DK137680B - Fremgangsmåde til fremstilling af deacetoxycephalosporinderivater. - Google Patents
Fremgangsmåde til fremstilling af deacetoxycephalosporinderivater.Info
- Publication number
- DK137680B DK137680B DK368172A DK368172A DK137680B DK 137680 B DK137680 B DK 137680B DK 368172 A DK368172 A DK 368172A DK 368172 A DK368172 A DK 368172A DK 137680 B DK137680 B DK 137680B
- Authority
- DK
- Denmark
- Prior art keywords
- deacetoxycephalosporin
- derivatives
- preparation
- deacetoxycephalosporin derivatives
- Prior art date
Links
- NNQIJOYQWYKBOW-UHFFFAOYSA-N desacetoxycephalosphorin G Natural products S1CC(C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 NNQIJOYQWYKBOW-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5551271A JPS5127680B1 (show.php) | 1971-07-25 | 1971-07-25 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK137680B true DK137680B (da) | 1978-04-17 |
| DK137680C DK137680C (show.php) | 1978-09-25 |
Family
ID=13000726
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK368172A DK137680B (da) | 1971-07-25 | 1972-07-25 | Fremgangsmåde til fremstilling af deacetoxycephalosporinderivater. |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5127680B1 (show.php) |
| AT (1) | AT314084B (show.php) |
| CH (1) | CH565185A5 (show.php) |
| DK (1) | DK137680B (show.php) |
| ES (1) | ES405129A1 (show.php) |
| NL (1) | NL7210259A (show.php) |
| SE (1) | SE395458B (show.php) |
-
1971
- 1971-07-25 JP JP5551271A patent/JPS5127680B1/ja active Pending
-
1972
- 1972-07-24 ES ES405129A patent/ES405129A1/es not_active Expired
- 1972-07-24 CH CH1100472A patent/CH565185A5/de not_active IP Right Cessation
- 1972-07-25 NL NL7210259A patent/NL7210259A/xx not_active Application Discontinuation
- 1972-07-25 DK DK368172A patent/DK137680B/da unknown
- 1972-07-25 SE SE973772A patent/SE395458B/xx unknown
- 1972-07-25 AT AT639272A patent/AT314084B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK137680C (show.php) | 1978-09-25 |
| NL7210259A (show.php) | 1973-01-29 |
| CH565185A5 (en) | 1975-08-15 |
| AT314084B (de) | 1974-03-25 |
| ES405129A1 (es) | 1975-07-16 |
| JPS5127680B1 (show.php) | 1976-08-13 |
| SE395458B (sv) | 1977-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138419B (da) | Fremgangsmåde til fremstilling af 1alfa-hydroxycholecalciferol. | |
| DK134316B (da) | Fremgangsmåde til fremstilling af methylsubstituerede cuinoner. | |
| DK133672B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater. | |
| DK128854B (da) | Analogifremgangsmåde til fremstilling af adenosinderivater. | |
| DK131760B (da) | Fremgangsmåde til fremstilling af et insulinsalt-protaminkomplex. | |
| DK131867B (da) | Analogifremgangsmåde til fremstilling af adenosinderivater. | |
| DK136981B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede benzylphthalazon-derivater. | |
| DK128537B (da) | Fremgangsmåde til fremstilling af chromanderivater. | |
| DK136215B (da) | Analogifremgangsmåde til fremstilling af kinolinderivater. | |
| DK127119B (da) | Analogifremgangsmåde til fremstilling af 6-amino-9-benzylpurin-forbindelser. | |
| DK133470B (da) | Fremgangsmåde til fremstilling af 3alfa-hydroxy-5alfa-steroider. | |
| DK130212B (da) | Analogifremgangsmåde til fremstilling af 7-aminoindazolderivater. | |
| DK140596B (da) | Analogifremgangsmåde til fremstilling af 8beta-(ureidomethyl)-ergolenderivater. | |
| DK140411B (da) | Fremgangsmåde til fremstilling af deacetoxycephalosporin C. | |
| DK129706B (da) | Analogifremgangsmåde til fremstilling af kromonderivater. | |
| FI51359C (fi) | Menetelmä digoksiinin alfa-asyylijohdannaisten valmistamiseksi. | |
| DK131864B (da) | Fremgangsmåde til fremstilling af pregnan-21-syrederivater. | |
| DK133464B (da) | Analogifremgangsmåde til fremstilling af nitrosourinstofderivater. | |
| DK127297B (da) | Analogifremgangsmåde til fremstilling af heterocyclisk substituerede nebularinderivater. | |
| DK130957B (da) | Fremgangsmåde til fremstilling af pregnanderivater. | |
| DK129794B (da) | Analogifremgangsmåde til fremstilling af N-acyl-3-(piperazinoethyl)-pyrazoler. | |
| DK131383B (da) | Fremgangsmåde til fremstilling af L-tryptofan. | |
| DK133902B (da) | Fremgangsmåde til fremstilling af Cephalosporin C. | |
| DK137192B (da) | Analogifremgangsmåde til fremstilling af cephalosporansyrederivater. | |
| DK126780B (da) | Fremgangsmåde til fremstilling af flavon-7-oxyacetater. |