DK133375B - Analogifremgangsmåde til fremstilling af 1-carbamoyl-3-phenylpyrrolidiner. - Google Patents
Analogifremgangsmåde til fremstilling af 1-carbamoyl-3-phenylpyrrolidiner.Info
- Publication number
- DK133375B DK133375B DK181570AA DK181570A DK133375B DK 133375 B DK133375 B DK 133375B DK 181570A A DK181570A A DK 181570AA DK 181570 A DK181570 A DK 181570A DK 133375 B DK133375 B DK 133375B
- Authority
- DK
- Denmark
- Prior art keywords
- phenylpyrrolidines
- carbamoyl
- preparation
- analogous process
- analogous
- Prior art date
Links
- FICMSFWWLMBEST-UHFFFAOYSA-N 3-phenylpyrrolidine-1-carboxamide Chemical class C1N(C(=O)N)CCC1C1=CC=CC=C1 FICMSFWWLMBEST-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/06—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with radicals, containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/20—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81549669A | 1969-04-11 | 1969-04-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK133375B true DK133375B (da) | 1976-05-10 |
| DK133375C DK133375C (cg-RX-API-DMAC7.html) | 1976-10-04 |
Family
ID=25217975
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK181570AA DK133375B (da) | 1969-04-11 | 1970-04-10 | Analogifremgangsmåde til fremstilling af 1-carbamoyl-3-phenylpyrrolidiner. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3644398A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS4830055B1 (cg-RX-API-DMAC7.html) |
| AT (1) | AT293419B (cg-RX-API-DMAC7.html) |
| BE (1) | BE748393A (cg-RX-API-DMAC7.html) |
| CH (1) | CH550787A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2017256A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK133375B (cg-RX-API-DMAC7.html) |
| ES (1) | ES378316A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2042323B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1304392A (cg-RX-API-DMAC7.html) |
| NL (1) | NL7004609A (cg-RX-API-DMAC7.html) |
| NO (1) | NO133494C (cg-RX-API-DMAC7.html) |
| SE (1) | SE348194B (cg-RX-API-DMAC7.html) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2541855A1 (de) * | 1975-09-18 | 1977-03-31 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii |
| US4374991A (en) | 1976-12-17 | 1983-02-22 | Rohm And Haas Company | 2,6-Dimethylpiperidinyl-N-carbobutoxymethyl urea |
| US4357471A (en) | 1976-12-17 | 1982-11-02 | Rohm And Haas Company | Azaspiro compounds |
| US4400512A (en) * | 1976-12-17 | 1983-08-23 | Rohm And Haas Company | Azaspiro compounds |
| US4241071A (en) * | 1977-01-27 | 1980-12-23 | American Hoechst Corporation | Antidepressant (α-phenyl-2-tolyl)azacycloalkanes |
| US4405630A (en) * | 1980-12-29 | 1983-09-20 | Rohm And Haas Company | Arthropod repellent compositions and methods |
| DE3328643A1 (de) * | 1983-08-09 | 1985-02-21 | Gödecke AG, 1000 Berlin | 3-aryl-3-pyrrolin-derivate, verfahren zu deren herstellung sowie deren verwendung bei der bekaempfung von herz- und gefaesskrankheiten |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| CA2143143A1 (en) * | 1994-03-08 | 1995-09-09 | Toshihiko Tanaka | 3-phenylpyrrolidine derivatives |
-
1969
- 1969-04-11 US US815496A patent/US3644398A/en not_active Expired - Lifetime
-
1970
- 1970-02-20 CH CH250370A patent/CH550787A/xx not_active IP Right Cessation
- 1970-04-01 NL NL7004609A patent/NL7004609A/xx unknown
- 1970-04-02 BE BE748393D patent/BE748393A/xx unknown
- 1970-04-07 ES ES378316A patent/ES378316A1/es not_active Expired
- 1970-04-07 GB GB1641370A patent/GB1304392A/en not_active Expired
