B DK2572AA DK2572A DK138229B DK 138229 B DK138229 B DK 138229B DK 2572A A DK2572A A DK 2572AA DK 2572 A DK2572 A DK 2572A DK 138229 B DK138229 B DK 138229B
- Authority
- DK
- Denmark
- Prior art keywords
- eburnamonine
- preparation
- Prior art date
Links
- WYJAPUKIYAZSEM-MOPGFXCFSA-N Eburnamonine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)CC(=O)N5C2=C1 WYJAPUKIYAZSEM-MOPGFXCFSA-N 0.000 title 1
- WYJAPUKIYAZSEM-UHFFFAOYSA-N rac-Eburnamonin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(=O)N5C2=C1 WYJAPUKIYAZSEM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D461/00—Heterocyclic compounds containing indolo [3,2,1-d,e] pyrido [3,2,1,j] [1,5]-naphthyridine ring systems, e.g. vincamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Glass Compositions (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK517273A DK138228B (da) | 1971-01-06 | 1973-09-21 | Indoloqvinolizylideneddikesyrealkylester til anvendelse som mellemproudkt ved (+)(-)-eburnamonin samt fremgangsmåde til fremstilling af alklesteren. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7100204A FR2121360B1 (enExample) | 1971-01-06 | 1971-01-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK138229B true DK138229B (da) | 1978-07-31 |
| DK138229C DK138229C (enExample) | 1979-01-15 |
Family
ID=9069855
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK2572AA DK138229B (da) | 1971-01-06 | 1972-01-04 | Fremgangsmåde til fremstilling af (+)(-)-eburnamonin. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3753995A (enExample) |
| JP (1) | JPS506480B1 (enExample) |
| BE (1) | BE776337A (enExample) |
| CA (1) | CA937571A (enExample) |
| CH (1) | CH550187A (enExample) |
| DK (1) | DK138229B (enExample) |
| FR (1) | FR2121360B1 (enExample) |
| GB (1) | GB1350553A (enExample) |
| HU (1) | HU164117B (enExample) |
| NL (1) | NL175179C (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2179620B1 (enExample) * | 1972-04-14 | 1975-12-26 | Roussel Uclaf | |
| GB1435573A (en) * | 1973-05-25 | 1976-05-12 | Wyeth John & Brother Ltd | Indoloquinolizines |
| US4123535A (en) * | 1974-09-06 | 1978-10-31 | Sandoz Ltd. | Psychostimulating 14-amino-14,15-dihydroeburnamenines |
| HU171663B (hu) * | 1975-09-01 | 1978-02-28 | Richter Gedeon Vegyeszet | Sposob poluchenija novykh proizvodnykh 14-skobka-zamehhennogo metil-skobka zakryta-vinkana |
| US4315011A (en) * | 1978-07-12 | 1982-02-09 | Richter Gedeon Vegyeszeti Gyar Rt. | 1-Alkyl-9-bromohexahydroindolo quinolizium salts and use thereof to increase blood flow |
| IT1132307B (it) * | 1980-08-04 | 1986-07-02 | Mora Paolo Corvi | Procedimento per la sintesi di vincamina ed alcaloidi indolici correlati |
| HU191403B (en) * | 1984-04-02 | 1987-02-27 | Richter Gedeon Vegyeszeti Gyar Rt,Hu | Process for preparing new, raceme and optically active 14-hydroxyimino-eburnane |
| US4735943A (en) * | 1984-06-29 | 1988-04-05 | Sanwa Kagaku Kenkyusho Co., Ltd. | Eburnamonine oxime derivatives, salts thereof, and pharmaceutical agents containing the same |
-
1971
- 1971-01-06 FR FR7100204A patent/FR2121360B1/fr not_active Expired
- 1971-12-06 CH CH1772971A patent/CH550187A/fr not_active IP Right Cessation
- 1971-12-07 BE BE776337A patent/BE776337A/xx not_active IP Right Cessation
- 1971-12-23 JP JP46104214A patent/JPS506480B1/ja active Pending
- 1971-12-28 US US00213215A patent/US3753995A/en not_active Expired - Lifetime
- 1971-12-29 HU HURO637A patent/HU164117B/hu not_active IP Right Cessation
-
1972
- 1972-01-04 DK DK2572AA patent/DK138229B/da not_active IP Right Cessation
- 1972-01-05 CA CA131767A patent/CA937571A/en not_active Expired
- 1972-01-05 NL NLAANVRAGE7200093,A patent/NL175179C/xx not_active IP Right Cessation
- 1972-01-06 GB GB69372A patent/GB1350553A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL175179C (nl) | 1984-10-01 |
| BE776337A (fr) | 1972-06-07 |
| DE2200259A1 (de) | 1972-07-20 |
| GB1350553A (en) | 1974-04-18 |
| US3753995A (en) | 1973-08-21 |
| CA937571A (en) | 1973-11-27 |
| NL175179B (nl) | 1984-05-01 |
| CH550187A (fr) | 1974-06-14 |
| HU164117B (enExample) | 1973-12-28 |
| DE2200259B2 (de) | 1976-08-26 |
| JPS506480B1 (enExample) | 1975-03-14 |
| FR2121360A1 (enExample) | 1972-08-25 |
| DK138229C (enExample) | 1979-01-15 |
| NL7200093A (enExample) | 1972-07-10 |
| FR2121360B1 (enExample) | 1974-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138419B (da) | Fremgangsmåde til fremstilling af 1alfa-hydroxycholecalciferol. | |
| DK133751B (da) | Analogifremgangsmåde til fremstilling af benzopyraner. | |
| DK134316B (da) | Fremgangsmåde til fremstilling af methylsubstituerede cuinoner. | |
| DK131760B (da) | Fremgangsmåde til fremstilling af et insulinsalt-protaminkomplex. | |
| DK131873B (da) | Fremgangsmåde til fremstilling af pullulan. | |
| DK133828B (da) | Fremgangsmåde til fremstilling af zeaxanthin. | |
| DK136981B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede benzylphthalazon-derivater. | |
| DK129987B (da) | Analogifremgangsmåde til fremstilling af guanidiner. | |
| DK129339B (da) | Analogifremgangsmåde til fremstilling af N-aminophenylamidiner. | |
| DK135799B (da) | Fremgangsmåde til fremstilling af ethambutol. | |
| DK127119B (da) | Analogifremgangsmåde til fremstilling af 6-amino-9-benzylpurin-forbindelser. | |
| DK133470B (da) | Fremgangsmåde til fremstilling af 3alfa-hydroxy-5alfa-steroider. | |
| DK130212B (da) | Analogifremgangsmåde til fremstilling af 7-aminoindazolderivater. | |
| DK138229B (da) | Fremgangsmåde til fremstilling af (+)(-)-eburnamonin. | |
| DK134489B (da) | Fremgangsmåde til fremstilling af alkyl-7-desoxy-7(S)-substituerede-alfa-thiolincosaminider. | |
| DK129794B (da) | Analogifremgangsmåde til fremstilling af N-acyl-3-(piperazinoethyl)-pyrazoler. | |
| DK133464B (da) | Analogifremgangsmåde til fremstilling af nitrosourinstofderivater. | |
| DK127977B (da) | Fremgangsmåde til fremstilling af 6α-methyl-19-nor-pregnener. | |
| DK126780B (da) | Fremgangsmåde til fremstilling af flavon-7-oxyacetater. | |
| DK130987B (da) | Analogifremgangsmåde til fremstilling af 15alfa,16alfa-methylen-4-androsten-3-oner. | |
| DK129453B (da) | Analogifremgangsmåde til fremstilling af 1-aminoisoquinoliner. | |
| DK133902B (da) | Fremgangsmåde til fremstilling af Cephalosporin C. | |
| DK128205B (da) | Fremgangsmåde til fremstilling af 1-aryloxy-2-propanoler. | |
| DK139871B (da) | Analogifremgangsmåde til fremstilling af 3-isonicotinoyl-benzofuranderivater. | |
| DK132397B (da) | Fremgangsmåde til fremstilling af gødningsvirksomme citratopløselige alkaliglødephosphater. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |