DK137799B - Analogifremgangsmåde til fremstilling af 2-amino-3,5-dinitrothiophenforbindelser. - Google Patents
Analogifremgangsmåde til fremstilling af 2-amino-3,5-dinitrothiophenforbindelser.Info
- Publication number
- DK137799B DK137799B DK477173AA DK477173A DK137799B DK 137799 B DK137799 B DK 137799B DK 477173A A DK477173A A DK 477173AA DK 477173 A DK477173 A DK 477173A DK 137799 B DK137799 B DK 137799B
- Authority
- DK
- Denmark
- Prior art keywords
- dinitrothiophene
- amino
- compounds
- preparation
- analogous process
- Prior art date
Links
- DZRZHFOFVWAKGT-UHFFFAOYSA-N 3,5-dinitrothiophen-2-amine Chemical class NC=1SC([N+]([O-])=O)=CC=1[N+]([O-])=O DZRZHFOFVWAKGT-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/42—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms with nitro or nitroso radicals directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/42—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms with nitro or nitroso radicals directly attached to ring carbon atoms
- C07D333/44—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms with nitro or nitroso radicals directly attached to ring carbon atoms attached in position 5
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1283972A CH576464A5 (cg-RX-API-DMAC10.html) | 1972-08-31 | 1972-08-31 | |
| CH309873A CH590264A5 (cg-RX-API-DMAC10.html) | 1972-08-31 | 1973-03-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK137799B true DK137799B (da) | 1978-05-08 |
| DK137799C DK137799C (cg-RX-API-DMAC10.html) | 1978-10-09 |
Family
ID=25692170
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK477173AA DK137799B (da) | 1972-08-31 | 1973-08-30 | Analogifremgangsmåde til fremstilling af 2-amino-3,5-dinitrothiophenforbindelser. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3880849A (cg-RX-API-DMAC10.html) |
| AT (1) | AT333268B (cg-RX-API-DMAC10.html) |
| AU (1) | AU473025B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE804197A (cg-RX-API-DMAC10.html) |
| CA (1) | CA979456A (cg-RX-API-DMAC10.html) |
| CH (4) | CH586697A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2342931A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK137799B (cg-RX-API-DMAC10.html) |
| EG (1) | EG11398A (cg-RX-API-DMAC10.html) |
| FR (1) | FR2199465B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1439485A (cg-RX-API-DMAC10.html) |
| HU (1) | HU168401B (cg-RX-API-DMAC10.html) |
| IL (1) | IL42903A (cg-RX-API-DMAC10.html) |
| KE (1) | KE2726A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7311957A (cg-RX-API-DMAC10.html) |
| OA (1) | OA04672A (cg-RX-API-DMAC10.html) |
| PH (1) | PH10875A (cg-RX-API-DMAC10.html) |
| SE (1) | SE402590B (cg-RX-API-DMAC10.html) |
-
1972
- 1972-08-31 CH CH51576A patent/CH586697A5/xx not_active IP Right Cessation
- 1972-08-31 CH CH1283972A patent/CH576464A5/xx not_active IP Right Cessation
-
1973
- 1973-03-02 CH CH309873A patent/CH590264A5/xx not_active IP Right Cessation
- 1973-08-03 IL IL42903A patent/IL42903A/en unknown
- 1973-08-03 AU AU58890/73A patent/AU473025B2/en not_active Expired
- 1973-08-18 EG EG311/73A patent/EG11398A/xx active
- 1973-08-22 US US390627A patent/US3880849A/en not_active Expired - Lifetime
- 1973-08-22 CA CA179,377A patent/CA979456A/en not_active Expired
- 1973-08-24 DE DE19732342931 patent/DE2342931A1/de active Pending
- 1973-08-27 PH PH14969A patent/PH10875A/en unknown
- 1973-08-28 FR FR7331043A patent/FR2199465B1/fr not_active Expired
- 1973-08-29 SE SE7311761A patent/SE402590B/xx unknown
- 1973-08-30 BE BE135088A patent/BE804197A/xx unknown
- 1973-08-30 GB GB4085073A patent/GB1439485A/en not_active Expired
- 1973-08-30 NL NL7311957A patent/NL7311957A/xx not_active Application Discontinuation
- 1973-08-30 DK DK477173AA patent/DK137799B/da unknown
- 1973-08-30 OA OA54999A patent/OA04672A/xx unknown
- 1973-08-30 AT AT752873A patent/AT333268B/de not_active IP Right Cessation
- 1973-08-31 HU HUHO1607A patent/HU168401B/hu unknown
-
1977
- 1977-04-19 KE KE2726A patent/KE2726A/xx unknown
- 1977-04-29 CH CH536577A patent/CH597221A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH576464A5 (cg-RX-API-DMAC10.html) | 1976-06-15 |
| IL42903A (en) | 1976-11-30 |
| CH597221A5 (cg-RX-API-DMAC10.html) | 1978-03-31 |
| CH590264A5 (cg-RX-API-DMAC10.html) | 1977-07-29 |
| US3880849A (en) | 1975-04-29 |
| NL7311957A (cg-RX-API-DMAC10.html) | 1974-03-04 |
| PH10875A (en) | 1977-09-26 |
| DE2342931A1 (de) | 1974-03-14 |
| ATA752873A (de) | 1976-03-15 |
| BE804197A (fr) | 1974-02-28 |
| AU5889073A (en) | 1975-02-06 |
| OA04672A (fr) | 1980-07-31 |
| FR2199465B1 (cg-RX-API-DMAC10.html) | 1976-09-03 |
| CH586697A5 (cg-RX-API-DMAC10.html) | 1977-04-15 |
| KE2726A (en) | 1977-07-15 |
| AU473025B2 (en) | 1976-06-10 |
| GB1439485A (en) | 1976-06-16 |
| DK137799C (cg-RX-API-DMAC10.html) | 1978-10-09 |
| IL42903A0 (en) | 1973-11-28 |
| CA979456A (en) | 1975-12-09 |
| AT333268B (de) | 1976-11-10 |
| FR2199465A1 (cg-RX-API-DMAC10.html) | 1974-04-12 |
| HU168401B (cg-RX-API-DMAC10.html) | 1976-04-28 |
| SE402590B (sv) | 1978-07-10 |
| EG11398A (en) | 1977-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK136718B (da) | Analogifremgangsmåde til fremstilling af substituerede hexahydro-dibenzo(b,d)-pyran-9-oner. | |
| DK136719B (da) | Analogifremgangsmåde til fremstilling af substituerede hexahydro-dibenzo(b,d)-pyraner. | |
| DK134490B (da) | Analogifremgangsmåde til fremstilling af 2,6-diaminonebularin-derivater. | |
| DK132500B (da) | Analogifremgangsmåde til fremstilling af 2beta, 16beta-diamino-5alfa-androstaner. | |
| DK134604B (da) | Fremgangsmåde til fremstilling af indenyl-3-acetoglucuronider. | |
| DK137639B (da) | Analogifremgangsmåde til fremstilling af 1-aminomethyl-2,2-diaryl-cyclopropancarboxamider. | |
| DK131942B (da) | Fremgangsmåde til fremstilling af delta4,16-11beta-hydroxy-3,20-diketopregnadiener. | |
| DK135723B (da) | Analogifremgangsmåde til fremstilling af 7alfa-acylthio-3-oxo-D-homo-21,24-dinor-17aalfa-chlo-4-en-23,17a-lactoner. | |
| DK130994B (da) | Analogifremgangsmåde til fremstilling af 21-(beta-benzoylaminoisobutyryl)-16alfa,17alfa-(p-dimethylaminobenzyliden)-triamcinolon. | |
| DK132328B (da) | Analogifremgangsmåde til fremstilling af 17beta-hydroxy-16,16-dimethylestr-4-en-3-on. | |
| DK138645B (da) | Analogifremgangsmåde til fremstilling af sulfamoylfenyl-imidazolidiner. | |
| DK131575B (da) | Analogifremgangsmåde til fremstilling af 2beta-hydroxy-3alfa-aminosteroider. | |
| DK131855B (da) | Fremgangsmåde til fremstilling af 3,4-dihydropyridoner. | |
| DK132410B (da) | Analogifremgangsmåde til fremstilling af 2-amino-4H-pyraner. | |
| DK129657B (da) | Analogifremgangsmåde til fremstilling af 3-methylpyrazol-5-carboxamider. | |
| DK135166B (da) | Analogifremgangsmåde til fremstilling af 2-methyl-5-nitro-imidazoler. | |
| DK130987B (da) | Analogifremgangsmåde til fremstilling af 15alfa,16alfa-methylen-4-androsten-3-oner. | |
| DK132032B (da) | Analogifremgangsmåde til fremstilling af 15alfa,16alfa-methylen-4-pregnener. | |
| DK137928B (da) | Fremgangsmåde til fremstilling af 5alfa-hydroxygona-9,11-diener. | |
| DK132329B (da) | Fremgangsmåde til fremstilling af cardenolid-3,alfa-/2'-desoxy-glycosider/. | |
| DK134236B (da) | Analogifremgangsmåde til fremstilling af 3-cycloalkoxy-16alfa-cyanopregn-5-en-20-oner. | |
| DK139225B (da) | Fremgangsmåde til fremstilling af morphanthridiner. | |
| DK139677B (da) | Fremgangsmåde til fremstilling af 7-benzoylindolin-2-oner. | |
| DK131037B (da) | Analogifremgangsmåde til fremstilling af 15alfa,16alfa-methylen-4-østren-17beta-oler. | |
| DK135133B (da) | Fremgangsmåde til fremstilling af 21-fluor-16alfa,17alfa-alkylidendioxy-20-oxo-steroider. |