- 1970-04-09 SE SE04845/70A patent/SE348194B/xx unknown
- 1970-04-10 FR FR707013079A patent/FR2042323B1/fr not_active Expired
- 1970-04-10 NO NO1332/70A patent/NO133494C/no unknown
- 1970-04-10 AT AT329870A patent/AT293419B/de not_active IP Right Cessation
- 1970-04-10 DE DE19702017256 patent/DE2017256A1/de active Pending
- 1970-04-10 DK DK181570AA patent/DK133375B/da unknown
- 1970-04-11 JP JP45030700A patent/JPS4830055B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| ES378316A1 (es) | 1972-06-01 |
| DE2017256A1 (de) | 1970-10-08 |
| GB1304392A (cg-RX-API-DMAC7.html) | 1973-01-24 |
| NO133494C (cg-RX-API-DMAC7.html) | 1976-05-12 |
| DK133375C (cg-RX-API-DMAC7.html) | 1976-10-04 |
| US3644398A (en) | 1972-02-22 |
| JPS4830055B1 (cg-RX-API-DMAC7.html) | 1973-09-17 |
| NL7004609A (cg-RX-API-DMAC7.html) | 1970-10-13 |
| AT293419B (de) | 1971-10-11 |
| NO133494B (cg-RX-API-DMAC7.html) | 1976-02-02 |
| FR2042323B1 (cg-RX-API-DMAC7.html) | 1973-04-06 |
| CH550787A (de) | 1974-06-28 |
| FR2042323A1 (cg-RX-API-DMAC7.html) | 1971-02-12 |
| SE348194B (cg-RX-API-DMAC7.html) | 1972-08-28 |
| BE748393A (fr) | 1970-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK130306B (da) | Analogifremgangsmåde til fremstilling af S-trialkylphosphinguld-1-thio-β-D-glucopyranosider. | |
| DK136314B (da) | Analogifremgangsmåde til fremstilling af benzamidoethylpiperaziner. | |
| DK140697B (da) | Fremgangsmåde til fremstilling af 2-amino-4-hydroxy-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin. | |
| DK124195B (da) | Fremgangsmåde til fremstilling af cis-chrysantheminsyrer. | |
| DK133375B (da) | Analogifremgangsmåde til fremstilling af 1-carbamoyl-3-phenylpyrrolidiner. | |
| DK125089B (da) | Analogifremgangsmåde til fremstilling af evomonosidderivater. | |
| DK126944B (da) | Analogifremgangsmåde til fremstilling af hexahydrobenzindolderivater. | |
| DK128006B (da) | Analogifremgangsmåde til fremstilling af 11-desacetoxy-wortmannin. | |
| DK128778B (da) | Analogifremgangsmåde til fremstilling af bis-2-carboxy-chromonylderivater. | |
| DK131863B (da) | Analogifremgangsmåde til fremstilling af thiazolino- eller thiazidino-pyrimidinderivater. | |
| DK140010B (da) | Fremgangsmåde til fremstilling af peptider. | |
| DK123237B (da) | Analogifremgangsmåde til fremstilling af erythromycinasparter. | |
| DK128737B (da) | Analogifremgangsmåde til fremstilling af 6α-methyl-17α-caproyloxy-19-norprogesteron. | |
| DK123096B (da) | Analogifremgangsmåde til fremstilling af neriifolinderivater. | |
| DK125241B (da) | Analogifremgangsmåde til fremstilling af substituerede o-anilinophenethylalkoholer. | |
| DK125199B (da) | Analogifremgangsmåde til fremstilling af benzamidiner. | |
| DK123816B (da) | Analogifremgangsmåde til fremstilling af N-phenacylcarbamater. | |
| DK122127B (da) | Analogifremgangsmåde til fremstilling af 3-phenyl-4-acyloxycarbostyriler. | |
| DK122456B (da) | Fremgangsmåde til fremstilling af quinoxalin-di-N-oxid-aldehyd. | |
| DK124686B (da) | Analogifremgangsmåde til fremstilling af bis-thiachromonylforbindelser. | |
| DK126184B (da) | Fremgangsmåde til fremstilling af peptider. | |
| DK132026B (da) | Fremgangsmåde til fremstilling af 6-aminoacylamidopenicillansyrer. | |
| DK135798B (da) | Analogifremgangsmåde til fremstilling af isobutyl-cyclohexenyl-derivater. | |
| DK126991B (da) | Analogifremgangsmåde til fremstilling af 1-phenoxy-3-amino-2-propanolderivater. | |
| DK125918B (da) | Fremgangsmåde til fremstilling af alkyl-7-0-methyl-l-thio-lincosaminider. |