DK128928B - Analogifremgangsmåde til fremstilling af rifamycinderivater. - Google Patents
Analogifremgangsmåde til fremstilling af rifamycinderivater.Info
- Publication number
- DK128928B DK128928B DK643471AA DK643471A DK128928B DK 128928 B DK128928 B DK 128928B DK 643471A A DK643471A A DK 643471AA DK 643471 A DK643471 A DK 643471A DK 128928 B DK128928 B DK 128928B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- analogous process
- rifamycin derivatives
- rifamycin
- derivatives
- Prior art date
Links
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical class OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1946071 | 1971-01-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK128928B true DK128928B (da) | 1974-07-29 |
| DK128928C DK128928C (xx) | 1975-01-13 |
Family
ID=11158197
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK643471AA DK128928B (da) | 1971-01-18 | 1971-12-30 | Analogifremgangsmåde til fremstilling af rifamycinderivater. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3821199A (xx) |
| JP (1) | JPS554112B1 (xx) |
| AT (1) | AT309688B (xx) |
| BE (1) | BE778190A (xx) |
| CA (1) | CA926392A (xx) |
| CH (1) | CH546790A (xx) |
| DE (1) | DE2200931A1 (xx) |
| DK (1) | DK128928B (xx) |
| ES (1) | ES398973A1 (xx) |
| FR (1) | FR2122497B1 (xx) |
| GB (1) | GB1316689A (xx) |
| HU (1) | HU163576B (xx) |
| IL (1) | IL38385A (xx) |
| NL (1) | NL174145C (xx) |
| NO (1) | NO133103C (xx) |
| SE (1) | SE367828B (xx) |
| SU (1) | SU434657A3 (xx) |
| ZA (1) | ZA718439B (xx) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3880839A (en) * | 1973-12-21 | 1975-04-29 | Schering Corp | Process for the preparation of rifamycin 5 and analogs thereof from the halomicins |
| IT1048565B (it) * | 1975-05-15 | 1980-12-20 | Archifar Ind Chim Trentino | Amine aromatiche |
-
1971
- 1971-12-15 GB GB5832971A patent/GB1316689A/en not_active Expired
- 1971-12-16 IL IL38385A patent/IL38385A/xx unknown
- 1971-12-17 ZA ZA718439A patent/ZA718439B/xx unknown
- 1971-12-23 NO NO4813/71A patent/NO133103C/no unknown
- 1971-12-30 DK DK643471AA patent/DK128928B/da not_active IP Right Cessation
-
1972
- 1972-01-10 DE DE19722200931 patent/DE2200931A1/de active Pending
- 1972-01-12 SE SE00336/72A patent/SE367828B/xx unknown
- 1972-01-12 JP JP578372A patent/JPS554112B1/ja active Pending
- 1972-01-14 US US00217955A patent/US3821199A/en not_active Expired - Lifetime
- 1972-01-14 AT AT32472A patent/AT309688B/de active
- 1972-01-14 NL NLAANVRAGE7200574,A patent/NL174145C/xx not_active IP Right Cessation
- 1972-01-17 SU SU1734538A patent/SU434657A3/ru active
- 1972-01-17 HU HULE635A patent/HU163576B/hu unknown
- 1972-01-17 CA CA132602A patent/CA926392A/en not_active Expired
- 1972-01-17 CH CH62172A patent/CH546790A/fr not_active IP Right Cessation
- 1972-01-18 BE BE778190A patent/BE778190A/xx not_active IP Right Cessation
- 1972-01-18 ES ES398973A patent/ES398973A1/es not_active Expired
- 1972-01-18 FR FR7201594A patent/FR2122497B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL174145B (nl) | 1983-12-01 |
| FR2122497B1 (xx) | 1975-04-25 |
| DE2200931A1 (de) | 1972-08-03 |
| SE367828B (xx) | 1974-06-10 |
| ES398973A1 (es) | 1974-10-16 |
| JPS554112B1 (xx) | 1980-01-29 |
| AU3798672A (en) | 1973-07-19 |
| GB1316689A (en) | 1973-05-09 |
| CH546790A (fr) | 1974-03-15 |
| FR2122497A1 (xx) | 1972-09-01 |
| NO133103C (xx) | 1976-03-10 |
| NL174145C (nl) | 1984-05-01 |
| CA926392A (en) | 1973-05-15 |
| HU163576B (xx) | 1973-09-27 |
| IL38385A0 (en) | 1972-02-29 |
| IL38385A (en) | 1975-05-22 |
| SU434657A3 (ru) | 1974-06-30 |
| NO133103B (xx) | 1975-12-01 |
| US3821199A (en) | 1974-06-28 |
| BE778190A (fr) | 1972-05-16 |
| AT309688B (de) | 1973-08-27 |
| DK128928C (xx) | 1975-01-13 |
| NL7200574A (xx) | 1972-07-20 |
| ZA718439B (en) | 1972-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138419B (da) | Fremgangsmåde til fremstilling af 1alfa-hydroxycholecalciferol. | |
| DK137329B (da) | Analogifremgangsmåde til fremstilling af 2-karbalkoksyaminobenzimidazolderivater. | |
| DK133672B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater. | |
| DK134345B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater. | |
| DK128854B (da) | Analogifremgangsmåde til fremstilling af adenosinderivater. | |
| DK131760B (da) | Fremgangsmåde til fremstilling af et insulinsalt-protaminkomplex. | |
| DK131867B (da) | Analogifremgangsmåde til fremstilling af adenosinderivater. | |
| DK136981B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede benzylphthalazon-derivater. | |
| DK128537B (da) | Fremgangsmåde til fremstilling af chromanderivater. | |
| DK136215B (da) | Analogifremgangsmåde til fremstilling af kinolinderivater. | |
| DK127119B (da) | Analogifremgangsmåde til fremstilling af 6-amino-9-benzylpurin-forbindelser. | |
| DK130212B (da) | Analogifremgangsmåde til fremstilling af 7-aminoindazolderivater. | |
| DK138796B (da) | Analogifremgangsmåde til fremstilling af 2-carboxypyrazin-4-oxidderivater. | |
| DK133470B (da) | Fremgangsmåde til fremstilling af 3alfa-hydroxy-5alfa-steroider. | |
| DK129706B (da) | Analogifremgangsmåde til fremstilling af kromonderivater. | |
| DK135122B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-5-aminoalkyl-4-oxazolin-2-onderivater. | |
| DK139716B (da) | Analogifremgangsmåde til fremstilling af 4-aminoamfetaminderivater. | |
| DK133464B (da) | Analogifremgangsmåde til fremstilling af nitrosourinstofderivater. | |
| DK127297B (da) | Analogifremgangsmåde til fremstilling af heterocyclisk substituerede nebularinderivater. | |
| DK130957B (da) | Fremgangsmåde til fremstilling af pregnanderivater. | |
| DK131383B (da) | Fremgangsmåde til fremstilling af L-tryptofan. | |
| DK133902B (da) | Fremgangsmåde til fremstilling af Cephalosporin C. | |
| DK129794B (da) | Analogifremgangsmåde til fremstilling af N-acyl-3-(piperazinoethyl)-pyrazoler. | |
| DK126780B (da) | Fremgangsmåde til fremstilling af flavon-7-oxyacetater. | |
| DK139871B (da) | Analogifremgangsmåde til fremstilling af 3-isonicotinoyl-benzofuranderivater. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |