DK124552B - Fremgangsmåde til fremstilling af α-aminobenzylpenicillin. - Google Patents
Fremgangsmåde til fremstilling af α-aminobenzylpenicillin.Info
- Publication number
- DK124552B DK124552B DK572870AA DK572870A DK124552B DK 124552 B DK124552 B DK 124552B DK 572870A A DK572870A A DK 572870AA DK 572870 A DK572870 A DK 572870A DK 124552 B DK124552 B DK 124552B
- Authority
- DK
- Denmark
- Prior art keywords
- aminobenzylpenicillin
- preparation
- Prior art date
Links
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US87611169A | 1969-11-12 | 1969-11-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK124552B true DK124552B (da) | 1972-10-30 |
Family
ID=25367017
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK572870AA DK124552B (da) | 1969-11-12 | 1970-11-11 | Fremgangsmåde til fremstilling af α-aminobenzylpenicillin. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3649625A (enExample) |
| JP (1) | JPS5010318B1 (enExample) |
| BR (1) | BR6915341D0 (enExample) |
| CH (1) | CH517117A (enExample) |
| CS (1) | CS149936B2 (enExample) |
| DE (1) | DE2054786A1 (enExample) |
| DK (1) | DK124552B (enExample) |
| ES (1) | ES385425A1 (enExample) |
| FR (1) | FR2073346B1 (enExample) |
| GB (1) | GB1321629A (enExample) |
| IE (1) | IE34691B1 (enExample) |
| NL (1) | NL7016359A (enExample) |
| SE (1) | SE360871B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57125371U (enExample) * | 1981-01-28 | 1982-08-04 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL6810240A (enExample) * | 1967-07-20 | 1969-01-22 |
-
1969
- 1969-11-12 US US876111A patent/US3649625A/en not_active Expired - Lifetime
- 1969-12-19 BR BR215341/69A patent/BR6915341D0/pt unknown
- 1969-12-25 JP JP45002093A patent/JPS5010318B1/ja active Pending
-
1970
- 1970-11-02 IE IE1395/70A patent/IE34691B1/xx unknown
- 1970-11-06 DE DE19702054786 patent/DE2054786A1/de active Pending
- 1970-11-06 CH CH1650970A patent/CH517117A/fr not_active IP Right Cessation
- 1970-11-06 GB GB5293570A patent/GB1321629A/en not_active Expired
- 1970-11-09 CS CS7522A patent/CS149936B2/cs unknown
- 1970-11-09 NL NL7016359A patent/NL7016359A/xx unknown
- 1970-11-10 SE SE15161/70A patent/SE360871B/xx unknown
- 1970-11-11 ES ES385425A patent/ES385425A1/es not_active Expired
- 1970-11-11 DK DK572870AA patent/DK124552B/da unknown
- 1970-11-13 FR FR7040875A patent/FR2073346B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IE34691B1 (en) | 1975-07-23 |
| SE360871B (enExample) | 1973-10-08 |
| FR2073346B1 (enExample) | 1975-04-18 |
| ES385425A1 (es) | 1973-04-16 |
| CS149936B2 (enExample) | 1973-08-23 |
| CH517117A (fr) | 1971-12-31 |
| JPS5010318B1 (enExample) | 1975-04-19 |
| FR2073346A1 (enExample) | 1971-10-01 |
| US3649625A (en) | 1972-03-14 |
| NL7016359A (enExample) | 1971-05-14 |
| IE34691L (en) | 1971-05-12 |
| DE2054786A1 (de) | 1971-05-19 |
| BR6915341D0 (pt) | 1973-03-13 |
| GB1321629A (en) | 1973-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK130306B (da) | Analogifremgangsmåde til fremstilling af S-trialkylphosphinguld-1-thio-β-D-glucopyranosider. | |
| DK136314B (da) | Analogifremgangsmåde til fremstilling af benzamidoethylpiperaziner. | |
| DK140697B (da) | Fremgangsmåde til fremstilling af 2-amino-4-hydroxy-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin. | |
| DK124195B (da) | Fremgangsmåde til fremstilling af cis-chrysantheminsyrer. | |
| DK133375B (da) | Analogifremgangsmåde til fremstilling af 1-carbamoyl-3-phenylpyrrolidiner. | |
| DK126944B (da) | Analogifremgangsmåde til fremstilling af hexahydrobenzindolderivater. | |
| DK125089B (da) | Analogifremgangsmåde til fremstilling af evomonosidderivater. | |
| DK128006B (da) | Analogifremgangsmåde til fremstilling af 11-desacetoxy-wortmannin. | |
| DK128778B (da) | Analogifremgangsmåde til fremstilling af bis-2-carboxy-chromonylderivater. | |
| DK131863B (da) | Analogifremgangsmåde til fremstilling af thiazolino- eller thiazidino-pyrimidinderivater. | |
| DK140010B (da) | Fremgangsmåde til fremstilling af peptider. | |
| DK128737B (da) | Analogifremgangsmåde til fremstilling af 6α-methyl-17α-caproyloxy-19-norprogesteron. | |
| DK123096B (da) | Analogifremgangsmåde til fremstilling af neriifolinderivater. | |
| DK125241B (da) | Analogifremgangsmåde til fremstilling af substituerede o-anilinophenethylalkoholer. | |
| DK122456B (da) | Fremgangsmåde til fremstilling af quinoxalin-di-N-oxid-aldehyd. | |
| DK123816B (da) | Analogifremgangsmåde til fremstilling af N-phenacylcarbamater. | |
| DK122127B (da) | Analogifremgangsmåde til fremstilling af 3-phenyl-4-acyloxycarbostyriler. | |
| DK124686B (da) | Analogifremgangsmåde til fremstilling af bis-thiachromonylforbindelser. | |
| DK132026B (da) | Fremgangsmåde til fremstilling af 6-aminoacylamidopenicillansyrer. | |
| DK126184B (da) | Fremgangsmåde til fremstilling af peptider. | |
| DK126991B (da) | Analogifremgangsmåde til fremstilling af 1-phenoxy-3-amino-2-propanolderivater. | |
| DK139097B (da) | Analogifremgangsmåde til fremstilling af isobutyl-cyclohexenyl-derivater. | |
| DK125918B (da) | Fremgangsmåde til fremstilling af alkyl-7-0-methyl-l-thio-lincosaminider. | |
| DK122958B (da) | Fremgangsmåde til fremstilling af 4-alkoxypiperidiner. | |
| DK127474B (da) | Fremgangsmåde til fremstilling af steroid-spirocyclobutanoner. |