DK135945B - Fremgangsmåde til fremstilling af 2,4-diamino-5-(3',4',5'-trimetoxybenzyl)-pyrimidin. - Google Patents
Fremgangsmåde til fremstilling af 2,4-diamino-5-(3',4',5'-trimetoxybenzyl)-pyrimidin.Info
- Publication number
- DK135945B DK135945B DK495873A DK495873A DK135945B DK 135945 B DK135945 B DK 135945B DK 495873 A DK495873 A DK 495873A DK 495873 A DK495873 A DK 495873A DK 135945 B DK135945 B DK 135945B
- Authority
- DK
- Denmark
- Prior art keywords
- trimethoxybenzyl
- diamino
- pyrimidine
- preparation
- Prior art date
Links
- IEDVJHCEMCRBQM-UHFFFAOYSA-N trimethoprim Chemical compound COC1=C(OC)C(OC)=CC(CC=2C(=NC(N)=NC=2)N)=C1 IEDVJHCEMCRBQM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
- C07D239/49—Two nitrogen atoms with an aralkyl radical, or substituted aralkyl radical, attached in position 5, e.g. trimethoprim
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK495873A DK135945B (da) | 1973-09-10 | 1973-09-10 | Fremgangsmåde til fremstilling af 2,4-diamino-5-(3',4',5'-trimetoxybenzyl)-pyrimidin. |
| GB3898274A GB1445254A (en) | 1973-09-10 | 1974-09-06 | Method for the production of 2,4-diamino-5-3,4,5-trimethoxy benzyl-pyrimidine |
| AT724274A AT340934B (de) | 1973-09-10 | 1974-09-09 | Verfahren zur herstellung von 2,4-diamino-5- (3',4',5'-trimethoxybenzyl) -pyrimidin |
| CA208,719A CA1016943A (en) | 1973-09-10 | 1974-09-09 | Method for the production of 2,4-diamino-5-(3',4',5'-trimethoxybenzyl)-pyrimidine |
| JP10307874A JPS5315518B2 (cg-RX-API-DMAC7.html) | 1973-09-10 | 1974-09-09 | |
| DE19742443080 DE2443080C3 (de) | 1973-09-10 | 1974-09-09 | Verfahren zur Herstellung von ' 2,4-Diamino-5-(3',4'3'-triinethoxybenzyl)-pyrhnidin |
| NL7411931A NL160553C (nl) | 1973-09-10 | 1974-09-09 | Werkwijze voor het bereiden van 2,4-diamino 5-(3',4',5'-trimethoxybenzyl)pyrimidine. |
| CH1224974A CH599943A5 (cg-RX-API-DMAC7.html) | 1973-09-10 | 1974-09-09 | |
| KE280577A KE2805A (en) | 1973-09-10 | 1977-11-29 | Method for the production of 2,4-diamino-5-(3',4',5'-trimethoxybenzyl)-pyrimidine |
| HK12578A HK12578A (en) | 1973-09-10 | 1978-03-02 | Method for the production of 2,4-diamino-5-(3',4',5'-trimethoxybenzyl)-pyrimidine |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK495873A DK135945B (da) | 1973-09-10 | 1973-09-10 | Fremgangsmåde til fremstilling af 2,4-diamino-5-(3',4',5'-trimetoxybenzyl)-pyrimidin. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK495873A DK495873A (cg-RX-API-DMAC7.html) | 1975-05-12 |
| DK135945B true DK135945B (da) | 1977-07-18 |
| DK135945C DK135945C (cg-RX-API-DMAC7.html) | 1979-09-17 |
Family
ID=8138184
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK495873A DK135945B (da) | 1973-09-10 | 1973-09-10 | Fremgangsmåde til fremstilling af 2,4-diamino-5-(3',4',5'-trimetoxybenzyl)-pyrimidin. |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS5315518B2 (cg-RX-API-DMAC7.html) |
| AT (1) | AT340934B (cg-RX-API-DMAC7.html) |
| CA (1) | CA1016943A (cg-RX-API-DMAC7.html) |
| CH (1) | CH599943A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2443080C3 (cg-RX-API-DMAC7.html) |
| DK (1) | DK135945B (cg-RX-API-DMAC7.html) |
| GB (1) | GB1445254A (cg-RX-API-DMAC7.html) |
| HK (1) | HK12578A (cg-RX-API-DMAC7.html) |
| KE (1) | KE2805A (cg-RX-API-DMAC7.html) |
| NL (1) | NL160553C (cg-RX-API-DMAC7.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60189686U (ja) * | 1984-05-28 | 1985-12-16 | 井上エムテ−ピ−株式会社 | ク−ルエア−インテ−クホ−ス |
-
1973
- 1973-09-10 DK DK495873A patent/DK135945B/da not_active IP Right Cessation
-
1974
- 1974-09-06 GB GB3898274A patent/GB1445254A/en not_active Expired
- 1974-09-09 NL NL7411931A patent/NL160553C/xx not_active IP Right Cessation
- 1974-09-09 JP JP10307874A patent/JPS5315518B2/ja not_active Expired
- 1974-09-09 DE DE19742443080 patent/DE2443080C3/de not_active Expired
- 1974-09-09 CH CH1224974A patent/CH599943A5/xx not_active IP Right Cessation
- 1974-09-09 CA CA208,719A patent/CA1016943A/en not_active Expired
- 1974-09-09 AT AT724274A patent/AT340934B/de not_active IP Right Cessation
-
1977
- 1977-11-29 KE KE280577A patent/KE2805A/xx unknown
-
1978
- 1978-03-02 HK HK12578A patent/HK12578A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA1016943A (en) | 1977-09-06 |
| KE2805A (en) | 1978-01-06 |
| CH599943A5 (cg-RX-API-DMAC7.html) | 1978-06-15 |
| NL160553B (nl) | 1979-06-15 |
| DK135945C (cg-RX-API-DMAC7.html) | 1979-09-17 |
| JPS50116483A (cg-RX-API-DMAC7.html) | 1975-09-11 |
| ATA724274A (de) | 1977-05-15 |
| DK495873A (cg-RX-API-DMAC7.html) | 1975-05-12 |
| AT340934B (de) | 1978-01-10 |
| JPS5315518B2 (cg-RX-API-DMAC7.html) | 1978-05-25 |
| HK12578A (en) | 1978-03-10 |
| NL7411931A (nl) | 1975-03-12 |
| DE2443080C3 (de) | 1979-12-20 |
| GB1445254A (en) | 1976-08-11 |
| DE2443080A1 (de) | 1975-03-20 |
| NL160553C (nl) | 1979-11-15 |
| DE2443080B2 (de) | 1977-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138798B (da) | Fremgangsmåde til fremstilling af optisk aktive 1,4-benzodiazepin-2-on-derivater. | |
| DK138791B (da) | Analogifremgangsmåde til fremstilling af 2,6-disubstituerede fenylaminoguanidinforbindelser. | |
| DK139678B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetramethyl-4-oxopiperidin. | |
| DK133673B (da) | Fremgangsmåde til fremstilling af 3,4-dihydro-2(1H)-quinazolinonderivater. | |
| DK140406B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetramethyl-4-oxopiperidin. | |
| DK137752B (da) | Fremgangsmåde til fremstilling af N-arylsulfonyl-N'-(3-azabicycloalkyl)-urinstoffer. | |
| DK137381B (da) | Analogifremgangsmåde til fremstilling af N,N'-disubstituerede amidiner. | |
| DK135945B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-5-(3',4',5'-trimetoxybenzyl)-pyrimidin. | |
| DK120706B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-5-(3',4',5'-trimethoxybenzyl)-pyrimidin. | |
| DK135375B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-6-hydroxy-5-(3',4',5'-trimetoxybenzyl)-pyrimidin. | |
| DK131466B (da) | Analogifremgangsmåde til fremstilling af 2,4-diamino-5-(3,4,5-triethoxybenzyl)-pyrimidin eller salte heraf. | |
| DK127421B (da) | Fremgangsmåde til fremstilling af cardenolid-3[2',3'-didesoxyglycosider]. | |
| DK129996B (da) | Fremgangsmåde til fremstilling af 3,4-dihydro-2(1H)-quinazolinonderivater. | |
| DK138895B (da) | Fremgangsmåde til fremstilling af 8-beta-(2'-pyrimidino-aminometyl)-ergolinderivater. | |
| DK136726B (da) | Fremgangsmåde til fremstilling af phthalimido- eller cyclohexen-1,2-dicarboximido-thionophosphater. | |
| DK134228B (da) | Fremgangsmåde til fremstilling af 4-phenyl-2(1H)-quinazolinonderivater. | |
| DK126653B (da) | Analogifremgangsmåde til fremstilling af 2,6-dimorpholino-8-alkanolamino-pyrimido[5,4-d]pyrimidiner. | |
| DK131781B (da) | Analogifremgangsmåde til fremstilling af N-oxider af 2,4-diamino-5-(3-methoxy-4,5-methylendioxybenzyl)-pyrimidin eller farmakologisk tålelige syreadditionssalte deraf. | |
| DK124683B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede derivater af 2,4-(1H,3H)-quinazolindioner. | |
| DK138119B (da) | Fremgangsmåde til fremstilling af 4-merkapto-1H-pyrazolo(3,4-d)pyrimidin. | |
| DK131938B (da) | Fremgangsmåde til fremstilling af 4-hydroxy-1H-pyrazolo/3,4-d/pyrimidin. | |
| DK128319B (da) | Fremgangsmåde til fremstilling af N,N'-dialkoxymethyl- eller N,N'-dibenzyloxymethyl-5,5-disubstituerede barbitursyrederivater. | |
| DK134401B (da) | Fremgangsmåde til fremstilling af 1,4-disubstituerede 2(1H)quinazolinonderivater. | |
| AT349023B (de) | Verfahren zur herstellung von 2,6-bis (diaethanolamin)-4,8-dipiperidin-pyrimid- (5,4-d)-pyrimidin | |
| DK133102C (da) | Analogifremgangsmade til fremstilling af 6-(5-nitrofuryl-2)-2,4-diaminopyrimidiner |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |