DK124205B - Analogifremgangsmåde til fremstilling af 6-klor-4-metylamino-1H-2,3-benzoxazin. - Google Patents
Analogifremgangsmåde til fremstilling af 6-klor-4-metylamino-1H-2,3-benzoxazin.Info
- Publication number
- DK124205B DK124205B DK456268AA DK456268A DK124205B DK 124205 B DK124205 B DK 124205B DK 456268A A DK456268A A DK 456268AA DK 456268 A DK456268 A DK 456268A DK 124205 B DK124205 B DK 124205B
- Authority
- DK
- Denmark
- Prior art keywords
- benzoxazine
- methylamino
- chloro
- preparation
- analogous process
- Prior art date
Links
- GUXQXIRGDSFDLP-UHFFFAOYSA-N 6-chloro-n-methyl-1h-2,3-benzoxazin-4-amine Chemical compound C1=C(Cl)C=C2C(NC)=NOCC2=C1 GUXQXIRGDSFDLP-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/02—1,2-Oxazines; Hydrogenated 1,2-oxazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4362167 | 1967-09-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK124205B true DK124205B (da) | 1972-09-25 |
Family
ID=10429582
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK456268AA DK124205B (da) | 1967-09-25 | 1968-09-23 | Analogifremgangsmåde til fremstilling af 6-klor-4-metylamino-1H-2,3-benzoxazin. |
| DK453470AA DK124889B (da) | 1967-09-25 | 1970-09-03 | Analogifremgangsmåde til fremstilling af 1H-2,3-benzoxaziner. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK453470AA DK124889B (da) | 1967-09-25 | 1970-09-03 | Analogifremgangsmåde til fremstilling af 1H-2,3-benzoxaziner. |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS4946630B1 (enExample) |
| AT (1) | AT278841B (enExample) |
| BE (1) | BE721356A (enExample) |
| CA (1) | CA929522A (enExample) |
| CH (1) | CH481934A (enExample) |
| DE (1) | DE1795384C3 (enExample) |
| DK (2) | DK124205B (enExample) |
| ES (1) | ES358442A1 (enExample) |
| FI (1) | FI48842C (enExample) |
| FR (2) | FR1598168A (enExample) |
| GB (1) | GB1225612A (enExample) |
| IL (1) | IL30757A (enExample) |
| LU (1) | LU56962A1 (enExample) |
| NL (1) | NL6813657A (enExample) |
| NO (1) | NO128572B (enExample) |
| SE (2) | SE332988B (enExample) |
| YU (1) | YU31966B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4005082A (en) * | 1967-09-25 | 1977-01-25 | Gruppo Lepetit S.P.A. | 1H-2,3-Benzoxazines |
| FR2068436A6 (en) * | 1969-11-18 | 1971-08-27 | Lepetit Spa | 1h-2,3-benzoxazine derivs, nerve drugs and - anti-inflammatory agents |
| ZA738362B (en) * | 1972-12-22 | 1974-09-25 | Lepetit Spa | New 3,5-disubstituted triazole active on the c.n.s. |
-
1967
- 1967-09-25 GB GB4362167A patent/GB1225612A/en not_active Expired
-
1968
- 1968-09-18 FI FI682624A patent/FI48842C/fi active
- 1968-09-18 AT AT910868A patent/AT278841B/de not_active IP Right Cessation
- 1968-09-22 IL IL30757A patent/IL30757A/xx unknown
- 1968-09-23 DK DK456268AA patent/DK124205B/da unknown
- 1968-09-24 SE SE12868/68A patent/SE332988B/xx unknown
- 1968-09-24 DE DE1795384A patent/DE1795384C3/de not_active Expired
- 1968-09-24 ES ES358442A patent/ES358442A1/es not_active Expired
- 1968-09-24 NO NO03766/68A patent/NO128572B/no unknown
- 1968-09-24 NL NL6813657A patent/NL6813657A/xx unknown
- 1968-09-25 CA CA030877A patent/CA929522A/en not_active Expired
- 1968-09-25 YU YU2244/68A patent/YU31966B/xx unknown
- 1968-09-25 FR FR1598168D patent/FR1598168A/fr not_active Expired
- 1968-09-25 LU LU56962D patent/LU56962A1/xx unknown
- 1968-09-25 FR FR167488A patent/FR7757M/fr not_active Expired
- 1968-09-25 CH CH1430868A patent/CH481934A/fr not_active IP Right Cessation
- 1968-09-25 BE BE721356D patent/BE721356A/xx unknown
-
1970
- 1970-09-03 DK DK453470AA patent/DK124889B/da unknown
- 1970-10-29 SE SE14604/70A patent/SE351218B/xx unknown
-
1971
- 1971-02-10 JP JP46005918A patent/JPS4946630B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| NO128572B (enExample) | 1973-12-10 |
| GB1225612A (enExample) | 1971-03-17 |
| IL30757A (en) | 1973-05-31 |
| FI48842C (fi) | 1975-01-10 |
| FI48842B (enExample) | 1974-09-30 |
| YU31966B (en) | 1974-02-28 |
| YU224468A (en) | 1973-08-31 |
| NL6813657A (enExample) | 1969-03-27 |
| SE351218B (enExample) | 1972-11-20 |
| FR1598168A (enExample) | 1970-07-06 |
| IL30757A0 (en) | 1970-03-22 |
| ES358442A1 (es) | 1970-06-16 |
| JPS4946630B1 (enExample) | 1974-12-11 |
| AT278841B (de) | 1970-02-10 |
| SE332988B (enExample) | 1971-03-01 |
| CH481934A (fr) | 1969-11-30 |
| DE1795384C3 (de) | 1975-07-17 |
| DE1795384B2 (de) | 1974-10-03 |
| FR7757M (enExample) | 1970-03-16 |
| LU56962A1 (enExample) | 1969-02-05 |
| DE1795384A1 (de) | 1972-03-09 |
| BE721356A (enExample) | 1969-03-03 |
| DK124889B (da) | 1972-12-04 |
| CA929522A (en) | 1973-07-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137232B (da) | Analogifremgangsmåde til fremstilling af phenylethanolaminer. | |
| DK122222B (da) | Fremgangsmåde til fremstilling af alk-3-en-1-oler. | |
| DK120698B (da) | Analogifremgangsmåde til fremstilling af acetylguanidiner. | |
| DK133783B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxy-1-thio-alfa-D-galacto-octopyranosider. | |
| DK124080B (da) | Fremgangsmåde til fremstilling af D-6-metyl-8-cyanmetylergolin. | |
| DK127065B (da) | Analogifremgangsmåde til fremstilling af 5-phenyl-7-triflourmethyl-1H-1,5-benzodiazepin-2,4-dioner. | |
| DK119307B (da) | Fremgangsmåde til fremstilling af ketonitriler. | |
| DK122758B (da) | Fremgangsmåde til fremstilling af α-methyl-multicyclo-methylaminer. | |
| DK122522B (da) | Fremgangsmåde til fremstilling af dichlorquinoliner. | |
| DK123100B (da) | Fremgangsmåde til fremstilling af N-tritylimidazoler. | |
| DK121759B (da) | Analogifremgangsmåde til fremstilling af 3-oxo-7α-methylgona-4,9-diener. | |
| DK128811B (da) | Analogifremgangsmåde til fremstilling af 14α,17α-methylendioxypregnanderivater. | |
| DK124205B (da) | Analogifremgangsmåde til fremstilling af 6-klor-4-metylamino-1H-2,3-benzoxazin. | |
| DK130307B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkyl-17β-hydroxy-17α-ethynylgona-4,9-diener. | |
| DK118291B (da) | Analogifremgangsmåde til fremstilling af 10α-alkoxy-9,10-dihydroergolinderivater. | |
| DK124882B (da) | Analogifremgangsmåde til fremstilling af 17α-acyloxy-11β-methyl-19-norpregn-4-en-3,20-dioner. | |
| DK119976B (da) | Analogifremgangsmåde til fremstilling af 18-methyl-19-nor-17α-hydroxyprogesteroner og -17-estere deraf. | |
| DK120994B (da) | Analogifremgangsmåde til fremstilling af N,N-dimethylaminoætyl-14β-hydroksy-5β-pregn-20-en-21-karboksylater. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK121372B (da) | Analogifremgangsmåde til fremstilling af 17β-(1-alkoxycycloalkyloxy)-2α,3α-epithio-5α-androstaner. | |
| DK117568B (da) | Analogifremgangsmåde til fremstilling af ftalazino-ftalazindioner. | |
| DK122666B (da) | Analogifremgangsmåde til fremstilling af hydrocortison-17-cyclopentancorboxylat. | |
| DK120948B (da) | Fremgangsmåde til fremstilling af (androst-17β-yl)-α-pyroner. | |
| DK125136B (da) | Analogifremgangsmåde til fremstilling af 1,3-benzoxazinderivater. | |
| DK118402B (da) | Analogifremgangsmåde til fremstilling af 11β-hydroxy-pregn-4-en-3,20-dion-[17α,16α-d]-oxazoliner. |